Spaces:
Runtime error
Runtime error
Create app.py
Browse files
app.py
ADDED
|
@@ -0,0 +1,173 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
from huggingface_hub import from_pretrained_keras
|
| 2 |
+
import gradio as gr
|
| 3 |
+
from rdkit import Chem, RDLogger
|
| 4 |
+
from rdkit.Chem.Draw import IPythonConsole, MolsToGridImage
|
| 5 |
+
import numpy as np
|
| 6 |
+
import tensorflow as tf
|
| 7 |
+
from tensorflow import keras
|
| 8 |
+
|
| 9 |
+
# Config
|
| 10 |
+
class Featurizer:
|
| 11 |
+
def __init__(self, allowable_sets):
|
| 12 |
+
self.dim = 0
|
| 13 |
+
self.features_mapping = {}
|
| 14 |
+
for k, s in allowable_sets.items():
|
| 15 |
+
s = sorted(list(s))
|
| 16 |
+
self.features_mapping[k] = dict(zip(s, range(self.dim, len(s) + self.dim)))
|
| 17 |
+
self.dim += len(s)
|
| 18 |
+
|
| 19 |
+
def encode(self, inputs):
|
| 20 |
+
output = np.zeros((self.dim,))
|
| 21 |
+
for name_feature, feature_mapping in self.features_mapping.items():
|
| 22 |
+
feature = getattr(self, name_feature)(inputs)
|
| 23 |
+
if feature not in feature_mapping:
|
| 24 |
+
continue
|
| 25 |
+
output[feature_mapping[feature]] = 1.0
|
| 26 |
+
return output
|
| 27 |
+
|
| 28 |
+
|
| 29 |
+
class AtomFeaturizer(Featurizer):
|
| 30 |
+
def __init__(self, allowable_sets):
|
| 31 |
+
super().__init__(allowable_sets)
|
| 32 |
+
|
| 33 |
+
def symbol(self, atom):
|
| 34 |
+
return atom.GetSymbol()
|
| 35 |
+
|
| 36 |
+
def n_valence(self, atom):
|
| 37 |
+
return atom.GetTotalValence()
|
| 38 |
+
|
| 39 |
+
def n_hydrogens(self, atom):
|
| 40 |
+
return atom.GetTotalNumHs()
|
| 41 |
+
|
| 42 |
+
def hybridization(self, atom):
|
| 43 |
+
return atom.GetHybridization().name.lower()
|
| 44 |
+
|
| 45 |
+
|
| 46 |
+
class BondFeaturizer(Featurizer):
|
| 47 |
+
def __init__(self, allowable_sets):
|
| 48 |
+
super().__init__(allowable_sets)
|
| 49 |
+
self.dim += 1
|
| 50 |
+
|
| 51 |
+
def encode(self, bond):
|
| 52 |
+
output = np.zeros((self.dim,))
|
| 53 |
+
if bond is None:
|
| 54 |
+
output[-1] = 1.0
|
| 55 |
+
return output
|
| 56 |
+
output = super().encode(bond)
|
| 57 |
+
return output
|
| 58 |
+
|
| 59 |
+
def bond_type(self, bond):
|
| 60 |
+
return bond.GetBondType().name.lower()
|
| 61 |
+
|
| 62 |
+
def conjugated(self, bond):
|
| 63 |
+
return bond.GetIsConjugated()
|
| 64 |
+
|
| 65 |
+
|
| 66 |
+
atom_featurizer = AtomFeaturizer(
|
| 67 |
+
allowable_sets={
|
| 68 |
+
"symbol": {"B", "Br", "C", "Ca", "Cl", "F", "H", "I", "N", "Na", "O", "P", "S"},
|
| 69 |
+
"n_valence": {0, 1, 2, 3, 4, 5, 6},
|
| 70 |
+
"n_hydrogens": {0, 1, 2, 3, 4},
|
| 71 |
+
"hybridization": {"s", "sp", "sp2", "sp3"},
|
| 72 |
+
}
|
| 73 |
+
)
|
| 74 |
+
|
| 75 |
+
bond_featurizer = BondFeaturizer(
|
| 76 |
+
allowable_sets={
|
| 77 |
+
"bond_type": {"single", "double", "triple", "aromatic"},
|
| 78 |
+
"conjugated": {True, False},
|
| 79 |
+
}
|
| 80 |
+
)
|
| 81 |
+
|
| 82 |
+
def molecule_from_smiles(smiles):
|
| 83 |
+
# MolFromSmiles(m, sanitize=True) should be equivalent to
|
| 84 |
+
# MolFromSmiles(m, sanitize=False) -> SanitizeMol(m) -> AssignStereochemistry(m, ...)
|
| 85 |
+
molecule = Chem.MolFromSmiles(smiles, sanitize=False)
|
| 86 |
+
|
| 87 |
+
# If sanitization is unsuccessful, catch the error, and try again without
|
| 88 |
+
# the sanitization step that caused the error
|
| 89 |
+
flag = Chem.SanitizeMol(molecule, catchErrors=True)
|
| 90 |
+
if flag != Chem.SanitizeFlags.SANITIZE_NONE:
|
| 91 |
+
Chem.SanitizeMol(molecule, sanitizeOps=Chem.SanitizeFlags.SANITIZE_ALL ^ flag)
|
| 92 |
+
|
| 93 |
+
Chem.AssignStereochemistry(molecule, cleanIt=True, force=True)
|
| 94 |
+
return molecule
|
| 95 |
+
|
| 96 |
+
|
| 97 |
+
def graph_from_molecule(molecule):
|
| 98 |
+
# Initialize graph
|
| 99 |
+
atom_features = []
|
| 100 |
+
bond_features = []
|
| 101 |
+
pair_indices = []
|
| 102 |
+
|
| 103 |
+
for atom in molecule.GetAtoms():
|
| 104 |
+
atom_features.append(atom_featurizer.encode(atom))
|
| 105 |
+
|
| 106 |
+
# Add self-loops
|
| 107 |
+
pair_indices.append([atom.GetIdx(), atom.GetIdx()])
|
| 108 |
+
bond_features.append(bond_featurizer.encode(None))
|
| 109 |
+
|
| 110 |
+
for neighbor in atom.GetNeighbors():
|
| 111 |
+
bond = molecule.GetBondBetweenAtoms(atom.GetIdx(), neighbor.GetIdx())
|
| 112 |
+
pair_indices.append([atom.GetIdx(), neighbor.GetIdx()])
|
| 113 |
+
bond_features.append(bond_featurizer.encode(bond))
|
| 114 |
+
|
| 115 |
+
return np.array(atom_features), np.array(bond_features), np.array(pair_indices)
|
| 116 |
+
|
| 117 |
+
|
| 118 |
+
def graphs_from_smiles(smiles_list):
|
| 119 |
+
# Initialize graphs
|
| 120 |
+
atom_features_list = []
|
| 121 |
+
bond_features_list = []
|
| 122 |
+
pair_indices_list = []
|
| 123 |
+
|
| 124 |
+
for smiles in smiles_list:
|
| 125 |
+
molecule = molecule_from_smiles(smiles)
|
| 126 |
+
atom_features, bond_features, pair_indices = graph_from_molecule(molecule)
|
| 127 |
+
|
| 128 |
+
atom_features_list.append(atom_features)
|
| 129 |
+
bond_features_list.append(bond_features)
|
| 130 |
+
pair_indices_list.append(pair_indices)
|
| 131 |
+
|
| 132 |
+
# Convert lists to ragged tensors for tf.data.Dataset later on
|
| 133 |
+
return (
|
| 134 |
+
tf.ragged.constant(atom_features_list, dtype=tf.float32),
|
| 135 |
+
tf.ragged.constant(bond_features_list, dtype=tf.float32),
|
| 136 |
+
tf.ragged.constant(pair_indices_list, dtype=tf.int64),
|
| 137 |
+
)
|
| 138 |
+
|
| 139 |
+
model = from_pretrained_keras("keras-io/wgan-molecular-graphs")
|
| 140 |
+
|
| 141 |
+
def predict(smiles, label):
|
| 142 |
+
molecules = [molecule_from_smiles(smiles)]
|
| 143 |
+
input = graphs_from_smiles([smiles])
|
| 144 |
+
label = pd.Series([label])
|
| 145 |
+
test_dataset = MPNNDataset(input, label)
|
| 146 |
+
y_pred = tf.squeeze(model.predict(test_dataset), axis=1)
|
| 147 |
+
legends = [f"y_true/y_pred = {label[i]}/{y_pred[i]:.2f}" for i in range(len(label))]
|
| 148 |
+
MolsToGridImage(molecules, molsPerRow=1, legends=legends, returnPNG=False, subImgSize=(550, 550)).save("img.png")
|
| 149 |
+
return 'img.png'
|
| 150 |
+
|
| 151 |
+
inputs = [
|
| 152 |
+
gr.Textbox(label='Smiles of molecular'),
|
| 153 |
+
gr.Textbox(label='Molecular permeability')
|
| 154 |
+
]
|
| 155 |
+
|
| 156 |
+
examples = [
|
| 157 |
+
["CO/N=C(C(=O)N[C@H]1[C@H]2SCC(=C(N2C1=O)C(O)=O)C)/c3csc(N)n3", 0],
|
| 158 |
+
["[C@H]37[C@H]2[C@@]([C@](C(COC(C1=CC(=CC=C1)[S](O)(=O)=O)=O)=O)(O)[C@@H](C2)C)(C[C@@H]([C@@H]3[C@@]4(C(=CC5=C(C4)C=N[N]5C6=CC=CC=C6)C(=C7)C)C)O)C", 1],
|
| 159 |
+
["CNCCCC2(C)C(=O)N(c1ccccc1)c3ccccc23", 1],
|
| 160 |
+
["O.N[C@@H](C(=O)NC1C2CCC(=C(N2C1=O)C(O)=O)Cl)c3ccccc3", 0],
|
| 161 |
+
["[C@@]4([C@@]3([C@H]([C@H]2[C@@H]([C@@]1(C(=CC(=O)CC1)CC2)C)[C@H](C3)O)CC4)C)(C(COC(C)=O)=O)OC(CC)=O", 1],
|
| 162 |
+
["[C@]34([C@H](C2[C@@](F)([C@@]1(C(=CC(=O)C=C1)[C@@H](F)C2)C)[C@@H](O)C3)C[C@H]5OC(O[C@@]45C(=O)COC(=O)C6CC6)(C)C)C", 1]
|
| 163 |
+
|
| 164 |
+
]
|
| 165 |
+
gr.Interface(
|
| 166 |
+
fn=predict,
|
| 167 |
+
title="Predict blood-brain barrier permeability of molecular",
|
| 168 |
+
description = "Message-passing neural network (MPNN) for molecular property prediction",
|
| 169 |
+
inputs=inputs,
|
| 170 |
+
examples=examples,
|
| 171 |
+
outputs="image",
|
| 172 |
+
article = "Author: <a href=\"https://huggingface.co/vumichien\">Vu Minh Chien</a>. Based on the keras example from <a href=\"https://keras.io/examples/graph/mpnn-molecular-graphs/\">Alexander Kensert</a>",
|
| 173 |
+
).launch(debug=True, enable_queue=True)
|