Preserve order of inputs, outputs, and params.

examples/AIMO.lynxkite.json

@@ -149,321 +149,6 @@
                   "Please give a correct solution for this: Let $ABCD$ be a unit square. Let $P$ be the point on $AB$ such that $|AP| = 1/{20}$ and let $Q$ be the point on $AD$ such that $|AQ| = 1/{24}$. The lines $DP$ and $BQ$ divide the square into four regions. Find the ratio between the areas of the largest region and the smallest region.",
                   "To solve the problem, we first establish the coordinates of the points in the unit square \\(ABCD\\). \n\nLet the square \\(ABCD\\) have the following coordinates:\n- \\(A(0, 1)\\)\n- \\(B(1, 1)\\)\n- \\(C(1, 0)\\)\n- \\(D(0, 0)\\)\n\nNext, we define point \\(P\\) on segment \\(AB\\) such that \\(AP = \\frac{1"
                 ],
-                [
-                  "d7e9c9",
-                  "A function $f: \\mathbb N \\to \\mathbb N$ satisfies the following two conditions for all positive integers $n$:$f(f(f(n)))=8n-7$ and $f(2n)=2f(n)+1$. Calculate $f(100)$.",
-                  199,
-                  "Please give a correct solution for this: A function $f: \\mathbb N \\to \\mathbb N$ satisfies the following two conditions for all positive integers $n$:$f(f(f(n)))=8n-7$ and $f(2n)=2f(n)+1$. Calculate $f(100)$.",
-                  "To find the function \\( f \\) satisfying the conditions \\( f(f(f(n))) = 8n - 7 \\) and \\( f(2n) = 2f(n) + 1 \\), let's start investigating each condition.\n\nFrom the first condition, we can substitute \\( n = 1 \\):\n\\[\nf(f(f(1))) = 8 \\cdot 1 - 7 = 1.\n\\]\nLet \\( a = f(1) \\)."
-                ],
-                [
-                  "246d26",
-                  "Each of the three-digits numbers $111$ to $999$ is coloured blue or yellow in such a way that the sum of any two (not necessarily different) yellow numbers is equal to a blue number. What is the maximum possible number of yellow numbers there can be?",
-                  250,
-                  "Please give a correct solution for this: Each of the three-digits numbers $111$ to $999$ is coloured blue or yellow in such a way that the sum of any two (not necessarily different) yellow numbers is equal to a blue number. What is the maximum possible number of yellow numbers there can be?",
-                  "To solve this problem, we start by letting \\( Y \\) denote the set of yellow numbers and \\( B \\) denote the set of blue numbers. The condition provided states that for any two yellow numbers \\( y_1, y_2 \\in Y \\), their sum \\( y_1 + y_2 \\) must equal some blue number \\( b \\in B \\). \n\nGiven that we are working with three-digit numbers, we note that any number \\( y \\) in \\("
-                ],
-                [
-                  "2fc4ad",
-                  "Let the `sparkle' operation on positive integer $n$ consist of calculating the sum of the digits of $n$ and taking its factorial, e.g. the sparkle of 13 is $4! = 24$. A robot starts with a positive integer on a blackboard, then after each second for the rest of eternity, replaces the number on the board with its sparkle. For some `special' numbers, if they're the first number, then eventually every number that appears will be less than 6. How many such special numbers are there with at most 36 digits?",
-                  702,
-                  "Please give a correct solution for this: Let the `sparkle' operation on positive integer $n$ consist of calculating the sum of the digits of $n$ and taking its factorial, e.g. the sparkle of 13 is $4! = 24$. A robot starts with a positive integer on a blackboard, then after each second for the rest of eternity, replaces the number on the board with its sparkle. For some `special' numbers, if they're the first number, then eventually every number that appears will be less than 6. How many such special numbers are there with at most 36 digits?",
-                  "To solve the problem, we first need to understand the sparkle operation performed on a positive integer \\( n \\). The sparkle of \\( n \\), denoted as \\( S(n) \\), is defined as the sum of its digits, denoted \\( s(n) \\), followed by taking the factorial of that sum, i.e., \n\n\\[\nS(n) = s(n)!\n\\]\n\nWe are tasked with finding \"special\" numbers \u2014 those numbers such that starting from them, all subsequent values"
-                ],
-                [
-                  "430b63",
-                  "What is the minimum value of $5x^2+5y^2-8xy$ when $x$ and $y$ range over all real numbers such that $|x-2y| + |y-2x| = 40$?",
-                  800,
-                  "Please give a correct solution for this: What is the minimum value of $5x^2+5y^2-8xy$ when $x$ and $y$ range over all real numbers such that $|x-2y| + |y-2x| = 40$?",
-                  "We need to minimize the expression \\( f(x, y) = 5x^2 + 5y^2 - 8xy \\) under the constraint given by the equation \\( |x - 2y| + |y - 2x| = 40 \\).\n\nFirst, we analyze the constraint \\( |x - 2y| + |y - 2x| = 40 \\). This absolute value constraint suggests there are multiple cases to consider. Let's define the"
-                ],
-                [
-                  "5277ed",
-                  "There exists a unique increasing geometric sequence of five 2-digit positive integers. What is their sum?",
-                  211,
-                  "Please give a correct solution for this: There exists a unique increasing geometric sequence of five 2-digit positive integers. What is their sum?",
-                  "To find a unique increasing geometric sequence of five 2-digit integers, we can denote the integers in the sequence as follows:\n\n\\[\na, ar, ar^2, ar^3, ar^4\n\\]\n\nwhere \\(a\\) is the first term and \\(r\\) is the common ratio.\n\nSince we want each term to be a two-digit integer, we have the following constraints:\n\n\\[\n10 \\leq a < 100\n\\]\n\\[\n10 \\le"
-                ],
-                [
-                  "739bc9",
-                  "For how many positive integers $m$ does the equation $\\vert \\vert x-1 \\vert -2 \\vert=\\frac{m}{100}$ have $4$ distinct solutions?",
-                  199,
-                  "Please give a correct solution for this: For how many positive integers $m$ does the equation $\\vert \\vert x-1 \\vert -2 \\vert=\\frac{m}{100}$ have $4$ distinct solutions?",
-                  "To solve the equation \\( \\vert \\vert x-1 \\vert -2 \\vert = \\frac{m}{100} \\) for the number of positive integers \\( m \\) that yield \\( 4 \\) distinct solutions, we first analyze the expression \\( \\vert \\vert x-1 \\vert -2 \\vert \\).\n\n1. **Break down the expression:**\n   Let \\( y = \\vert x - 1 \\vert \\). Then, we rewrite the equation as"
-                ],
-                [
-                  "82e2a0",
-                  "Suppose that we roll four 6-sided fair dice with faces numbered 1 to~6. Let $a/b$ be the probability that the highest roll is a 5, where $a$ and $b$ are relatively prime positive integers. Find $a + b$.",
-                  185,
-                  "Please give a correct solution for this: Suppose that we roll four 6-sided fair dice with faces numbered 1 to~6. Let $a/b$ be the probability that the highest roll is a 5, where $a$ and $b$ are relatively prime positive integers. Find $a + b$.",
-                  "Given that we want the probability that the highest roll of four 6-sided dice is exactly 5, we need to consider two things: that at least one die shows a 5 and no die shows a 6.\n\n### Step 1: Calculate the total number of outcomes when rolling four dice.\nEach die has 6 faces, so when we roll four dice, the total number of possible outcomes is:\n\n\\[\n6^4 = 1296.\n\\]\n\n### Step 2:"
-                ],
-                [
-                  "8ee6f3",
-                  "The points $\\left(x, y\\right)$ satisfying $((\\vert x + y \\vert - 10)^2 + ( \\vert x - y \\vert - 10)^2)((\\vert x \\vert - 8)^2 + ( \\vert y \\vert - 8)^2) = 0$ enclose a convex polygon. What is the area of this convex polygon?",
-                  320,
-                  "Please give a correct solution for this: The points $\\left(x, y\\right)$ satisfying $((\\vert x + y \\vert - 10)^2 + ( \\vert x - y \\vert - 10)^2)((\\vert x \\vert - 8)^2 + ( \\vert y \\vert - 8)^2) = 0$ enclose a convex polygon. What is the area of this convex polygon?",
-                  "To solve the equation \n\n\\[\n((|x + y| - 10)^2 + (|x - y| - 10)^2)((|x| - 8)^2 + (|y| - 8)^2) = 0,\n\\]\n\nwe need to analyze the two factors separately and determine the resultant sets of points.\n\n### Step 1: Analyze the first factor\n\nThe expression \\((|x + y| - 10)^2 + (|x"
-                ],
-                [
-                  "bedda4",
-                  "Let $ABCD$ be a unit square. Let $P$ be the point on $AB$ such that $|AP| = 1/{20}$ and let $Q$ be the point on $AD$ such that $|AQ| = 1/{24}$. The lines $DP$ and $BQ$ divide the square into four regions. Find the ratio between the areas of the largest region and the smallest region.",
-                  480,
-                  "Please give a correct solution for this: Let $ABCD$ be a unit square. Let $P$ be the point on $AB$ such that $|AP| = 1/{20}$ and let $Q$ be the point on $AD$ such that $|AQ| = 1/{24}$. The lines $DP$ and $BQ$ divide the square into four regions. Find the ratio between the areas of the largest region and the smallest region.",
-                  "To solve the problem, we first establish the coordinates of the points in the unit square \\(ABCD\\). \n\nLet the square \\(ABCD\\) have the following coordinates:\n- \\(A(0, 1)\\)\n- \\(B(1, 1)\\)\n- \\(C(1, 0)\\)\n- \\(D(0, 0)\\)\n\nNext, we define point \\(P\\) on segment \\(AB\\) such that \\(AP = \\frac{1"
-                ],
-                [
-                  "d7e9c9",
-                  "A function $f: \\mathbb N \\to \\mathbb N$ satisfies the following two conditions for all positive integers $n$:$f(f(f(n)))=8n-7$ and $f(2n)=2f(n)+1$. Calculate $f(100)$.",
-                  199,
-                  "Please give a correct solution for this: A function $f: \\mathbb N \\to \\mathbb N$ satisfies the following two conditions for all positive integers $n$:$f(f(f(n)))=8n-7$ and $f(2n)=2f(n)+1$. Calculate $f(100)$.",
-                  "To find the function \\( f \\) satisfying the conditions \\( f(f(f(n))) = 8n - 7 \\) and \\( f(2n) = 2f(n) + 1 \\), let's start investigating each condition.\n\nFrom the first condition, we can substitute \\( n = 1 \\):\n\\[\nf(f(f(1))) = 8 \\cdot 1 - 7 = 1.\n\\]\nLet \\( a = f(1) \\)."
-                ],
-                [
-                  "246d26",
-                  "Each of the three-digits numbers $111$ to $999$ is coloured blue or yellow in such a way that the sum of any two (not necessarily different) yellow numbers is equal to a blue number. What is the maximum possible number of yellow numbers there can be?",
-                  250,
-                  "Please give a correct solution for this: Each of the three-digits numbers $111$ to $999$ is coloured blue or yellow in such a way that the sum of any two (not necessarily different) yellow numbers is equal to a blue number. What is the maximum possible number of yellow numbers there can be?",
-                  "To solve this problem, we start by letting \\( Y \\) denote the set of yellow numbers and \\( B \\) denote the set of blue numbers. The condition provided states that for any two yellow numbers \\( y_1, y_2 \\in Y \\), their sum \\( y_1 + y_2 \\) must equal some blue number \\( b \\in B \\). \n\nGiven that we are working with three-digit numbers, we note that any number \\( y \\) in \\("
-                ],
-                [
-                  "2fc4ad",
-                  "Let the `sparkle' operation on positive integer $n$ consist of calculating the sum of the digits of $n$ and taking its factorial, e.g. the sparkle of 13 is $4! = 24$. A robot starts with a positive integer on a blackboard, then after each second for the rest of eternity, replaces the number on the board with its sparkle. For some `special' numbers, if they're the first number, then eventually every number that appears will be less than 6. How many such special numbers are there with at most 36 digits?",
-                  702,
-                  "Please give a correct solution for this: Let the `sparkle' operation on positive integer $n$ consist of calculating the sum of the digits of $n$ and taking its factorial, e.g. the sparkle of 13 is $4! = 24$. A robot starts with a positive integer on a blackboard, then after each second for the rest of eternity, replaces the number on the board with its sparkle. For some `special' numbers, if they're the first number, then eventually every number that appears will be less than 6. How many such special numbers are there with at most 36 digits?",
-                  "To solve the problem, we first need to understand the sparkle operation performed on a positive integer \\( n \\). The sparkle of \\( n \\), denoted as \\( S(n) \\), is defined as the sum of its digits, denoted \\( s(n) \\), followed by taking the factorial of that sum, i.e., \n\n\\[\nS(n) = s(n)!\n\\]\n\nWe are tasked with finding \"special\" numbers \u2014 those numbers such that starting from them, all subsequent values"
-                ],
-                [
-                  "430b63",
-                  "What is the minimum value of $5x^2+5y^2-8xy$ when $x$ and $y$ range over all real numbers such that $|x-2y| + |y-2x| = 40$?",
-                  800,
-                  "Please give a correct solution for this: What is the minimum value of $5x^2+5y^2-8xy$ when $x$ and $y$ range over all real numbers such that $|x-2y| + |y-2x| = 40$?",
-                  "We need to minimize the expression \\( f(x, y) = 5x^2 + 5y^2 - 8xy \\) under the constraint given by the equation \\( |x - 2y| + |y - 2x| = 40 \\).\n\nFirst, we analyze the constraint \\( |x - 2y| + |y - 2x| = 40 \\). This absolute value constraint suggests there are multiple cases to consider. Let's define the"
-                ],
-                [
-                  "5277ed",
-                  "There exists a unique increasing geometric sequence of five 2-digit positive integers. What is their sum?",
-                  211,
-                  "Please give a correct solution for this: There exists a unique increasing geometric sequence of five 2-digit positive integers. What is their sum?",
-                  "To find a unique increasing geometric sequence of five 2-digit integers, we can denote the integers in the sequence as follows:\n\n\\[\na, ar, ar^2, ar^3, ar^4\n\\]\n\nwhere \\(a\\) is the first term and \\(r\\) is the common ratio.\n\nSince we want each term to be a two-digit integer, we have the following constraints:\n\n\\[\n10 \\leq a < 100\n\\]\n\\[\n10 \\le"
-                ],
-                [
-                  "739bc9",
-                  "For how many positive integers $m$ does the equation $\\vert \\vert x-1 \\vert -2 \\vert=\\frac{m}{100}$ have $4$ distinct solutions?",
-                  199,
-                  "Please give a correct solution for this: For how many positive integers $m$ does the equation $\\vert \\vert x-1 \\vert -2 \\vert=\\frac{m}{100}$ have $4$ distinct solutions?",
-                  "To solve the equation \\( \\vert \\vert x-1 \\vert -2 \\vert = \\frac{m}{100} \\) for the number of positive integers \\( m \\) that yield \\( 4 \\) distinct solutions, we first analyze the expression \\( \\vert \\vert x-1 \\vert -2 \\vert \\).\n\n1. **Break down the expression:**\n   Let \\( y = \\vert x - 1 \\vert \\). Then, we rewrite the equation as"
-                ],
-                [
-                  "82e2a0",
-                  "Suppose that we roll four 6-sided fair dice with faces numbered 1 to~6. Let $a/b$ be the probability that the highest roll is a 5, where $a$ and $b$ are relatively prime positive integers. Find $a + b$.",
-                  185,
-                  "Please give a correct solution for this: Suppose that we roll four 6-sided fair dice with faces numbered 1 to~6. Let $a/b$ be the probability that the highest roll is a 5, where $a$ and $b$ are relatively prime positive integers. Find $a + b$.",
-                  "Given that we want the probability that the highest roll of four 6-sided dice is exactly 5, we need to consider two things: that at least one die shows a 5 and no die shows a 6.\n\n### Step 1: Calculate the total number of outcomes when rolling four dice.\nEach die has 6 faces, so when we roll four dice, the total number of possible outcomes is:\n\n\\[\n6^4 = 1296.\n\\]\n\n### Step 2:"
-                ],
-                [
-                  "8ee6f3",
-                  "The points $\\left(x, y\\right)$ satisfying $((\\vert x + y \\vert - 10)^2 + ( \\vert x - y \\vert - 10)^2)((\\vert x \\vert - 8)^2 + ( \\vert y \\vert - 8)^2) = 0$ enclose a convex polygon. What is the area of this convex polygon?",
-                  320,
-                  "Please give a correct solution for this: The points $\\left(x, y\\right)$ satisfying $((\\vert x + y \\vert - 10)^2 + ( \\vert x - y \\vert - 10)^2)((\\vert x \\vert - 8)^2 + ( \\vert y \\vert - 8)^2) = 0$ enclose a convex polygon. What is the area of this convex polygon?",
-                  "To solve the equation \n\n\\[\n((|x + y| - 10)^2 + (|x - y| - 10)^2)((|x| - 8)^2 + (|y| - 8)^2) = 0,\n\\]\n\nwe need to analyze the two factors separately and determine the resultant sets of points.\n\n### Step 1: Analyze the first factor\n\nThe expression \\((|x + y| - 10)^2 + (|x"
-                ],
-                [
-                  "bedda4",
-                  "Let $ABCD$ be a unit square. Let $P$ be the point on $AB$ such that $|AP| = 1/{20}$ and let $Q$ be the point on $AD$ such that $|AQ| = 1/{24}$. The lines $DP$ and $BQ$ divide the square into four regions. Find the ratio between the areas of the largest region and the smallest region.",
-                  480,
-                  "Please give a correct solution for this: Let $ABCD$ be a unit square. Let $P$ be the point on $AB$ such that $|AP| = 1/{20}$ and let $Q$ be the point on $AD$ such that $|AQ| = 1/{24}$. The lines $DP$ and $BQ$ divide the square into four regions. Find the ratio between the areas of the largest region and the smallest region.",
-                  "To solve the problem, we first establish the coordinates of the points in the unit square \\(ABCD\\). \n\nLet the square \\(ABCD\\) have the following coordinates:\n- \\(A(0, 1)\\)\n- \\(B(1, 1)\\)\n- \\(C(1, 0)\\)\n- \\(D(0, 0)\\)\n\nNext, we define point \\(P\\) on segment \\(AB\\) such that \\(AP = \\frac{1"
-                ],
-                [
-                  "d7e9c9",
-                  "A function $f: \\mathbb N \\to \\mathbb N$ satisfies the following two conditions for all positive integers $n$:$f(f(f(n)))=8n-7$ and $f(2n)=2f(n)+1$. Calculate $f(100)$.",
-                  199,
-                  "Please give a correct solution for this: A function $f: \\mathbb N \\to \\mathbb N$ satisfies the following two conditions for all positive integers $n$:$f(f(f(n)))=8n-7$ and $f(2n)=2f(n)+1$. Calculate $f(100)$.",
-                  "To find the function \\( f \\) satisfying the conditions \\( f(f(f(n))) = 8n - 7 \\) and \\( f(2n) = 2f(n) + 1 \\), let's start investigating each condition.\n\nFrom the first condition, we can substitute \\( n = 1 \\):\n\\[\nf(f(f(1))) = 8 \\cdot 1 - 7 = 1.\n\\]\nLet \\( a = f(1) \\)."
-                ],
-                [
-                  "246d26",
-                  "Each of the three-digits numbers $111$ to $999$ is coloured blue or yellow in such a way that the sum of any two (not necessarily different) yellow numbers is equal to a blue number. What is the maximum possible number of yellow numbers there can be?",
-                  250,
-                  "Please give a correct solution for this: Each of the three-digits numbers $111$ to $999$ is coloured blue or yellow in such a way that the sum of any two (not necessarily different) yellow numbers is equal to a blue number. What is the maximum possible number of yellow numbers there can be?",
-                  "To solve this problem, we start by letting \\( Y \\) denote the set of yellow numbers and \\( B \\) denote the set of blue numbers. The condition provided states that for any two yellow numbers \\( y_1, y_2 \\in Y \\), their sum \\( y_1 + y_2 \\) must equal some blue number \\( b \\in B \\). \n\nGiven that we are working with three-digit numbers, we note that any number \\( y \\) in \\("
-                ],
-                [
-                  "2fc4ad",
-                  "Let the `sparkle' operation on positive integer $n$ consist of calculating the sum of the digits of $n$ and taking its factorial, e.g. the sparkle of 13 is $4! = 24$. A robot starts with a positive integer on a blackboard, then after each second for the rest of eternity, replaces the number on the board with its sparkle. For some `special' numbers, if they're the first number, then eventually every number that appears will be less than 6. How many such special numbers are there with at most 36 digits?",
-                  702,
-                  "Please give a correct solution for this: Let the `sparkle' operation on positive integer $n$ consist of calculating the sum of the digits of $n$ and taking its factorial, e.g. the sparkle of 13 is $4! = 24$. A robot starts with a positive integer on a blackboard, then after each second for the rest of eternity, replaces the number on the board with its sparkle. For some `special' numbers, if they're the first number, then eventually every number that appears will be less than 6. How many such special numbers are there with at most 36 digits?",
-                  "To solve the problem, we first need to understand the sparkle operation performed on a positive integer \\( n \\). The sparkle of \\( n \\), denoted as \\( S(n) \\), is defined as the sum of its digits, denoted \\( s(n) \\), followed by taking the factorial of that sum, i.e., \n\n\\[\nS(n) = s(n)!\n\\]\n\nWe are tasked with finding \"special\" numbers \u2014 those numbers such that starting from them, all subsequent values"
-                ],
-                [
-                  "430b63",
-                  "What is the minimum value of $5x^2+5y^2-8xy$ when $x$ and $y$ range over all real numbers such that $|x-2y| + |y-2x| = 40$?",
-                  800,
-                  "Please give a correct solution for this: What is the minimum value of $5x^2+5y^2-8xy$ when $x$ and $y$ range over all real numbers such that $|x-2y| + |y-2x| = 40$?",
-                  "We need to minimize the expression \\( f(x, y) = 5x^2 + 5y^2 - 8xy \\) under the constraint given by the equation \\( |x - 2y| + |y - 2x| = 40 \\).\n\nFirst, we analyze the constraint \\( |x - 2y| + |y - 2x| = 40 \\). This absolute value constraint suggests there are multiple cases to consider. Let's define the"
-                ],
-                [
-                  "5277ed",
-                  "There exists a unique increasing geometric sequence of five 2-digit positive integers. What is their sum?",
-                  211,
-                  "Please give a correct solution for this: There exists a unique increasing geometric sequence of five 2-digit positive integers. What is their sum?",
-                  "To find a unique increasing geometric sequence of five 2-digit integers, we can denote the integers in the sequence as follows:\n\n\\[\na, ar, ar^2, ar^3, ar^4\n\\]\n\nwhere \\(a\\) is the first term and \\(r\\) is the common ratio.\n\nSince we want each term to be a two-digit integer, we have the following constraints:\n\n\\[\n10 \\leq a < 100\n\\]\n\\[\n10 \\le"
-                ],
-                [
-                  "739bc9",
-                  "For how many positive integers $m$ does the equation $\\vert \\vert x-1 \\vert -2 \\vert=\\frac{m}{100}$ have $4$ distinct solutions?",
-                  199,
-                  "Please give a correct solution for this: For how many positive integers $m$ does the equation $\\vert \\vert x-1 \\vert -2 \\vert=\\frac{m}{100}$ have $4$ distinct solutions?",
-                  "To solve the equation \\( \\vert \\vert x-1 \\vert -2 \\vert = \\frac{m}{100} \\) for the number of positive integers \\( m \\) that yield \\( 4 \\) distinct solutions, we first analyze the expression \\( \\vert \\vert x-1 \\vert -2 \\vert \\).\n\n1. **Break down the expression:**\n   Let \\( y = \\vert x - 1 \\vert \\). Then, we rewrite the equation as"
-                ],
-                [
-                  "82e2a0",
-                  "Suppose that we roll four 6-sided fair dice with faces numbered 1 to~6. Let $a/b$ be the probability that the highest roll is a 5, where $a$ and $b$ are relatively prime positive integers. Find $a + b$.",
-                  185,
-                  "Please give a correct solution for this: Suppose that we roll four 6-sided fair dice with faces numbered 1 to~6. Let $a/b$ be the probability that the highest roll is a 5, where $a$ and $b$ are relatively prime positive integers. Find $a + b$.",
-                  "Given that we want the probability that the highest roll of four 6-sided dice is exactly 5, we need to consider two things: that at least one die shows a 5 and no die shows a 6.\n\n### Step 1: Calculate the total number of outcomes when rolling four dice.\nEach die has 6 faces, so when we roll four dice, the total number of possible outcomes is:\n\n\\[\n6^4 = 1296.\n\\]\n\n### Step 2:"
-                ],
-                [
-                  "8ee6f3",
-                  "The points $\\left(x, y\\right)$ satisfying $((\\vert x + y \\vert - 10)^2 + ( \\vert x - y \\vert - 10)^2)((\\vert x \\vert - 8)^2 + ( \\vert y \\vert - 8)^2) = 0$ enclose a convex polygon. What is the area of this convex polygon?",
-                  320,
-                  "Please give a correct solution for this: The points $\\left(x, y\\right)$ satisfying $((\\vert x + y \\vert - 10)^2 + ( \\vert x - y \\vert - 10)^2)((\\vert x \\vert - 8)^2 + ( \\vert y \\vert - 8)^2) = 0$ enclose a convex polygon. What is the area of this convex polygon?",
-                  "To solve the equation \n\n\\[\n((|x + y| - 10)^2 + (|x - y| - 10)^2)((|x| - 8)^2 + (|y| - 8)^2) = 0,\n\\]\n\nwe need to analyze the two factors separately and determine the resultant sets of points.\n\n### Step 1: Analyze the first factor\n\nThe expression \\((|x + y| - 10)^2 + (|x"
-                ],
-                [
-                  "bedda4",
-                  "Let $ABCD$ be a unit square. Let $P$ be the point on $AB$ such that $|AP| = 1/{20}$ and let $Q$ be the point on $AD$ such that $|AQ| = 1/{24}$. The lines $DP$ and $BQ$ divide the square into four regions. Find the ratio between the areas of the largest region and the smallest region.",
-                  480,
-                  "Please give a correct solution for this: Let $ABCD$ be a unit square. Let $P$ be the point on $AB$ such that $|AP| = 1/{20}$ and let $Q$ be the point on $AD$ such that $|AQ| = 1/{24}$. The lines $DP$ and $BQ$ divide the square into four regions. Find the ratio between the areas of the largest region and the smallest region.",
-                  "To solve the problem, we first establish the coordinates of the points in the unit square \\(ABCD\\). \n\nLet the square \\(ABCD\\) have the following coordinates:\n- \\(A(0, 1)\\)\n- \\(B(1, 1)\\)\n- \\(C(1, 0)\\)\n- \\(D(0, 0)\\)\n\nNext, we define point \\(P\\) on segment \\(AB\\) such that \\(AP = \\frac{1"
-                ],
-                [
-                  "d7e9c9",
-                  "A function $f: \\mathbb N \\to \\mathbb N$ satisfies the following two conditions for all positive integers $n$:$f(f(f(n)))=8n-7$ and $f(2n)=2f(n)+1$. Calculate $f(100)$.",
-                  199,
-                  "Please give a correct solution for this: A function $f: \\mathbb N \\to \\mathbb N$ satisfies the following two conditions for all positive integers $n$:$f(f(f(n)))=8n-7$ and $f(2n)=2f(n)+1$. Calculate $f(100)$.",
-                  "To find the function \\( f \\) satisfying the conditions \\( f(f(f(n))) = 8n - 7 \\) and \\( f(2n) = 2f(n) + 1 \\), let's start investigating each condition.\n\nFrom the first condition, we can substitute \\( n = 1 \\):\n\\[\nf(f(f(1))) = 8 \\cdot 1 - 7 = 1.\n\\]\nLet \\( a = f(1) \\)."
-                ],
-                [
-                  "246d26",
-                  "Each of the three-digits numbers $111$ to $999$ is coloured blue or yellow in such a way that the sum of any two (not necessarily different) yellow numbers is equal to a blue number. What is the maximum possible number of yellow numbers there can be?",
-                  250,
-                  "Please give a correct solution for this: Each of the three-digits numbers $111$ to $999$ is coloured blue or yellow in such a way that the sum of any two (not necessarily different) yellow numbers is equal to a blue number. What is the maximum possible number of yellow numbers there can be?",
-                  "To solve this problem, we start by letting \\( Y \\) denote the set of yellow numbers and \\( B \\) denote the set of blue numbers. The condition provided states that for any two yellow numbers \\( y_1, y_2 \\in Y \\), their sum \\( y_1 + y_2 \\) must equal some blue number \\( b \\in B \\). \n\nGiven that we are working with three-digit numbers, we note that any number \\( y \\) in \\("
-                ],
-                [
-                  "2fc4ad",
-                  "Let the `sparkle' operation on positive integer $n$ consist of calculating the sum of the digits of $n$ and taking its factorial, e.g. the sparkle of 13 is $4! = 24$. A robot starts with a positive integer on a blackboard, then after each second for the rest of eternity, replaces the number on the board with its sparkle. For some `special' numbers, if they're the first number, then eventually every number that appears will be less than 6. How many such special numbers are there with at most 36 digits?",
-                  702,
-                  "Please give a correct solution for this: Let the `sparkle' operation on positive integer $n$ consist of calculating the sum of the digits of $n$ and taking its factorial, e.g. the sparkle of 13 is $4! = 24$. A robot starts with a positive integer on a blackboard, then after each second for the rest of eternity, replaces the number on the board with its sparkle. For some `special' numbers, if they're the first number, then eventually every number that appears will be less than 6. How many such special numbers are there with at most 36 digits?",
-                  "To solve the problem, we first need to understand the sparkle operation performed on a positive integer \\( n \\). The sparkle of \\( n \\), denoted as \\( S(n) \\), is defined as the sum of its digits, denoted \\( s(n) \\), followed by taking the factorial of that sum, i.e., \n\n\\[\nS(n) = s(n)!\n\\]\n\nWe are tasked with finding \"special\" numbers \u2014 those numbers such that starting from them, all subsequent values"
-                ],
-                [
-                  "430b63",
-                  "What is the minimum value of $5x^2+5y^2-8xy$ when $x$ and $y$ range over all real numbers such that $|x-2y| + |y-2x| = 40$?",
-                  800,
-                  "Please give a correct solution for this: What is the minimum value of $5x^2+5y^2-8xy$ when $x$ and $y$ range over all real numbers such that $|x-2y| + |y-2x| = 40$?",
-                  "We need to minimize the expression \\( f(x, y) = 5x^2 + 5y^2 - 8xy \\) under the constraint given by the equation \\( |x - 2y| + |y - 2x| = 40 \\).\n\nFirst, we analyze the constraint \\( |x - 2y| + |y - 2x| = 40 \\). This absolute value constraint suggests there are multiple cases to consider. Let's define the"
-                ],
-                [
-                  "5277ed",
-                  "There exists a unique increasing geometric sequence of five 2-digit positive integers. What is their sum?",
-                  211,
-                  "Please give a correct solution for this: There exists a unique increasing geometric sequence of five 2-digit positive integers. What is their sum?",
-                  "To find a unique increasing geometric sequence of five 2-digit integers, we can denote the integers in the sequence as follows:\n\n\\[\na, ar, ar^2, ar^3, ar^4\n\\]\n\nwhere \\(a\\) is the first term and \\(r\\) is the common ratio.\n\nSince we want each term to be a two-digit integer, we have the following constraints:\n\n\\[\n10 \\leq a < 100\n\\]\n\\[\n10 \\le"
-                ],
-                [
-                  "739bc9",
-                  "For how many positive integers $m$ does the equation $\\vert \\vert x-1 \\vert -2 \\vert=\\frac{m}{100}$ have $4$ distinct solutions?",
-                  199,
-                  "Please give a correct solution for this: For how many positive integers $m$ does the equation $\\vert \\vert x-1 \\vert -2 \\vert=\\frac{m}{100}$ have $4$ distinct solutions?",
-                  "To solve the equation \\( \\vert \\vert x-1 \\vert -2 \\vert = \\frac{m}{100} \\) for the number of positive integers \\( m \\) that yield \\( 4 \\) distinct solutions, we first analyze the expression \\( \\vert \\vert x-1 \\vert -2 \\vert \\).\n\n1. **Break down the expression:**\n   Let \\( y = \\vert x - 1 \\vert \\). Then, we rewrite the equation as"
-                ],
-                [
-                  "82e2a0",
-                  "Suppose that we roll four 6-sided fair dice with faces numbered 1 to~6. Let $a/b$ be the probability that the highest roll is a 5, where $a$ and $b$ are relatively prime positive integers. Find $a + b$.",
-                  185,
-                  "Please give a correct solution for this: Suppose that we roll four 6-sided fair dice with faces numbered 1 to~6. Let $a/b$ be the probability that the highest roll is a 5, where $a$ and $b$ are relatively prime positive integers. Find $a + b$.",
-                  "Given that we want the probability that the highest roll of four 6-sided dice is exactly 5, we need to consider two things: that at least one die shows a 5 and no die shows a 6.\n\n### Step 1: Calculate the total number of outcomes when rolling four dice.\nEach die has 6 faces, so when we roll four dice, the total number of possible outcomes is:\n\n\\[\n6^4 = 1296.\n\\]\n\n### Step 2:"
-                ],
-                [
-                  "8ee6f3",
-                  "The points $\\left(x, y\\right)$ satisfying $((\\vert x + y \\vert - 10)^2 + ( \\vert x - y \\vert - 10)^2)((\\vert x \\vert - 8)^2 + ( \\vert y \\vert - 8)^2) = 0$ enclose a convex polygon. What is the area of this convex polygon?",
-                  320,
-                  "Please give a correct solution for this: The points $\\left(x, y\\right)$ satisfying $((\\vert x + y \\vert - 10)^2 + ( \\vert x - y \\vert - 10)^2)((\\vert x \\vert - 8)^2 + ( \\vert y \\vert - 8)^2) = 0$ enclose a convex polygon. What is the area of this convex polygon?",
-                  "To solve the equation \n\n\\[\n((|x + y| - 10)^2 + (|x - y| - 10)^2)((|x| - 8)^2 + (|y| - 8)^2) = 0,\n\\]\n\nwe need to analyze the two factors separately and determine the resultant sets of points.\n\n### Step 1: Analyze the first factor\n\nThe expression \\((|x + y| - 10)^2 + (|x"
-                ],
-                [
-                  "bedda4",
-                  "Let $ABCD$ be a unit square. Let $P$ be the point on $AB$ such that $|AP| = 1/{20}$ and let $Q$ be the point on $AD$ such that $|AQ| = 1/{24}$. The lines $DP$ and $BQ$ divide the square into four regions. Find the ratio between the areas of the largest region and the smallest region.",
-                  480,
-                  "Please give a correct solution for this: Let $ABCD$ be a unit square. Let $P$ be the point on $AB$ such that $|AP| = 1/{20}$ and let $Q$ be the point on $AD$ such that $|AQ| = 1/{24}$. The lines $DP$ and $BQ$ divide the square into four regions. Find the ratio between the areas of the largest region and the smallest region.",
-                  "To solve the problem, we first establish the coordinates of the points in the unit square \\(ABCD\\). \n\nLet the square \\(ABCD\\) have the following coordinates:\n- \\(A(0, 1)\\)\n- \\(B(1, 1)\\)\n- \\(C(1, 0)\\)\n- \\(D(0, 0)\\)\n\nNext, we define point \\(P\\) on segment \\(AB\\) such that \\(AP = \\frac{1"
-                ],
-                [
-                  "d7e9c9",
-                  "A function $f: \\mathbb N \\to \\mathbb N$ satisfies the following two conditions for all positive integers $n$:$f(f(f(n)))=8n-7$ and $f(2n)=2f(n)+1$. Calculate $f(100)$.",
-                  199,
-                  "Please give a correct solution for this: A function $f: \\mathbb N \\to \\mathbb N$ satisfies the following two conditions for all positive integers $n$:$f(f(f(n)))=8n-7$ and $f(2n)=2f(n)+1$. Calculate $f(100)$.",
-                  "To find the function \\( f \\) satisfying the conditions \\( f(f(f(n))) = 8n - 7 \\) and \\( f(2n) = 2f(n) + 1 \\), let's start investigating each condition.\n\nFrom the first condition, we can substitute \\( n = 1 \\):\n\\[\nf(f(f(1))) = 8 \\cdot 1 - 7 = 1.\n\\]\nLet \\( a = f(1) \\)."
-                ],
-                [
-                  "246d26",
-                  "Each of the three-digits numbers $111$ to $999$ is coloured blue or yellow in such a way that the sum of any two (not necessarily different) yellow numbers is equal to a blue number. What is the maximum possible number of yellow numbers there can be?",
-                  250,
-                  "Please give a correct solution for this: Each of the three-digits numbers $111$ to $999$ is coloured blue or yellow in such a way that the sum of any two (not necessarily different) yellow numbers is equal to a blue number. What is the maximum possible number of yellow numbers there can be?",
-                  "To solve this problem, we start by letting \\( Y \\) denote the set of yellow numbers and \\( B \\) denote the set of blue numbers. The condition provided states that for any two yellow numbers \\( y_1, y_2 \\in Y \\), their sum \\( y_1 + y_2 \\) must equal some blue number \\( b \\in B \\). \n\nGiven that we are working with three-digit numbers, we note that any number \\( y \\) in \\("
-                ],
-                [
-                  "2fc4ad",
-                  "Let the `sparkle' operation on positive integer $n$ consist of calculating the sum of the digits of $n$ and taking its factorial, e.g. the sparkle of 13 is $4! = 24$. A robot starts with a positive integer on a blackboard, then after each second for the rest of eternity, replaces the number on the board with its sparkle. For some `special' numbers, if they're the first number, then eventually every number that appears will be less than 6. How many such special numbers are there with at most 36 digits?",
-                  702,
-                  "Please give a correct solution for this: Let the `sparkle' operation on positive integer $n$ consist of calculating the sum of the digits of $n$ and taking its factorial, e.g. the sparkle of 13 is $4! = 24$. A robot starts with a positive integer on a blackboard, then after each second for the rest of eternity, replaces the number on the board with its sparkle. For some `special' numbers, if they're the first number, then eventually every number that appears will be less than 6. How many such special numbers are there with at most 36 digits?",
-                  "To solve the problem, we first need to understand the sparkle operation performed on a positive integer \\( n \\). The sparkle of \\( n \\), denoted as \\( S(n) \\), is defined as the sum of its digits, denoted \\( s(n) \\), followed by taking the factorial of that sum, i.e., \n\n\\[\nS(n) = s(n)!\n\\]\n\nWe are tasked with finding \"special\" numbers \u2014 those numbers such that starting from them, all subsequent values"
-                ],
-                [
-                  "430b63",
-                  "What is the minimum value of $5x^2+5y^2-8xy$ when $x$ and $y$ range over all real numbers such that $|x-2y| + |y-2x| = 40$?",
-                  800,
-                  "Please give a correct solution for this: What is the minimum value of $5x^2+5y^2-8xy$ when $x$ and $y$ range over all real numbers such that $|x-2y| + |y-2x| = 40$?",
-                  "We need to minimize the expression \\( f(x, y) = 5x^2 + 5y^2 - 8xy \\) under the constraint given by the equation \\( |x - 2y| + |y - 2x| = 40 \\).\n\nFirst, we analyze the constraint \\( |x - 2y| + |y - 2x| = 40 \\). This absolute value constraint suggests there are multiple cases to consider. Let's define the"
-                ],
-                [
-                  "5277ed",
-                  "There exists a unique increasing geometric sequence of five 2-digit positive integers. What is their sum?",
-                  211,
-                  "Please give a correct solution for this: There exists a unique increasing geometric sequence of five 2-digit positive integers. What is their sum?",
-                  "To find a unique increasing geometric sequence of five 2-digit integers, we can denote the integers in the sequence as follows:\n\n\\[\na, ar, ar^2, ar^3, ar^4\n\\]\n\nwhere \\(a\\) is the first term and \\(r\\) is the common ratio.\n\nSince we want each term to be a two-digit integer, we have the following constraints:\n\n\\[\n10 \\leq a < 100\n\\]\n\\[\n10 \\le"
-                ],
-                [
-                  "739bc9",
-                  "For how many positive integers $m$ does the equation $\\vert \\vert x-1 \\vert -2 \\vert=\\frac{m}{100}$ have $4$ distinct solutions?",
-                  199,
-                  "Please give a correct solution for this: For how many positive integers $m$ does the equation $\\vert \\vert x-1 \\vert -2 \\vert=\\frac{m}{100}$ have $4$ distinct solutions?",
-                  "To solve the equation \\( \\vert \\vert x-1 \\vert -2 \\vert = \\frac{m}{100} \\) for the number of positive integers \\( m \\) that yield \\( 4 \\) distinct solutions, we first analyze the expression \\( \\vert \\vert x-1 \\vert -2 \\vert \\).\n\n1. **Break down the expression:**\n   Let \\( y = \\vert x - 1 \\vert \\). Then, we rewrite the equation as"
-                ],
-                [
-                  "82e2a0",
-                  "Suppose that we roll four 6-sided fair dice with faces numbered 1 to~6. Let $a/b$ be the probability that the highest roll is a 5, where $a$ and $b$ are relatively prime positive integers. Find $a + b$.",
-                  185,
-                  "Please give a correct solution for this: Suppose that we roll four 6-sided fair dice with faces numbered 1 to~6. Let $a/b$ be the probability that the highest roll is a 5, where $a$ and $b$ are relatively prime positive integers. Find $a + b$.",
-                  "Given that we want the probability that the highest roll of four 6-sided dice is exactly 5, we need to consider two things: that at least one die shows a 5 and no die shows a 6.\n\n### Step 1: Calculate the total number of outcomes when rolling four dice.\nEach die has 6 faces, so when we roll four dice, the total number of possible outcomes is:\n\n\\[\n6^4 = 1296.\n\\]\n\n### Step 2:"
-                ],
-                [
-                  "8ee6f3",
-                  "The points $\\left(x, y\\right)$ satisfying $((\\vert x + y \\vert - 10)^2 + ( \\vert x - y \\vert - 10)^2)((\\vert x \\vert - 8)^2 + ( \\vert y \\vert - 8)^2) = 0$ enclose a convex polygon. What is the area of this convex polygon?",
-                  320,
-                  "Please give a correct solution for this: The points $\\left(x, y\\right)$ satisfying $((\\vert x + y \\vert - 10)^2 + ( \\vert x - y \\vert - 10)^2)((\\vert x \\vert - 8)^2 + ( \\vert y \\vert - 8)^2) = 0$ enclose a convex polygon. What is the area of this convex polygon?",
-                  "To solve the equation \n\n\\[\n((|x + y| - 10)^2 + (|x - y| - 10)^2)((|x| - 8)^2 + (|y| - 8)^2) = 0,\n\\]\n\nwe need to analyze the two factors separately and determine the resultant sets of points.\n\n### Step 1: Analyze the first factor\n\nThe expression \\((|x + y| - 10)^2 + (|x"
-                ],
-                [
-                  "bedda4",
-                  "Let $ABCD$ be a unit square. Let $P$ be the point on $AB$ such that $|AP| = 1/{20}$ and let $Q$ be the point on $AD$ such that $|AQ| = 1/{24}$. The lines $DP$ and $BQ$ divide the square into four regions. Find the ratio between the areas of the largest region and the smallest region.",
-                  480,
-                  "Please give a correct solution for this: Let $ABCD$ be a unit square. Let $P$ be the point on $AB$ such that $|AP| = 1/{20}$ and let $Q$ be the point on $AD$ such that $|AQ| = 1/{24}$. The lines $DP$ and $BQ$ divide the square into four regions. Find the ratio between the areas of the largest region and the smallest region.",
-                  "To solve the problem, we first establish the coordinates of the points in the unit square \\(ABCD\\). \n\nLet the square \\(ABCD\\) have the following coordinates:\n- \\(A(0, 1)\\)\n- \\(B(1, 1)\\)\n- \\(C(1, 0)\\)\n- \\(D(0, 0)\\)\n\nNext, we define point \\(P\\) on segment \\(AB\\) such that \\(AP = \\frac{1"
-                ],
                 [
                   "d7e9c9",
                   "A function $f: \\mathbb N \\to \\mathbb N$ satisfies the following two conditions for all positive integers $n$:$f(f(f(n)))=8n-7$ and $f(2n)=2f(n)+1$. Calculate $f(100)$.",
@@ -478,18 +163,19 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "input": {
+          "color": "orange",
+          "inputs": [
+            {
               "name": "input",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "View",
-          "outputs": {},
-          "params": {},
+          "outputs": [],
+          "params": [],
           "type": "table_view"
         },
         "params": {},
@@ -653,231 +339,6 @@
                   "Let $ABCD$ be a unit square. Let $P$ be the point on $AB$ such that $|AP| = 1/{20}$ and let $Q$ be the point on $AD$ such that $|AQ| = 1/{24}$. The lines $DP$ and $BQ$ divide the square into four regions. Find the ratio between the areas of the largest region and the smallest region.",
                   480
                 ],
-                [
-                  "d7e9c9",
-                  "A function $f: \\mathbb N \\to \\mathbb N$ satisfies the following two conditions for all positive integers $n$:$f(f(f(n)))=8n-7$ and $f(2n)=2f(n)+1$. Calculate $f(100)$.",
-                  199
-                ],
-                [
-                  "246d26",
-                  "Each of the three-digits numbers $111$ to $999$ is coloured blue or yellow in such a way that the sum of any two (not necessarily different) yellow numbers is equal to a blue number. What is the maximum possible number of yellow numbers there can be?",
-                  250
-                ],
-                [
-                  "2fc4ad",
-                  "Let the `sparkle' operation on positive integer $n$ consist of calculating the sum of the digits of $n$ and taking its factorial, e.g. the sparkle of 13 is $4! = 24$. A robot starts with a positive integer on a blackboard, then after each second for the rest of eternity, replaces the number on the board with its sparkle. For some `special' numbers, if they're the first number, then eventually every number that appears will be less than 6. How many such special numbers are there with at most 36 digits?",
-                  702
-                ],
-                [
-                  "430b63",
-                  "What is the minimum value of $5x^2+5y^2-8xy$ when $x$ and $y$ range over all real numbers such that $|x-2y| + |y-2x| = 40$?",
-                  800
-                ],
-                [
-                  "5277ed",
-                  "There exists a unique increasing geometric sequence of five 2-digit positive integers. What is their sum?",
-                  211
-                ],
-                [
-                  "739bc9",
-                  "For how many positive integers $m$ does the equation $\\vert \\vert x-1 \\vert -2 \\vert=\\frac{m}{100}$ have $4$ distinct solutions?",
-                  199
-                ],
-                [
-                  "82e2a0",
-                  "Suppose that we roll four 6-sided fair dice with faces numbered 1 to~6. Let $a/b$ be the probability that the highest roll is a 5, where $a$ and $b$ are relatively prime positive integers. Find $a + b$.",
-                  185
-                ],
-                [
-                  "8ee6f3",
-                  "The points $\\left(x, y\\right)$ satisfying $((\\vert x + y \\vert - 10)^2 + ( \\vert x - y \\vert - 10)^2)((\\vert x \\vert - 8)^2 + ( \\vert y \\vert - 8)^2) = 0$ enclose a convex polygon. What is the area of this convex polygon?",
-                  320
-                ],
-                [
-                  "bedda4",
-                  "Let $ABCD$ be a unit square. Let $P$ be the point on $AB$ such that $|AP| = 1/{20}$ and let $Q$ be the point on $AD$ such that $|AQ| = 1/{24}$. The lines $DP$ and $BQ$ divide the square into four regions. Find the ratio between the areas of the largest region and the smallest region.",
-                  480
-                ],
-                [
-                  "d7e9c9",
-                  "A function $f: \\mathbb N \\to \\mathbb N$ satisfies the following two conditions for all positive integers $n$:$f(f(f(n)))=8n-7$ and $f(2n)=2f(n)+1$. Calculate $f(100)$.",
-                  199
-                ],
-                [
-                  "246d26",
-                  "Each of the three-digits numbers $111$ to $999$ is coloured blue or yellow in such a way that the sum of any two (not necessarily different) yellow numbers is equal to a blue number. What is the maximum possible number of yellow numbers there can be?",
-                  250
-                ],
-                [
-                  "2fc4ad",
-                  "Let the `sparkle' operation on positive integer $n$ consist of calculating the sum of the digits of $n$ and taking its factorial, e.g. the sparkle of 13 is $4! = 24$. A robot starts with a positive integer on a blackboard, then after each second for the rest of eternity, replaces the number on the board with its sparkle. For some `special' numbers, if they're the first number, then eventually every number that appears will be less than 6. How many such special numbers are there with at most 36 digits?",
-                  702
-                ],
-                [
-                  "430b63",
-                  "What is the minimum value of $5x^2+5y^2-8xy$ when $x$ and $y$ range over all real numbers such that $|x-2y| + |y-2x| = 40$?",
-                  800
-                ],
-                [
-                  "5277ed",
-                  "There exists a unique increasing geometric sequence of five 2-digit positive integers. What is their sum?",
-                  211
-                ],
-                [
-                  "739bc9",
-                  "For how many positive integers $m$ does the equation $\\vert \\vert x-1 \\vert -2 \\vert=\\frac{m}{100}$ have $4$ distinct solutions?",
-                  199
-                ],
-                [
-                  "82e2a0",
-                  "Suppose that we roll four 6-sided fair dice with faces numbered 1 to~6. Let $a/b$ be the probability that the highest roll is a 5, where $a$ and $b$ are relatively prime positive integers. Find $a + b$.",
-                  185
-                ],
-                [
-                  "8ee6f3",
-                  "The points $\\left(x, y\\right)$ satisfying $((\\vert x + y \\vert - 10)^2 + ( \\vert x - y \\vert - 10)^2)((\\vert x \\vert - 8)^2 + ( \\vert y \\vert - 8)^2) = 0$ enclose a convex polygon. What is the area of this convex polygon?",
-                  320
-                ],
-                [
-                  "bedda4",
-                  "Let $ABCD$ be a unit square. Let $P$ be the point on $AB$ such that $|AP| = 1/{20}$ and let $Q$ be the point on $AD$ such that $|AQ| = 1/{24}$. The lines $DP$ and $BQ$ divide the square into four regions. Find the ratio between the areas of the largest region and the smallest region.",
-                  480
-                ],
-                [
-                  "d7e9c9",
-                  "A function $f: \\mathbb N \\to \\mathbb N$ satisfies the following two conditions for all positive integers $n$:$f(f(f(n)))=8n-7$ and $f(2n)=2f(n)+1$. Calculate $f(100)$.",
-                  199
-                ],
-                [
-                  "246d26",
-                  "Each of the three-digits numbers $111$ to $999$ is coloured blue or yellow in such a way that the sum of any two (not necessarily different) yellow numbers is equal to a blue number. What is the maximum possible number of yellow numbers there can be?",
-                  250
-                ],
-                [
-                  "2fc4ad",
-                  "Let the `sparkle' operation on positive integer $n$ consist of calculating the sum of the digits of $n$ and taking its factorial, e.g. the sparkle of 13 is $4! = 24$. A robot starts with a positive integer on a blackboard, then after each second for the rest of eternity, replaces the number on the board with its sparkle. For some `special' numbers, if they're the first number, then eventually every number that appears will be less than 6. How many such special numbers are there with at most 36 digits?",
-                  702
-                ],
-                [
-                  "430b63",
-                  "What is the minimum value of $5x^2+5y^2-8xy$ when $x$ and $y$ range over all real numbers such that $|x-2y| + |y-2x| = 40$?",
-                  800
-                ],
-                [
-                  "5277ed",
-                  "There exists a unique increasing geometric sequence of five 2-digit positive integers. What is their sum?",
-                  211
-                ],
-                [
-                  "739bc9",
-                  "For how many positive integers $m$ does the equation $\\vert \\vert x-1 \\vert -2 \\vert=\\frac{m}{100}$ have $4$ distinct solutions?",
-                  199
-                ],
-                [
-                  "82e2a0",
-                  "Suppose that we roll four 6-sided fair dice with faces numbered 1 to~6. Let $a/b$ be the probability that the highest roll is a 5, where $a$ and $b$ are relatively prime positive integers. Find $a + b$.",
-                  185
-                ],
-                [
-                  "8ee6f3",
-                  "The points $\\left(x, y\\right)$ satisfying $((\\vert x + y \\vert - 10)^2 + ( \\vert x - y \\vert - 10)^2)((\\vert x \\vert - 8)^2 + ( \\vert y \\vert - 8)^2) = 0$ enclose a convex polygon. What is the area of this convex polygon?",
-                  320
-                ],
-                [
-                  "bedda4",
-                  "Let $ABCD$ be a unit square. Let $P$ be the point on $AB$ such that $|AP| = 1/{20}$ and let $Q$ be the point on $AD$ such that $|AQ| = 1/{24}$. The lines $DP$ and $BQ$ divide the square into four regions. Find the ratio between the areas of the largest region and the smallest region.",
-                  480
-                ],
-                [
-                  "d7e9c9",
-                  "A function $f: \\mathbb N \\to \\mathbb N$ satisfies the following two conditions for all positive integers $n$:$f(f(f(n)))=8n-7$ and $f(2n)=2f(n)+1$. Calculate $f(100)$.",
-                  199
-                ],
-                [
-                  "246d26",
-                  "Each of the three-digits numbers $111$ to $999$ is coloured blue or yellow in such a way that the sum of any two (not necessarily different) yellow numbers is equal to a blue number. What is the maximum possible number of yellow numbers there can be?",
-                  250
-                ],
-                [
-                  "2fc4ad",
-                  "Let the `sparkle' operation on positive integer $n$ consist of calculating the sum of the digits of $n$ and taking its factorial, e.g. the sparkle of 13 is $4! = 24$. A robot starts with a positive integer on a blackboard, then after each second for the rest of eternity, replaces the number on the board with its sparkle. For some `special' numbers, if they're the first number, then eventually every number that appears will be less than 6. How many such special numbers are there with at most 36 digits?",
-                  702
-                ],
-                [
-                  "430b63",
-                  "What is the minimum value of $5x^2+5y^2-8xy$ when $x$ and $y$ range over all real numbers such that $|x-2y| + |y-2x| = 40$?",
-                  800
-                ],
-                [
-                  "5277ed",
-                  "There exists a unique increasing geometric sequence of five 2-digit positive integers. What is their sum?",
-                  211
-                ],
-                [
-                  "739bc9",
-                  "For how many positive integers $m$ does the equation $\\vert \\vert x-1 \\vert -2 \\vert=\\frac{m}{100}$ have $4$ distinct solutions?",
-                  199
-                ],
-                [
-                  "82e2a0",
-                  "Suppose that we roll four 6-sided fair dice with faces numbered 1 to~6. Let $a/b$ be the probability that the highest roll is a 5, where $a$ and $b$ are relatively prime positive integers. Find $a + b$.",
-                  185
-                ],
-                [
-                  "8ee6f3",
-                  "The points $\\left(x, y\\right)$ satisfying $((\\vert x + y \\vert - 10)^2 + ( \\vert x - y \\vert - 10)^2)((\\vert x \\vert - 8)^2 + ( \\vert y \\vert - 8)^2) = 0$ enclose a convex polygon. What is the area of this convex polygon?",
-                  320
-                ],
-                [
-                  "bedda4",
-                  "Let $ABCD$ be a unit square. Let $P$ be the point on $AB$ such that $|AP| = 1/{20}$ and let $Q$ be the point on $AD$ such that $|AQ| = 1/{24}$. The lines $DP$ and $BQ$ divide the square into four regions. Find the ratio between the areas of the largest region and the smallest region.",
-                  480
-                ],
-                [
-                  "d7e9c9",
-                  "A function $f: \\mathbb N \\to \\mathbb N$ satisfies the following two conditions for all positive integers $n$:$f(f(f(n)))=8n-7$ and $f(2n)=2f(n)+1$. Calculate $f(100)$.",
-                  199
-                ],
-                [
-                  "246d26",
-                  "Each of the three-digits numbers $111$ to $999$ is coloured blue or yellow in such a way that the sum of any two (not necessarily different) yellow numbers is equal to a blue number. What is the maximum possible number of yellow numbers there can be?",
-                  250
-                ],
-                [
-                  "2fc4ad",
-                  "Let the `sparkle' operation on positive integer $n$ consist of calculating the sum of the digits of $n$ and taking its factorial, e.g. the sparkle of 13 is $4! = 24$. A robot starts with a positive integer on a blackboard, then after each second for the rest of eternity, replaces the number on the board with its sparkle. For some `special' numbers, if they're the first number, then eventually every number that appears will be less than 6. How many such special numbers are there with at most 36 digits?",
-                  702
-                ],
-                [
-                  "430b63",
-                  "What is the minimum value of $5x^2+5y^2-8xy$ when $x$ and $y$ range over all real numbers such that $|x-2y| + |y-2x| = 40$?",
-                  800
-                ],
-                [
-                  "5277ed",
-                  "There exists a unique increasing geometric sequence of five 2-digit positive integers. What is their sum?",
-                  211
-                ],
-                [
-                  "739bc9",
-                  "For how many positive integers $m$ does the equation $\\vert \\vert x-1 \\vert -2 \\vert=\\frac{m}{100}$ have $4$ distinct solutions?",
-                  199
-                ],
-                [
-                  "82e2a0",
-                  "Suppose that we roll four 6-sided fair dice with faces numbered 1 to~6. Let $a/b$ be the probability that the highest roll is a 5, where $a$ and $b$ are relatively prime positive integers. Find $a + b$.",
-                  185
-                ],
-                [
-                  "8ee6f3",
-                  "The points $\\left(x, y\\right)$ satisfying $((\\vert x + y \\vert - 10)^2 + ( \\vert x - y \\vert - 10)^2)((\\vert x \\vert - 8)^2 + ( \\vert y \\vert - 8)^2) = 0$ enclose a convex polygon. What is the area of this convex polygon?",
-                  320
-                ],
-                [
-                  "bedda4",
-                  "Let $ABCD$ be a unit square. Let $P$ be the point on $AB$ such that $|AP| = 1/{20}$ and let $Q$ be the point on $AD$ such that $|AQ| = 1/{24}$. The lines $DP$ and $BQ$ divide the square into four regions. Find the ratio between the areas of the largest region and the smallest region.",
-                  480
-                ],
                 [
                   "d7e9c9",
                   "A function $f: \\mathbb N \\to \\mathbb N$ satisfies the following two conditions for all positive integers $n$:$f(f(f(n)))=8n-7$ and $f(2n)=2f(n)+1$. Calculate $f(100)$.",
@@ -890,18 +351,19 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "input": {
+          "color": "orange",
+          "inputs": [
+            {
               "name": "input",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "View",
-          "outputs": {},
-          "params": {},
+          "outputs": [],
+          "params": [],
           "type": "table_view"
         },
         "params": {},
@@ -995,41 +457,42 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "input": {
+          "color": "orange",
+          "inputs": [
+            {
               "name": "input",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "Create prompt",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "save_as": {
+          ],
+          "params": [
+            {
               "default": "prompt",
               "name": "save_as",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "template": {
+            {
               "default": null,
               "name": "template",
               "type": {
                 "format": "textarea"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -1062,41 +525,42 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "input": {
+          "color": "orange",
+          "inputs": [
+            {
               "name": "input",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "Create prompt",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "save_as": {
+          ],
+          "params": [
+            {
               "default": "prompt",
               "name": "save_as",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "template": {
+            {
               "default": null,
               "name": "template",
               "type": {
                 "format": "textarea"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -1127,18 +591,19 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "input": {
+          "color": "orange",
+          "inputs": [
+            {
               "name": "input",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "View",
-          "outputs": {},
-          "params": {},
+          "outputs": [],
+          "params": [],
           "type": "table_view"
         },
         "params": {},
@@ -1252,34 +717,35 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "input": {
+          "color": "orange",
+          "inputs": [
+            {
               "name": "input",
               "position": "right",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "Loop",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "left",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "max_iterations": {
-              "default": 3.0,
+          ],
+          "params": [
+            {
+              "default": 3,
               "name": "max_iterations",
               "type": {
                 "type": "<class 'int'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -1312,33 +778,34 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {},
+          "color": "orange",
+          "inputs": [],
           "name": "Input CSV",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "filename": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "filename",
               "type": {
                 "format": "path"
               }
             },
-            "key": {
+            {
               "default": null,
               "name": "key",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -1366,41 +833,42 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "input": {
+          "color": "orange",
+          "inputs": [
+            {
               "name": "input",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "Branch",
-          "outputs": {
-            "false": {
-              "name": "false",
+          "outputs": [
+            {
+              "name": "true",
               "position": "right",
               "type": {
                 "type": "None"
               }
             },
-            "true": {
-              "name": "true",
+            {
+              "name": "false",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "expression": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "expression",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -1425,45 +893,42 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "input": {
+          "color": "orange",
+          "inputs": [
+            {
               "name": "input",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "Ask LLM",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "accepted_regex": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "accepted_regex",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "max_tokens": {
-              "default": 100.0,
+            {
+              "default": 100,
               "name": "max_tokens",
               "type": {
                 "type": "<class 'int'>"
               }
             }
-          },
-          "position": {
-            "x": 485.0,
-            "y": 196.0
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -1491,45 +956,42 @@
         "error": "Error code: 400 - {'error': {'message': 'Unrecognized request argument supplied: regex', 'type': 'invalid_request_error', 'param': None, 'code': None}}",
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "input": {
+          "color": "orange",
+          "inputs": [
+            {
               "name": "input",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "Ask LLM",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "accepted_regex": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "accepted_regex",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "max_tokens": {
-              "default": 100.0,
+            {
+              "default": 100,
               "name": "max_tokens",
               "type": {
                 "type": "<class 'int'>"
               }
             }
-          },
-          "position": {
-            "x": 759.0,
-            "y": 223.0
-          },
+          ],
           "type": "basic"
         },
         "params": {

examples/Bio Cypher demo.lynxkite.json

@@ -1,236 +1,331 @@
 {
+  "edges": [
+    {
+      "id": "Import CSV 1 Parse SMILES 1",
+      "source": "Import CSV 1",
+      "sourceHandle": "output",
+      "target": "Parse SMILES 1",
+      "targetHandle": "bundle"
+    },
+    {
+      "id": "Parse SMILES 1 Graph from molecule similarity 1",
+      "source": "Parse SMILES 1",
+      "sourceHandle": "output",
+      "target": "Graph from molecule similarity 1",
+      "targetHandle": "bundle"
+    },
+    {
+      "id": "Graph from molecule similarity 1 Visualize graph 1",
+      "source": "Graph from molecule similarity 1",
+      "sourceHandle": "output",
+      "target": "Visualize graph 1",
+      "targetHandle": "graph"
+    },
+    {
+      "id": "Graph from molecule similarity 1 Cypher 1",
+      "source": "Graph from molecule similarity 1",
+      "sourceHandle": "output",
+      "target": "Cypher 1",
+      "targetHandle": "bundle"
+    },
+    {
+      "id": "Cypher 1 View tables 1",
+      "source": "Cypher 1",
+      "sourceHandle": "output",
+      "target": "View tables 1",
+      "targetHandle": "bundle"
+    }
+  ],
   "env": "LynxKite Graph Analytics",
   "nodes": [
     {
-      "id": "Import CSV 1",
-      "type": "basic",
       "data": {
-        "title": "Import CSV",
-        "params": {
-          "filename": "uploads/drug_target_data_sample.csv",
-          "separator": "<auto>",
-          "columns": "<from file>"
-        },
-        "display": null,
-        "error": null,
         "__execution_delay": 0.0,
         "collapsed": null,
+        "display": null,
+        "error": null,
+        "input_metadata": [],
         "meta": {
-          "params": {
-            "separator": {
-              "default": "<auto>",
+          "color": "orange",
+          "inputs": [],
+          "name": "Import CSV",
+          "outputs": [
+            {
+              "name": "output",
+              "position": "right",
               "type": {
-                "type": "<class 'str'>"
-              },
-              "name": "separator"
-            },
-            "filename": {
+                "type": "None"
+              }
+            }
+          ],
+          "params": [
+            {
               "default": null,
+              "name": "filename",
               "type": {
                 "type": "<class 'str'>"
-              },
-              "name": "filename"
+              }
             },
-            "columns": {
-              "name": "columns",
+            {
               "default": "<from file>",
+              "name": "columns",
               "type": {
                 "type": "<class 'str'>"
               }
-            }
-          },
-          "outputs": {
-            "output": {
-              "position": "right",
-              "name": "output",
+            },
+            {
+              "default": "<auto>",
+              "name": "separator",
               "type": {
-                "type": "None"
+                "type": "<class 'str'>"
               }
             }
-          },
-          "type": "basic",
-          "inputs": {},
-          "name": "Import CSV"
-        }
+          ],
+          "type": "basic"
+        },
+        "params": {
+          "columns": "<from file>",
+          "filename": "uploads/drug_target_data_sample.csv",
+          "separator": "<auto>"
+        },
+        "status": "done",
+        "title": "Import CSV"
       },
+      "dragHandle": ".bg-primary",
+      "height": 200.0,
+      "id": "Import CSV 1",
       "position": {
         "x": 300.92214591096035,
         "y": 1018.8292637889027
       },
-      "width": 200.0,
-      "height": 200.0
+      "type": "basic",
+      "width": 200.0
     },
     {
-      "id": "Parse SMILES 1",
-      "type": "basic",
       "data": {
-        "title": "Parse SMILES",
-        "params": {
-          "smiles_column": "SMILES",
-          "table": "df",
-          "save_as": "mols"
-        },
         "display": null,
         "error": null,
+        "input_metadata": [
+          {
+            "dataframes": {
+              "df": {
+                "columns": [
+                  "ACCESSION",
+                  "ACTION_TYPE",
+                  "ACT_COMMENT",
+                  "ACT_SOURCE",
+                  "ACT_SOURCE_URL",
+                  "ACT_TYPE",
+                  "ACT_UNIT",
+                  "ACT_VALUE",
+                  "DRUG_NAME",
+                  "GENE",
+                  "INN",
+                  "InChI",
+                  "InChIKey",
+                  "MOA",
+                  "MOA_SOURCE",
+                  "MOA_SOURCE_URL",
+                  "ORGANISM",
+                  "RELATION",
+                  "SMILES",
+                  "STRUCT_ID",
+                  "SWISSPROT",
+                  "TARGET_CLASS",
+                  "TARGET_NAME",
+                  "TDL",
+                  "Unnamed: 0"
+                ]
+              }
+            },
+            "other": {},
+            "relations": []
+          }
+        ],
         "meta": {
+          "color": "orange",
+          "inputs": [
+            {
+              "name": "bundle",
+              "position": "left",
+              "type": {
+                "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
+              }
+            }
+          ],
           "name": "Parse SMILES",
-          "type": "basic",
-          "params": {
-            "table": {
+          "outputs": [
+            {
+              "name": "output",
+              "position": "right",
+              "type": {
+                "type": "None"
+              }
+            }
+          ],
+          "params": [
+            {
               "default": "df",
               "name": "table",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "smiles_column": {
-              "name": "smiles_column",
+            {
               "default": "SMILES",
+              "name": "smiles_column",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "save_as": {
+            {
+              "default": "mols",
               "name": "save_as",
               "type": {
                 "type": "<class 'str'>"
-              },
-              "default": "mols"
-            }
-          },
-          "inputs": {
-            "bundle": {
-              "name": "bundle",
-              "type": {
-                "type": "<class 'lynxkite_graph_analytics.lynxkite_ops.Bundle'>"
-              },
-              "position": "left"
-            }
-          },
-          "outputs": {
-            "output": {
-              "position": "right",
-              "type": {
-                "type": "None"
-              },
-              "name": "output"
+              }
             }
-          }
-        }
+          ],
+          "type": "basic"
+        },
+        "params": {
+          "save_as": "mols",
+          "smiles_column": "SMILES",
+          "table": "df"
+        },
+        "status": "done",
+        "title": "Parse SMILES"
       },
+      "dragHandle": ".bg-primary",
+      "height": 200.0,
+      "id": "Parse SMILES 1",
       "position": {
         "x": 580.5892989328847,
         "y": 1012.8823965480503
       },
-      "width": 200.0,
-      "height": 200.0
+      "type": "basic",
+      "width": 200.0
     },
     {
-      "id": "Graph from molecule similarity 1",
-      "type": "basic",
       "data": {
-        "title": "Graph from molecule similarity",
-        "params": {
-          "table": "df",
-          "average_degree": "3",
-          "mols_column": "mols"
-        },
+        "__execution_delay": 0.0,
+        "collapsed": null,
         "display": null,
         "error": null,
+        "input_metadata": [
+          {
+            "dataframes": {
+              "df": {
+                "columns": [
+                  "ACCESSION",
+                  "ACTION_TYPE",
+                  "ACT_COMMENT",
+                  "ACT_SOURCE",
+                  "ACT_SOURCE_URL",
+                  "ACT_TYPE",
+                  "ACT_UNIT",
+                  "ACT_VALUE",
+                  "DRUG_NAME",
+                  "GENE",
+                  "INN",
+                  "InChI",
+                  "InChIKey",
+                  "MOA",
+                  "MOA_SOURCE",
+                  "MOA_SOURCE_URL",
+                  "ORGANISM",
+                  "RELATION",
+                  "SMILES",
+                  "STRUCT_ID",
+                  "SWISSPROT",
+                  "TARGET_CLASS",
+                  "TARGET_NAME",
+                  "TDL",
+                  "Unnamed: 0",
+                  "mols"
+                ]
+              }
+            },
+            "other": {},
+            "relations": []
+          }
+        ],
         "meta": {
-          "inputs": {
-            "bundle": {
-              "position": "left",
+          "color": "orange",
+          "inputs": [
+            {
               "name": "bundle",
+              "position": "left",
               "type": {
-                "type": "<class 'lynxkite_graph_analytics.lynxkite_ops.Bundle'>"
+                "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
-          "outputs": {
-            "output": {
+          ],
+          "name": "Graph from molecule similarity",
+          "outputs": [
+            {
+              "name": "output",
+              "position": "right",
               "type": {
                 "type": "None"
-              },
-              "position": "right",
-              "name": "output"
+              }
             }
-          },
-          "type": "basic",
-          "name": "Graph from molecule similarity",
-          "params": {
-            "average_degree": {
-              "default": 10.0,
-              "type": {
-                "type": "<class 'int'>"
-              },
-              "name": "average_degree"
-            },
-            "table": {
+          ],
+          "params": [
+            {
               "default": "df",
               "name": "table",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "mols_column": {
+            {
               "default": "mols",
               "name": "mols_column",
               "type": {
                 "type": "<class 'str'>"
               }
+            },
+            {
+              "default": 10,
+              "name": "average_degree",
+              "type": {
+                "type": "<class 'int'>"
+              }
             }
-          }
+          ],
+          "type": "basic"
         },
-        "collapsed": null,
-        "__execution_delay": 0.0
+        "params": {
+          "average_degree": "3",
+          "mols_column": "mols",
+          "table": "df"
+        },
+        "status": "done",
+        "title": "Graph from molecule similarity"
       },
+      "dragHandle": ".bg-primary",
+      "height": 200.0,
+      "id": "Graph from molecule similarity 1",
       "position": {
         "x": 926.4337192214458,
         "y": 1014.4451876264845
       },
-      "height": 200.0,
+      "type": "basic",
       "width": 200.0
     },
     {
-      "id": "Visualize graph 1",
-      "type": "visualization",
       "data": {
-        "title": "Visualize graph",
-        "params": {
-          "color_nodes_by": "ORGANISM",
-          "label_by": "DRUG_NAME",
-          "color_edges_by": "similarity"
-        },
+        "__execution_delay": 0.0,
+        "collapsed": null,
         "display": {
           "animationDuration": 500,
           "animationEasingUpdate": "quinticInOut",
-          "tooltip": {
-            "show": true
-          },
           "series": [
             {
-              "type": "graph",
-              "lineStyle": {
-                "color": "gray",
-                "curveness": 0.3
-              },
-              "emphasis": {
-                "focus": "adjacency",
-                "lineStyle": {
-                  "width": 10
-                }
-              },
-              "label": {
-                "position": "top",
-                "formatter": "{b}"
-              },
               "data": [
                 {
                   "id": "0",
-                  "x": -0.13734854736037372,
-                  "y": 0.0003840689616843064,
-                  "symbolSize": 22.360679774997894,
                   "itemStyle": {
                     "color": "#a6cee3"
                   },
@@ -238,13 +333,13 @@
                     "show": true
                   },
                   "name": "phencyclidine",
-                  "value": "Torpedo californica"
+                  "symbolSize": 22.360679774997894,
+                  "value": "Torpedo californica",
+                  "x": 0.10782539581500938,
+                  "y": -0.23839701129914528
                 },
                 {
                   "id": "1",
-                  "x": 0.4859426303201164,
-                  "y": -0.09785193844993345,
-                  "symbolSize": 22.360679774997894,
                   "itemStyle": {
                     "color": "#1f78b4"
                   },
@@ -252,13 +347,13 @@
                     "show": true
                   },
                   "name": "triazolam",
-                  "value": "Homo sapiens"
+                  "symbolSize": 22.360679774997894,
+                  "value": "Homo sapiens",
+                  "x": -0.10748868396434766,
+                  "y": 0.19422487376381423
                 },
                 {
                   "id": "2",
-                  "x": -0.36490537596845657,
-                  "y": 0.655747709585604,
-                  "symbolSize": 22.360679774997894,
                   "itemStyle": {
                     "color": "#1f78b4"
                   },
@@ -266,13 +361,13 @@
                     "show": true
                   },
                   "name": "gentian violet",
-                  "value": "Homo sapiens"
+                  "symbolSize": 22.360679774997894,
+                  "value": "Homo sapiens",
+                  "x": 0.32091925175898867,
+                  "y": 0.37711363327258846
                 },
                 {
                   "id": "3",
-                  "x": 0.8039553347691868,
-                  "y": 0.44172015990267444,
-                  "symbolSize": 22.360679774997894,
                   "itemStyle": {
                     "color": "#1f78b4"
                   },
@@ -280,13 +375,13 @@
                     "show": true
                   },
                   "name": "ipratropium",
-                  "value": "Homo sapiens"
+                  "symbolSize": 22.360679774997894,
+                  "value": "Homo sapiens",
+                  "x": 0.6787440363904107,
+                  "y": -0.24483461144842011
                 },
                 {
                   "id": "4",
-                  "x": -0.7876440417604583,
-                  "y": -1.0,
-                  "symbolSize": 22.360679774997894,
                   "itemStyle": {
                     "color": "#1f78b4"
                   },
@@ -294,217 +389,350 @@
                     "show": true
                   },
                   "name": "deoxycholic acid",
-                  "value": "Homo sapiens"
+                  "symbolSize": 22.360679774997894,
+                  "value": "Homo sapiens",
+                  "x": -1.0,
+                  "y": -0.08810688428883728
                 }
               ],
+              "emphasis": {
+                "focus": "adjacency",
+                "lineStyle": {
+                  "width": 10
+                }
+              },
+              "label": {
+                "formatter": "{b}",
+                "position": "top"
+              },
+              "lineStyle": {
+                "color": "gray",
+                "curveness": 0.3
+              },
               "links": [
                 {
-                  "source": "3",
-                  "target": "4",
                   "lineStyle": {
                     "color": "#440154"
                   },
-                  "value": 0.8481012658227848
+                  "source": "3",
+                  "target": "4",
+                  "value": "0.8481012658227848"
                 },
                 {
-                  "source": "0",
-                  "target": "1",
                   "lineStyle": {
                     "color": "#3a538b"
                   },
-                  "value": 0.8813559322033898
+                  "source": "0",
+                  "target": "1",
+                  "value": "0.8813559322033898"
                 },
                 {
-                  "source": "0",
-                  "target": "4",
                   "lineStyle": {
                     "color": "#3a538b"
                   },
-                  "value": 0.8813559322033898
+                  "source": "0",
+                  "target": "4",
+                  "value": "0.8813559322033898"
                 },
                 {
-                  "source": "0",
-                  "target": "3",
                   "lineStyle": {
                     "color": "#26818e"
                   },
-                  "value": 0.9047619047619048
+                  "source": "0",
+                  "target": "3",
+                  "value": "0.9047619047619048"
                 },
                 {
-                  "source": "1",
-                  "target": "2",
                   "lineStyle": {
                     "color": "#23898d"
                   },
-                  "value": 0.9090909090909091
+                  "source": "1",
+                  "target": "2",
+                  "value": "0.9090909090909091"
                 },
                 {
-                  "source": "1",
-                  "target": "3",
                   "lineStyle": {
                     "color": "#1ea087"
                   },
-                  "value": 0.921875
+                  "source": "1",
+                  "target": "3",
+                  "value": "0.921875"
                 },
                 {
-                  "source": "0",
-                  "target": "2",
                   "lineStyle": {
                     "color": "#3ebc73"
                   },
-                  "value": 0.9375
+                  "source": "0",
+                  "target": "2",
+                  "value": "0.9375"
                 },
                 {
-                  "source": "1",
-                  "target": "4",
                   "lineStyle": {
                     "color": "#4fc369"
                   },
-                  "value": 0.9420289855072463
+                  "source": "1",
+                  "target": "4",
+                  "value": "0.9420289855072463"
                 },
                 {
-                  "source": "2",
-                  "target": "4",
                   "lineStyle": {
                     "color": "#9fd938"
                   },
-                  "value": 0.9589041095890412
+                  "source": "2",
+                  "target": "4",
+                  "value": "0.9589041095890412"
                 },
                 {
-                  "source": "2",
-                  "target": "3",
                   "lineStyle": {
                     "color": "#fde724"
                   },
-                  "value": 0.9775280898876404
+                  "source": "2",
+                  "target": "3",
+                  "value": "0.9775280898876404"
                 }
-              ]
+              ],
+              "type": "graph"
             }
-          ]
+          ],
+          "tooltip": {
+            "show": true
+          }
         },
         "error": null,
-        "__execution_delay": 0.0,
-        "collapsed": null,
+        "input_metadata": [
+          {
+            "dataframes": {
+              "edges": {
+                "columns": [
+                  "similarity",
+                  "source",
+                  "target"
+                ]
+              },
+              "nodes": {
+                "columns": [
+                  "ACCESSION",
+                  "ACTION_TYPE",
+                  "ACT_COMMENT",
+                  "ACT_SOURCE",
+                  "ACT_SOURCE_URL",
+                  "ACT_TYPE",
+                  "ACT_UNIT",
+                  "ACT_VALUE",
+                  "DRUG_NAME",
+                  "GENE",
+                  "INN",
+                  "InChI",
+                  "InChIKey",
+                  "MOA",
+                  "MOA_SOURCE",
+                  "MOA_SOURCE_URL",
+                  "ORGANISM",
+                  "RELATION",
+                  "SMILES",
+                  "STRUCT_ID",
+                  "SWISSPROT",
+                  "TARGET_CLASS",
+                  "TARGET_NAME",
+                  "TDL",
+                  "Unnamed: 0",
+                  "mols"
+                ]
+              }
+            },
+            "other": {},
+            "relations": [
+              {
+                "df": "edges",
+                "name": null,
+                "source_column": "source",
+                "source_key": "id",
+                "source_table": "nodes",
+                "target_column": "target",
+                "target_key": "id",
+                "target_table": "nodes"
+              }
+            ]
+          }
+        ],
         "meta": {
-          "params": {
-            "label_by": {
+          "color": "orange",
+          "inputs": [
+            {
+              "name": "graph",
+              "position": "left",
+              "type": {
+                "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
+              }
+            }
+          ],
+          "name": "Visualize graph",
+          "outputs": [],
+          "params": [
+            {
+              "default": null,
+              "name": "color_nodes_by",
               "type": {
                 "format": "node attribute"
-              },
-              "name": "label_by",
-              "default": null
+              }
             },
-            "color_nodes_by": {
+            {
+              "default": null,
+              "name": "label_by",
               "type": {
                 "format": "node attribute"
-              },
-              "name": "color_nodes_by",
-              "default": null
+              }
             },
-            "color_edges_by": {
+            {
+              "default": null,
               "name": "color_edges_by",
               "type": {
                 "format": "edge attribute"
-              },
-              "default": null
-            }
-          },
-          "inputs": {
-            "graph": {
-              "type": {
-                "type": "<class 'lynxkite_graph_analytics.lynxkite_ops.Bundle'>"
-              },
-              "name": "graph",
-              "position": "left"
+              }
             }
-          },
-          "outputs": {},
-          "position": {
-            "y": 167.0,
-            "x": 883.0
-          },
-          "type": "visualization",
-          "name": "Visualize graph"
-        }
+          ],
+          "type": "visualization"
+        },
+        "params": {
+          "color_edges_by": "similarity",
+          "color_nodes_by": "ORGANISM",
+          "label_by": "DRUG_NAME"
+        },
+        "status": "done",
+        "title": "Visualize graph"
       },
+      "dragHandle": ".bg-primary",
+      "height": 314.0,
+      "id": "Visualize graph 1",
       "position": {
         "x": 1254.2277640235457,
         "y": 931.9705991370125
       },
-      "height": 314.0,
+      "type": "visualization",
       "width": 407.0
     },
     {
-      "id": "Cypher 1",
-      "type": "basic",
       "data": {
-        "title": "Cypher",
-        "params": {
-          "save_as": "result",
-          "query": "MATCH\n  (a {ORGANISM: \"Homo sapiens\"})\n  -[r]->\n  (b {ORGANISM: \"Homo sapiens\"})\nWHERE\n  r.similarity > 0.9\nRETURN a.DRUG_NAME, b.DRUG_NAME"
-        },
+        "__execution_delay": 0.0,
+        "collapsed": null,
         "display": null,
         "error": null,
-        "meta": {
-          "outputs": {
-            "output": {
-              "type": {
-                "type": "None"
+        "input_metadata": [
+          {
+            "dataframes": {
+              "edges": {
+                "columns": [
+                  "similarity",
+                  "source",
+                  "target"
+                ]
               },
-              "name": "output",
-              "position": "right"
-            }
-          },
-          "inputs": {
-            "bundle": {
-              "position": "left",
+              "nodes": {
+                "columns": [
+                  "ACCESSION",
+                  "ACTION_TYPE",
+                  "ACT_COMMENT",
+                  "ACT_SOURCE",
+                  "ACT_SOURCE_URL",
+                  "ACT_TYPE",
+                  "ACT_UNIT",
+                  "ACT_VALUE",
+                  "DRUG_NAME",
+                  "GENE",
+                  "INN",
+                  "InChI",
+                  "InChIKey",
+                  "MOA",
+                  "MOA_SOURCE",
+                  "MOA_SOURCE_URL",
+                  "ORGANISM",
+                  "RELATION",
+                  "SMILES",
+                  "STRUCT_ID",
+                  "SWISSPROT",
+                  "TARGET_CLASS",
+                  "TARGET_NAME",
+                  "TDL",
+                  "Unnamed: 0",
+                  "mols"
+                ]
+              }
+            },
+            "other": {},
+            "relations": [
+              {
+                "df": "edges",
+                "name": null,
+                "source_column": "source",
+                "source_key": "id",
+                "source_table": "nodes",
+                "target_column": "target",
+                "target_key": "id",
+                "target_table": "nodes"
+              }
+            ]
+          }
+        ],
+        "meta": {
+          "color": "orange",
+          "inputs": [
+            {
               "name": "bundle",
+              "position": "left",
               "type": {
-                "type": "<class 'lynxkite_graph_analytics.lynxkite_ops.Bundle'>"
+                "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
+          ],
           "name": "Cypher",
-          "params": {
-            "query": {
+          "outputs": [
+            {
+              "name": "output",
+              "position": "right",
+              "type": {
+                "type": "None"
+              }
+            }
+          ],
+          "params": [
+            {
               "default": null,
               "name": "query",
               "type": {
                 "format": "textarea"
               }
             },
-            "save_as": {
+            {
+              "default": "result",
+              "name": "save_as",
               "type": {
                 "type": "<class 'str'>"
-              },
-              "default": "result",
-              "name": "save_as"
+              }
             }
-          },
-          "type": "basic",
-          "position": {
-            "x": 638.0,
-            "y": 577.0
-          }
+          ],
+          "type": "basic"
         },
-        "collapsed": null,
-        "__execution_delay": 0.0
+        "params": {
+          "query": "MATCH\n  (a {ORGANISM: \"Homo sapiens\"})\n  -[r]->\n  (b {ORGANISM: \"Homo sapiens\"})\nWHERE\n  r.similarity > 0.9\nRETURN a.DRUG_NAME, b.DRUG_NAME",
+          "save_as": "result"
+        },
+        "status": "done",
+        "title": "Cypher"
       },
+      "dragHandle": ".bg-primary",
+      "height": 267.0,
+      "id": "Cypher 1",
       "position": {
         "x": 1209.2024653849007,
         "y": 1567.9825632648467
       },
-      "height": 267.0,
+      "type": "basic",
       "width": 434.0
     },
     {
-      "id": "View tables 1",
-      "type": "table_view",
       "data": {
-        "title": "View tables",
-        "params": {
-          "limit": 100.0
-        },
+        "__execution_delay": null,
+        "collapsed": null,
         "display": {
           "dataframes": {
             "edges": {
@@ -606,14 +834,14 @@
                   "CHRNA1",
                   "ACHA_TORCA",
                   6.66,
-                  null,
+                  NaN,
                   "IC50",
                   "Displacement of [3H]PCP from nAChR in Torpedo nobiliana electric organs membranes in presence of 100 uM carbachol by scintillation counting method",
                   "CHEMBL",
                   "=",
-                  null,
+                  NaN,
                   "nan",
-                  null,
+                  NaN,
                   "nan",
                   "nan",
                   "nan",
@@ -622,7 +850,7 @@
                   "InChI=1S/C17H25N/c1-4-10-16(11-5-1)17(12-6-2-7-13-17)18-14-8-3-9-15-18/h1,4-5,10-11H,2-3,6-9,12-15H2",
                   "JTJMJGYZQZDUJJ-UHFFFAOYSA-N",
                   "phencyclidine",
-                  "<rdkit.Chem.rdchem.Mol object at 0x74d424169e70>"
+                  "<rdkit.Chem.rdchem.Mol object at 0x70fb3f748120>"
                 ],
                 [
                   12934,
@@ -634,14 +862,14 @@
                   "GABRG2|GABRA3|GABRB2",
                   "GBRG2_HUMAN|GBRA3_HUMAN|GBRB2_HUMAN",
                   8.876,
-                  null,
+                  NaN,
                   "Ki",
                   "nan",
                   "WOMBAT-PK",
                   "=",
                   1.0,
                   "CHEMBL",
-                  null,
+                  NaN,
                   "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL646",
                   "POSITIVE ALLOSTERIC MODULATOR",
                   "Tclin|Tclin|Tclin|Tclin|Tclin|Tclin|Tclin|Tclin|Tclin",
@@ -650,7 +878,7 @@
                   "InChI=1S/C17H12Cl2N4/c1-10-21-22-16-9-20-17(12-4-2-3-5-14(12)19)13-8-11(18)6-7-15(13)23(10)16/h2-8H,9H2,1H3",
                   "JOFWLTCLBGQGBO-UHFFFAOYSA-N",
                   "triazolam",
-                  "<rdkit.Chem.rdchem.Mol object at 0x74d42416ab20>"
+                  "<rdkit.Chem.rdchem.Mol object at 0x70fb3f748430>"
                 ],
                 [
                   15266,
@@ -662,14 +890,14 @@
                   "DRD2",
                   "DRD2_HUMAN",
                   5.975,
-                  null,
+                  NaN,
                   "Ki",
                   "DRUGMATRIX: Dopamine D2L radioligand binding (ligand: [3H] Spiperone)",
                   "DRUG MATRIX",
                   "=",
-                  null,
+                  NaN,
                   "nan",
-                  null,
+                  NaN,
                   "nan",
                   "nan",
                   "Tclin",
@@ -678,7 +906,7 @@
                   "InChI=1S/C25H30N3/c1-26(2)22-13-7-19(8-14-22)25(20-9-15-23(16-10-20)27(3)4)21-11-17-24(18-12-21)28(5)6/h7-18H,1-6H3/q+1",
                   "LGLFFNDHMLKUMI-UHFFFAOYSA-N",
                   "gentian violet",
-                  "<rdkit.Chem.rdchem.Mol object at 0x74d424169070>"
+                  "<rdkit.Chem.rdchem.Mol object at 0x70fb3f7483c0>"
                 ],
                 [
                   6488,
@@ -690,14 +918,14 @@
                   "CHRM1",
                   "ACM1_HUMAN",
                   9.31,
-                  null,
+                  NaN,
                   "Ki",
                   "nan",
                   "WOMBAT-PK",
                   "=",
-                  null,
+                  NaN,
                   "nan",
-                  null,
+                  NaN,
                   "nan",
                   "nan",
                   "Tclin",
@@ -706,7 +934,7 @@
                   "InChI=1S/C20H30NO3/c1-14(2)21(3)16-9-10-17(21)12-18(11-16)24-20(23)19(13-22)15-7-5-4-6-8-15/h4-8,14,16-19,22H,9-13H2,1-3H3/q+1/t16-,17+,18+,19?,21?",
                   "OEXHQOGQTVQTAT-BHIXFJMTSA-N",
                   "ipratropium",
-                  "<rdkit.Chem.rdchem.Mol object at 0x74d42416a7a0>"
+                  "<rdkit.Chem.rdchem.Mol object at 0x70fb3f7484a0>"
                 ],
                 [
                   17453,
@@ -718,14 +946,14 @@
                   "GPBAR1",
                   "GPBAR_HUMAN",
                   6.2,
-                  null,
+                  NaN,
                   "EC50",
                   "nan",
                   "IUPHAR",
                   "=",
-                  null,
+                  NaN,
                   "nan",
-                  null,
+                  NaN,
                   "nan",
                   "AGONIST",
                   "Tchem",
@@ -734,7 +962,7 @@
                   "InChI=1S/C24H40O4/c1-14(4-9-22(27)28)18-7-8-19-17-6-5-15-12-16(25)10-11-23(15,2)20(17)13-21(26)24(18,19)3/h14-21,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15-,16-,17+,18-,19+,20+,21+,23+,24-/m1/s1",
                   "KXGVEGMKQFWNSR-LLQZFEROSA-N",
                   "deoxycholic acid",
-                  "<rdkit.Chem.rdchem.Mol object at 0x74d424168890>"
+                  "<rdkit.Chem.rdchem.Mol object at 0x70fb3f748510>"
                 ]
               ]
             },
@@ -767,91 +995,125 @@
               ]
             }
           },
+          "other": {},
           "relations": [
             {
               "df": "edges",
+              "name": null,
               "source_column": "source",
-              "target_column": "target",
-              "source_table": "nodes",
-              "target_table": "nodes",
               "source_key": "id",
-              "target_key": "id"
+              "source_table": "nodes",
+              "target_column": "target",
+              "target_key": "id",
+              "target_table": "nodes"
             }
-          ],
-          "other": null
+          ]
         },
         "error": null,
-        "meta": {
-          "params": {
-            "limit": {
-              "default": 100.0,
-              "name": "limit",
-              "type": {
-                "type": "<class 'int'>"
+        "input_metadata": [
+          {
+            "dataframes": {
+              "edges": {
+                "columns": [
+                  "similarity",
+                  "source",
+                  "target"
+                ]
+              },
+              "nodes": {
+                "columns": [
+                  "ACCESSION",
+                  "ACTION_TYPE",
+                  "ACT_COMMENT",
+                  "ACT_SOURCE",
+                  "ACT_SOURCE_URL",
+                  "ACT_TYPE",
+                  "ACT_UNIT",
+                  "ACT_VALUE",
+                  "DRUG_NAME",
+                  "GENE",
+                  "INN",
+                  "InChI",
+                  "InChIKey",
+                  "MOA",
+                  "MOA_SOURCE",
+                  "MOA_SOURCE_URL",
+                  "ORGANISM",
+                  "RELATION",
+                  "SMILES",
+                  "STRUCT_ID",
+                  "SWISSPROT",
+                  "TARGET_CLASS",
+                  "TARGET_NAME",
+                  "TDL",
+                  "Unnamed: 0",
+                  "mols"
+                ]
+              },
+              "result": {
+                "columns": [
+                  "a.DRUG_NAME",
+                  "b.DRUG_NAME"
+                ]
               }
-            }
-          },
-          "inputs": {
-            "bundle": {
+            },
+            "other": {},
+            "relations": [
+              {
+                "df": "edges",
+                "name": null,
+                "source_column": "source",
+                "source_key": "id",
+                "source_table": "nodes",
+                "target_column": "target",
+                "target_key": "id",
+                "target_table": "nodes"
+              }
+            ]
+          }
+        ],
+        "meta": {
+          "color": "orange",
+          "inputs": [
+            {
               "name": "bundle",
               "position": "left",
               "type": {
-                "type": "<class 'lynxkite_graph_analytics.lynxkite_ops.Bundle'>"
+                "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
-          "position": {
-            "x": 1183.0,
-            "y": 534.0
-          },
+          ],
           "name": "View tables",
-          "outputs": {},
+          "outputs": [],
+          "params": [
+            {
+              "default": 100,
+              "name": "limit",
+              "type": {
+                "type": "<class 'int'>"
+              }
+            }
+          ],
           "type": "table_view"
-        }
+        },
+        "params": {
+          "_tables_open": {
+            "result": true
+          },
+          "limit": 100.0
+        },
+        "status": "done",
+        "title": "View tables"
       },
+      "dragHandle": ".bg-primary",
+      "height": 295.0,
+      "id": "View tables 1",
       "position": {
         "x": 1817.1767094971015,
         "y": 1459.025582190881
       },
-      "width": 322.0,
-      "height": 295.0
-    }
-  ],
-  "edges": [
-    {
-      "id": "Import CSV 1 Parse SMILES 1",
-      "source": "Import CSV 1",
-      "target": "Parse SMILES 1",
-      "sourceHandle": "output",
-      "targetHandle": "bundle"
-    },
-    {
-      "id": "Parse SMILES 1 Graph from molecule similarity 1",
-      "source": "Parse SMILES 1",
-      "target": "Graph from molecule similarity 1",
-      "sourceHandle": "output",
-      "targetHandle": "bundle"
-    },
-    {
-      "id": "Graph from molecule similarity 1 Visualize graph 1",
-      "source": "Graph from molecule similarity 1",
-      "target": "Visualize graph 1",
-      "sourceHandle": "output",
-      "targetHandle": "graph"
-    },
-    {
-      "id": "Graph from molecule similarity 1 Cypher 1",
-      "source": "Graph from molecule similarity 1",
-      "target": "Cypher 1",
-      "sourceHandle": "output",
-      "targetHandle": "bundle"
-    },
-    {
-      "id": "Cypher 1 View tables 1",
-      "source": "Cypher 1",
-      "target": "View tables 1",
-      "sourceHandle": "output",
-      "targetHandle": "bundle"
+      "type": "table_view",
+      "width": 322.0
     }
   ]
 }

examples/BioNeMo demo.lynxkite.json

@@ -115,26 +115,26 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "BioNeMo > Import H5AD file",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "file_path": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "file_path",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "position": {
             "x": 504.0,
             "y": 355.0
@@ -162,26 +162,26 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {
-            "adata": {
+          "inputs": [
+            {
               "name": "adata",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "BioNeMo > Get labels",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {},
+          ],
+          "params": [],
           "position": {
             "x": 389.0,
             "y": 633.0
@@ -209,26 +209,26 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "BioNeMo > Download model",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "model_name": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "model_name",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "position": {
             "x": 1026.0,
             "y": 839.0
@@ -258,26 +258,26 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "BioNeMo > Download model",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "model_name": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "model_name",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "position": {
             "x": 939.0,
             "y": 523.0
@@ -307,61 +307,61 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "BioNeMo > Download CELLxGENE dataset",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "census_version": {
+          ],
+          "params": [
+            {
               "default": "2023-12-15",
               "name": "census_version",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "max_workers": {
+            {
               "default": 1.0,
               "name": "max_workers",
               "type": {
                 "type": "<class 'int'>"
               }
             },
-            "organism": {
+            {
               "default": "Homo sapiens",
               "name": "organism",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "save_path": {
+            {
               "default": null,
               "name": "save_path",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "use_mp": {
+            {
               "default": false,
               "name": "use_mp",
               "type": {
                 "type": "<class 'bool'>"
               }
             },
-            "value_filter": {
+            {
               "default": "dataset_id==\"8e47ed12-c658-4252-b126-381df8d52a3d\"",
               "name": "value_filter",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "position": {
             "x": 1020.0,
             "y": 262.0
@@ -396,41 +396,41 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {
-            "dataset_path": {
+          "inputs": [
+            {
               "name": "dataset_path",
               "position": "left",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "model_path": {
+            {
               "name": "model_path",
               "position": "left",
               "type": {
                 "type": "str | None"
               }
             }
-          },
+          ],
           "name": "BioNeMo > Infer",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "results_path": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "results_path",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "position": {
             "x": 1544.0,
             "y": 356.0
@@ -460,41 +460,41 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {
-            "dataset_path": {
+          "inputs": [
+            {
               "name": "dataset_path",
               "position": "left",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "model_path": {
+            {
               "name": "model_path",
               "position": "left",
               "type": {
                 "type": "str | None"
               }
             }
-          },
+          ],
           "name": "BioNeMo > Infer",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "results_path": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "results_path",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "position": {
             "x": 1256.0,
             "y": 1005.0
@@ -522,26 +522,26 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {
-            "results_path": {
+          "inputs": [
+            {
               "name": "results_path",
               "position": "left",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "name": "BioNeMo > Load results",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {},
+          ],
+          "params": [],
           "position": {
             "x": 1506.0,
             "y": 804.0
@@ -567,41 +567,41 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {
-            "data": {
+          "inputs": [
+            {
               "name": "data",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             },
-            "labels": {
+            {
               "name": "labels",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "BioNeMo > Run benchmark",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "use_pca": {
+          ],
+          "params": [
+            {
               "default": false,
               "name": "use_pca",
               "type": {
                 "type": "<class 'bool'>"
               }
             }
-          },
+          ],
           "position": {
             "x": 1698.0,
             "y": 929.0
@@ -629,26 +629,26 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {
-            "results_path": {
+          "inputs": [
+            {
               "name": "results_path",
               "position": "left",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "name": "BioNeMo > Load results",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {},
+          ],
+          "params": [],
           "position": {
             "x": 1314.0,
             "y": 286.0
@@ -674,41 +674,41 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {
-            "data": {
+          "inputs": [
+            {
               "name": "data",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             },
-            "labels": {
+            {
               "name": "labels",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "BioNeMo > Run benchmark",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "use_pca": {
+          ],
+          "params": [
+            {
               "default": false,
               "name": "use_pca",
               "type": {
                 "type": "<class 'bool'>"
               }
             }
-          },
+          ],
           "position": {
             "x": 1576.0,
             "y": 395.0
@@ -817,25 +817,25 @@
         },
         "error": null,
         "meta": {
-          "inputs": {
-            "benchmark_output100m": {
+          "inputs": [
+            {
               "name": "benchmark_output100m",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             },
-            "benchmark_output10m": {
+            {
               "name": "benchmark_output10m",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "BioNeMo > Plot f1 comparison",
-          "outputs": {},
-          "params": {},
+          "outputs": [],
+          "params": [],
           "position": {
             "x": 1716.0,
             "y": 309.0
@@ -942,25 +942,25 @@
         },
         "error": null,
         "meta": {
-          "inputs": {
-            "benchmark_output100m": {
+          "inputs": [
+            {
               "name": "benchmark_output100m",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             },
-            "benchmark_output10m": {
+            {
               "name": "benchmark_output10m",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "BioNeMo > Plot accuracy comparison",
-          "outputs": {},
-          "params": {},
+          "outputs": [],
+          "params": [],
           "position": {
             "x": 1574.0,
             "y": 720.0

examples/Generative drug screening.lynxkite.json

@@ -60,19 +60,19 @@
         "error": null,
         "input_metadata": [],
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "Import file",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "file_format": {
+          ],
+          "params": [
+            {
               "default": "csv",
               "groups": {
                 "csv": [
@@ -118,21 +118,21 @@
               },
               "type": "group"
             },
-            "file_path": {
+            {
               "default": null,
               "name": "file_path",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "table_name": {
+            {
               "default": null,
               "name": "table_name",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -163,19 +163,19 @@
         "error": null,
         "input_metadata": [],
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "Import file",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "file_format": {
+          ],
+          "params": [
+            {
               "default": "csv",
               "groups": {
                 "csv": [
@@ -221,21 +221,21 @@
               },
               "type": "group"
             },
-            "file_path": {
+            {
               "default": null,
               "name": "file_path",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "table_name": {
+            {
               "default": null,
               "name": "table_name",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -278,76 +278,76 @@
           }
         ],
         "meta": {
-          "inputs": {
-            "bundle": {
+          "inputs": [
+            {
               "name": "bundle",
               "position": "left",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
+          ],
           "name": "Query GenMol",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "molecule_column": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "molecule_column",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "molecule_table": {
+            {
               "default": null,
               "name": "molecule_table",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "noise": {
+            {
               "default": 0.2,
               "name": "noise",
               "type": {
                 "type": "<class 'float'>"
               }
             },
-            "num_molecules": {
+            {
               "default": 5.0,
               "name": "num_molecules",
               "type": {
                 "type": "<class 'int'>"
               }
             },
-            "scoring": {
+            {
               "default": "QED",
               "name": "scoring",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "step_size": {
+            {
               "default": 4.0,
               "name": "step_size",
               "type": {
                 "type": "<class 'int'>"
               }
             },
-            "temperature": {
+            {
               "default": 1.0,
               "name": "temperature",
               "type": {
                 "type": "<class 'float'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -409,90 +409,90 @@
           }
         ],
         "meta": {
-          "inputs": {
-            "ligands": {
+          "inputs": [
+            {
               "name": "ligands",
               "position": "left",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             },
-            "proteins": {
+            {
               "name": "proteins",
               "position": "left",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
+          ],
           "name": "Query DiffDock",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "ligand_column": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "ligand_column",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "ligand_file_type": {
+            {
               "default": "txt",
               "name": "ligand_file_type",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "ligand_table": {
+            {
               "default": null,
               "name": "ligand_table",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "num_poses": {
+            {
               "default": 10.0,
               "name": "num_poses",
               "type": {
                 "type": "<class 'int'>"
               }
             },
-            "num_steps": {
+            {
               "default": 18.0,
               "name": "num_steps",
               "type": {
                 "type": "<class 'int'>"
               }
             },
-            "protein_column": {
+            {
               "default": null,
               "name": "protein_column",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "protein_table": {
+            {
               "default": null,
               "name": "protein_table",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "time_divisions": {
+            {
               "default": 20.0,
               "name": "time_divisions",
               "type": {
                 "type": "<class 'int'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -538,69 +538,69 @@
           }
         ],
         "meta": {
-          "inputs": {
-            "bundle": {
+          "inputs": [
+            {
               "name": "bundle",
               "position": "left",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
+          ],
           "name": "Query OpenFold2",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "alignment_column": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "alignment_column",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "alignment_table": {
+            {
               "default": null,
               "name": "alignment_table",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "protein_column": {
+            {
               "default": null,
               "name": "protein_column",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "protein_table": {
+            {
               "default": null,
               "name": "protein_table",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "relax_prediction": {
+            {
               "default": false,
               "name": "relax_prediction",
               "type": {
                 "type": "<class 'bool'>"
               }
             },
-            "selected_models": {
+            {
               "default": "1,2",
               "name": "selected_models",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -706,26 +706,26 @@
           }
         ],
         "meta": {
-          "inputs": {
-            "bundle": {
+          "inputs": [
+            {
               "name": "bundle",
               "position": "left",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
+          ],
           "name": "View tables",
-          "outputs": {},
-          "params": {
-            "limit": {
+          "outputs": [],
+          "params": [
+            {
               "default": 100.0,
               "name": "limit",
               "type": {
                 "type": "<class 'int'>"
               }
             }
-          },
+          ],
           "position": {
             "x": 1260.0,
             "y": 768.0
@@ -768,76 +768,76 @@
           }
         ],
         "meta": {
-          "inputs": {
-            "bundle": {
+          "inputs": [
+            {
               "name": "bundle",
               "position": "left",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
+          ],
           "name": "MSA-search",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "databases": {
+          ],
+          "params": [
+            {
               "default": "Uniref30_2302,colabfold_envdb_202108",
               "name": "databases",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "e_value": {
+            {
               "default": 0.0001,
               "name": "e_value",
               "type": {
                 "type": "<class 'float'>"
               }
             },
-            "iterations": {
+            {
               "default": 1.0,
               "name": "iterations",
               "type": {
                 "type": "<class 'int'>"
               }
             },
-            "output_alignment_formats": {
+            {
               "default": "a3m",
               "name": "output_alignment_formats",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "protein_column": {
+            {
               "default": null,
               "name": "protein_column",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "protein_table": {
+            {
               "default": null,
               "name": "protein_table",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "search_type": {
+            {
               "default": "alphafold2",
               "name": "search_type",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "position": {
             "x": 774.0,
             "y": 313.0
@@ -894,40 +894,40 @@
           }
         ],
         "meta": {
-          "inputs": {
-            "bundle": {
+          "inputs": [
+            {
               "name": "bundle",
               "position": "left",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
+          ],
           "name": "View molecule",
-          "outputs": {},
-          "params": {
-            "molecule_column": {
+          "outputs": [],
+          "params": [
+            {
               "default": null,
               "name": "molecule_column",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "molecule_table": {
+            {
               "default": null,
               "name": "molecule_table",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "row_index": {
+            {
               "default": 0.0,
               "name": "row_index",
               "type": {
                 "type": "<class 'int'>"
               }
             }
-          },
+          ],
           "position": {
             "x": 768.0,
             "y": 333.0

examples/Graph RAG.lynxkite.json

@@ -1,56 +1,153 @@
 {
+  "edges": [
+    {
+      "id": "xy-edge__Input document 1output-Split document 1input",
+      "source": "Input document 1",
+      "sourceHandle": "output",
+      "target": "Split document 1",
+      "targetHandle": "input"
+    },
+    {
+      "id": "xy-edge__Split document 1output-View 1input",
+      "source": "Split document 1",
+      "sourceHandle": "output",
+      "target": "View 1",
+      "targetHandle": "input"
+    },
+    {
+      "id": "xy-edge__Input chat 1output-RAG 1input",
+      "source": "Input chat 1",
+      "sourceHandle": "output",
+      "target": "RAG 1",
+      "targetHandle": "input"
+    },
+    {
+      "id": "xy-edge__Split document 1output-RAG 1db",
+      "source": "Split document 1",
+      "sourceHandle": "output",
+      "target": "RAG 1",
+      "targetHandle": "db"
+    },
+    {
+      "id": "xy-edge__RAG 1output-View 3input",
+      "source": "RAG 1",
+      "sourceHandle": "output",
+      "target": "View 3",
+      "targetHandle": "input"
+    },
+    {
+      "id": "xy-edge__Create prompt 1output-Ask LLM 1input",
+      "source": "Create prompt 1",
+      "sourceHandle": "output",
+      "target": "Ask LLM 1",
+      "targetHandle": "input"
+    },
+    {
+      "id": "xy-edge__Ask LLM 1output-View 4input",
+      "source": "Ask LLM 1",
+      "sourceHandle": "output",
+      "target": "View 4",
+      "targetHandle": "input"
+    },
+    {
+      "id": "xy-edge__RAG 1output-Add neighbors 1item",
+      "source": "RAG 1",
+      "sourceHandle": "output",
+      "target": "Add neighbors 1",
+      "targetHandle": "item"
+    },
+    {
+      "id": "xy-edge__Add neighbors 1output-Create prompt 1input",
+      "source": "Add neighbors 1",
+      "sourceHandle": "output",
+      "target": "Create prompt 1",
+      "targetHandle": "input"
+    },
+    {
+      "id": "xy-edge__Split document 1output-Build document graph 1input",
+      "source": "Split document 1",
+      "sourceHandle": "output",
+      "target": "Build document graph 1",
+      "targetHandle": "input"
+    },
+    {
+      "id": "xy-edge__Split document 1output-Add neighbors 1nodes",
+      "source": "Split document 1",
+      "sourceHandle": "output",
+      "target": "Add neighbors 1",
+      "targetHandle": "nodes"
+    },
+    {
+      "id": "xy-edge__Split document 1output-Predict links 1nodes",
+      "source": "Split document 1",
+      "sourceHandle": "output",
+      "target": "Predict links 1",
+      "targetHandle": "nodes"
+    },
+    {
+      "id": "xy-edge__Build document graph 1output-Predict links 1edges",
+      "source": "Build document graph 1",
+      "sourceHandle": "output",
+      "target": "Predict links 1",
+      "targetHandle": "edges"
+    },
+    {
+      "id": "xy-edge__Predict links 1output-Add neighbors 1edges",
+      "source": "Predict links 1",
+      "sourceHandle": "output",
+      "target": "Add neighbors 1",
+      "targetHandle": "edges"
+    }
+  ],
   "env": "LLM logic",
   "nodes": [
     {
-      "id": "Input document 1",
-      "type": "basic",
       "data": {
-        "title": "Input document",
-        "params": {
-          "filename": "uploads/example-pizza.md"
-        },
+        "__execution_delay": 0.0,
+        "collapsed": null,
         "display": null,
         "error": null,
-        "__execution_delay": 0.0,
         "meta": {
-          "type": "basic",
-          "params": {
-            "filename": {
-              "type": {
-                "format": "path"
-              },
-              "name": "filename",
-              "default": null
-            }
-          },
-          "inputs": {},
+          "inputs": [],
           "name": "Input document",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
+              "position": "right",
               "type": {
                 "type": "None"
-              },
-              "position": "right"
+              }
             }
-          }
+          ],
+          "params": [
+            {
+              "default": null,
+              "name": "filename",
+              "type": {
+                "format": "path"
+              }
+            }
+          ],
+          "type": "basic"
+        },
+        "params": {
+          "filename": "uploads/example-pizza.md"
         },
-        "collapsed": null
+        "title": "Input document"
       },
+      "height": 217.0,
+      "id": "Input document 1",
+      "parentId": null,
       "position": {
         "x": -1138.7178641442829,
         "y": -307.0280242240266
       },
-      "parentId": null,
-      "width": 290.0,
-      "height": 217.0
+      "type": "basic",
+      "width": 290.0
     },
     {
-      "id": "View 1",
-      "type": "table_view",
       "data": {
-        "title": "View",
-        "params": {},
+        "beingResized": false,
         "display": {
           "dataframes": {
             "df": {
@@ -122,7 +219,7 @@
                   "Specialty pizzas include a combination of premium toppings and are available in all sizes. Prices below are for Medium size, with additional costs for upgrading to larger sizes."
                 ],
                 [
-                  "| Pizza Name           | Description                                        | Price (Medium)  |\n|----------------------|----------------------------------------------------|-----------------|\n| Meat Lover’s          | Pepperoni, sausage, bacon, ham                     | $16.99          |\n| Veggie Delight        | Mushrooms, bell peppers, onions, olives            | $14.99          |\n| BBQ Chicken           | BBQ sauce, grilled chicken, red onions, cilantro   | $17.99          |\n| Margherita            | Fresh mozzarella, tomatoes, basil                  | $15.99          |\n| Hawaiian              | Ham, pineapple                                     | $14.99          |"
+                  "| Pizza Name           | Description                                        | Price (Medium)  |\n|----------------------|----------------------------------------------------|-----------------|\n| Meat Lover\u2019s          | Pepperoni, sausage, bacon, ham                     | $16.99          |\n| Veggie Delight        | Mushrooms, bell peppers, onions, olives            | $14.99          |\n| BBQ Chicken           | BBQ sauce, grilled chicken, red onions, cilantro   | $17.99          |\n| Margherita            | Fresh mozzarella, tomatoes, basil                  | $15.99          |\n| Hawaiian              | Ham, pineapple                                     | $14.99          |"
                 ],
                 [
                   "---"
@@ -190,275 +287,275 @@
         },
         "error": null,
         "meta": {
-          "name": "View",
-          "inputs": {
-            "input": {
+          "inputs": [
+            {
               "name": "input",
+              "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
-              },
-              "position": "left"
+              }
             }
-          },
-          "outputs": {},
-          "params": {},
+          ],
+          "name": "View",
+          "outputs": [],
+          "params": [],
           "type": "table_view"
         },
-        "beingResized": false
+        "params": {},
+        "title": "View"
       },
+      "height": 367.0,
+      "id": "View 1",
+      "parentId": null,
       "position": {
         "x": 320.42256477431704,
         "y": -562.3096858852143
       },
-      "parentId": null,
-      "width": 909.0,
-      "height": 367.0
+      "type": "table_view",
+      "width": 909.0
     },
     {
-      "id": "Split document 1",
-      "type": "basic",
       "data": {
-        "title": "Split document",
-        "params": {
-          "delimiter": "\\n\\n"
-        },
         "display": null,
         "error": null,
         "meta": {
-          "params": {
-            "delimiter": {
-              "name": "delimiter",
-              "type": {
-                "type": "<class 'str'>"
-              },
-              "default": "\\n\\n"
-            }
-          },
-          "type": "basic",
-          "inputs": {
-            "input": {
+          "inputs": [
+            {
+              "name": "input",
+              "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
-              },
-              "position": "left",
-              "name": "input"
+              }
             }
-          },
+          ],
           "name": "Split document",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
+              "position": "right",
               "type": {
                 "type": "None"
-              },
-              "position": "right"
+              }
             }
-          }
-        }
+          ],
+          "params": [
+            {
+              "default": "\\n\\n",
+              "name": "delimiter",
+              "type": {
+                "type": "<class 'str'>"
+              }
+            }
+          ],
+          "type": "basic"
+        },
+        "params": {
+          "delimiter": "\\n\\n"
+        },
+        "title": "Split document"
       },
+      "height": 200.0,
+      "id": "Split document 1",
+      "parentId": null,
       "position": {
         "x": -671.5138580866221,
         "y": -394.5831190981944
       },
-      "parentId": null,
-      "height": 200.0,
+      "type": "basic",
       "width": 200.0
     },
     {
-      "id": "Input chat 1",
-      "type": "basic",
       "data": {
-        "title": "Input chat",
-        "params": {
-          "chat": "What's your cheapest drink?"
-        },
+        "__execution_delay": 0.0,
+        "beingResized": false,
+        "collapsed": null,
         "display": null,
         "error": null,
-        "__execution_delay": 0.0,
         "meta": {
-          "type": "basic",
+          "inputs": [],
           "name": "Input chat",
-          "params": {
-            "chat": {
-              "name": "chat",
-              "default": null,
+          "outputs": [
+            {
+              "name": "output",
+              "position": "right",
               "type": {
-                "type": "<class 'str'>"
+                "type": "None"
               }
             }
-          },
-          "inputs": {},
-          "outputs": {
-            "output": {
-              "position": "right",
+          ],
+          "params": [
+            {
+              "default": null,
+              "name": "chat",
               "type": {
-                "type": "None"
-              },
-              "name": "output"
+                "type": "<class 'str'>"
+              }
             }
-          }
+          ],
+          "type": "basic"
         },
-        "collapsed": null,
-        "beingResized": false
+        "params": {
+          "chat": "What's your cheapest drink?"
+        },
+        "title": "Input chat"
       },
+      "height": 197.0,
+      "id": "Input chat 1",
+      "parentId": null,
       "position": {
         "x": -1169.0221491975267,
         "y": 142.6860253469853
       },
-      "parentId": null,
-      "width": 347.0,
-      "height": 197.0
+      "type": "basic",
+      "width": 347.0
     },
     {
-      "id": "Create prompt 1",
-      "type": "basic",
       "data": {
-        "title": "Create prompt",
-        "params": {
-          "template": "\n{% for item in rag %}\n---\n{{item}}\n{% endfor %}\n---\nIs the information above sufficient to answer the following question?\n- {{text}}\n\nIf the information is insufficient please say so. Otherwise, provide the answer.",
-          "save_as": "prompt"
-        },
+        "__execution_delay": 0.0,
+        "collapsed": null,
         "display": null,
         "error": null,
-        "collapsed": null,
-        "__execution_delay": 0.0,
         "meta": {
-          "name": "Create prompt",
-          "inputs": {
-            "input": {
+          "inputs": [
+            {
+              "name": "input",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
-              },
-              "name": "input"
+              }
             }
-          },
-          "outputs": {
-            "output": {
+          ],
+          "name": "Create prompt",
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "save_as": {
+          ],
+          "params": [
+            {
+              "default": "prompt",
+              "name": "save_as",
               "type": {
                 "type": "<class 'str'>"
-              },
-              "default": "prompt",
-              "name": "save_as"
+              }
             },
-            "template": {
+            {
               "default": null,
+              "name": "template",
               "type": {
                 "format": "textarea"
-              },
-              "name": "template"
+              }
             }
-          },
+          ],
           "type": "basic"
-        }
+        },
+        "params": {
+          "save_as": "prompt",
+          "template": "\n{% for item in rag %}\n---\n{{item}}\n{% endfor %}\n---\nIs the information above sufficient to answer the following question?\n- {{text}}\n\nIf the information is insufficient please say so. Otherwise, provide the answer."
+        },
+        "title": "Create prompt"
       },
+      "height": 362.0,
+      "id": "Create prompt 1",
+      "parentId": null,
       "position": {
         "x": 324.81988008998496,
         "y": -9.071826950189632
       },
-      "height": 362.0,
-      "parentId": null,
+      "type": "basic",
       "width": 270.0
     },
     {
-      "id": "RAG 1",
-      "type": "basic",
       "data": {
-        "title": "RAG",
-        "params": {
-          "engine": "Custom",
-          "db_field": "text",
-          "input_field": "text",
-          "num_matches": "1"
-        },
         "display": null,
         "error": null,
         "meta": {
-          "name": "RAG",
-          "params": {
-            "input_field": {
-              "name": "input_field",
-              "default": "text",
+          "inputs": [
+            {
+              "name": "db",
+              "position": "top",
               "type": {
-                "type": "<class 'str'>"
+                "type": "<class 'inspect._empty'>"
               }
             },
-            "db_field": {
-              "name": "db_field",
-              "default": "text",
+            {
+              "name": "input",
+              "position": "left",
               "type": {
-                "type": "<class 'str'>"
+                "type": "<class 'inspect._empty'>"
               }
-            },
-            "engine": {
+            }
+          ],
+          "name": "RAG",
+          "outputs": [
+            {
+              "name": "output",
+              "position": "right",
+              "type": {
+                "type": "None"
+              }
+            }
+          ],
+          "params": [
+            {
+              "default": "text",
+              "name": "db_field",
+              "type": {
+                "type": "<class 'str'>"
+              }
+            },
+            {
+              "default": "RagEngine.Chroma",
+              "name": "engine",
               "type": {
                 "enum": [
                   "Chroma",
                   "Custom"
                 ]
-              },
-              "name": "engine",
-              "default": "RagEngine.Chroma"
+              }
             },
-            "num_matches": {
-              "type": {
-                "type": "<class 'int'>"
-              },
-              "name": "num_matches",
-              "default": 10.0
-            }
-          },
-          "outputs": {
-            "output": {
-              "name": "output",
-              "type": {
-                "type": "None"
-              },
-              "position": "right"
-            }
-          },
-          "inputs": {
-            "input": {
+            {
+              "default": "text",
+              "name": "input_field",
               "type": {
-                "type": "<class 'inspect._empty'>"
-              },
-              "name": "input",
-              "position": "left"
+                "type": "<class 'str'>"
+              }
             },
-            "db": {
-              "name": "db",
+            {
+              "default": 10.0,
+              "name": "num_matches",
               "type": {
-                "type": "<class 'inspect._empty'>"
-              },
-              "position": "top"
+                "type": "<class 'int'>"
+              }
             }
-          },
+          ],
           "type": "basic"
-        }
+        },
+        "params": {
+          "db_field": "text",
+          "engine": "Custom",
+          "input_field": "text",
+          "num_matches": "1"
+        },
+        "title": "RAG"
       },
+      "height": 424.0,
+      "id": "RAG 1",
+      "parentId": null,
       "position": {
         "x": -645.0268659124858,
         "y": 44.3669514323544
       },
-      "parentId": null,
-      "width": 423.0,
-      "height": 424.0
+      "type": "basic",
+      "width": 423.0
     },
     {
-      "id": "View 3",
-      "type": "table_view",
       "data": {
-        "title": "View",
-        "params": {},
+        "beingResized": false,
         "display": {
           "dataframes": {
             "df": {
@@ -478,97 +575,96 @@
           }
         },
         "error": null,
-        "beingResized": false,
         "meta": {
-          "name": "View",
-          "params": {},
-          "inputs": {
-            "input": {
+          "inputs": [
+            {
+              "name": "input",
+              "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
-              },
-              "position": "left",
-              "name": "input"
+              }
             }
-          },
-          "outputs": {},
+          ],
+          "name": "View",
+          "outputs": [],
+          "params": [],
           "type": "table_view"
-        }
+        },
+        "params": {},
+        "title": "View"
       },
+      "height": 228.0,
+      "id": "View 3",
+      "parentId": null,
       "position": {
         "x": -43.795911596608875,
         "y": 457.1809102819045
       },
-      "parentId": null,
-      "width": 296.0,
-      "height": 228.0
+      "type": "table_view",
+      "width": 296.0
     },
     {
-      "id": "Ask LLM 1",
-      "type": "basic",
       "data": {
-        "title": "Ask LLM",
-        "params": {
-          "max_tokens": 100.0,
-          "accepted_regex": ""
-        },
+        "__execution_delay": 0.0,
+        "collapsed": null,
         "display": null,
         "error": null,
-        "collapsed": null,
-        "__execution_delay": 0.0,
         "meta": {
-          "inputs": {
-            "input": {
-              "position": "left",
+          "inputs": [
+            {
               "name": "input",
+              "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
-          "params": {
-            "accepted_regex": {
+          ],
+          "name": "Ask LLM",
+          "outputs": [
+            {
+              "name": "output",
+              "position": "right",
               "type": {
-                "type": "<class 'str'>"
-              },
+                "type": "None"
+              }
+            }
+          ],
+          "params": [
+            {
               "default": null,
-              "name": "accepted_regex"
+              "name": "accepted_regex",
+              "type": {
+                "type": "<class 'str'>"
+              }
             },
-            "max_tokens": {
-              "name": "max_tokens",
+            {
               "default": 100.0,
+              "name": "max_tokens",
               "type": {
                 "type": "<class 'int'>"
               }
             }
-          },
-          "outputs": {
-            "output": {
-              "type": {
-                "type": "None"
-              },
-              "position": "right",
-              "name": "output"
-            }
-          },
-          "name": "Ask LLM",
+          ],
           "type": "basic"
-        }
+        },
+        "params": {
+          "accepted_regex": "",
+          "max_tokens": 100.0
+        },
+        "title": "Ask LLM"
       },
+      "height": 329.0,
+      "id": "Ask LLM 1",
+      "parentId": null,
       "position": {
         "x": 649.0730411878703,
         "y": 29.290926423828694
       },
-      "height": 329.0,
-      "width": 249.0,
-      "parentId": null
+      "type": "basic",
+      "width": 249.0
     },
     {
-      "id": "View 4",
-      "type": "table_view",
       "data": {
-        "title": "View",
-        "params": {},
         "display": {
           "dataframes": {
             "df": {
@@ -595,273 +691,177 @@
         },
         "error": null,
         "meta": {
-          "outputs": {},
-          "type": "table_view",
-          "params": {},
-          "inputs": {
-            "input": {
+          "inputs": [
+            {
+              "name": "input",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
-              },
-              "name": "input"
+              }
             }
-          },
-          "name": "View"
-        }
+          ],
+          "name": "View",
+          "outputs": [],
+          "params": [],
+          "type": "table_view"
+        },
+        "params": {},
+        "title": "View"
       },
+      "height": 644.0,
+      "id": "View 4",
+      "parentId": null,
       "position": {
         "x": 1017.4149773467798,
         "y": -71.64715104646865
       },
-      "height": 644.0,
-      "parentId": null,
+      "type": "table_view",
       "width": 502.0
     },
     {
-      "id": "Build document graph 1",
-      "type": "basic",
       "data": {
-        "title": "Build document graph",
-        "params": {},
+        "collapsed": true,
         "display": null,
         "error": null,
-        "collapsed": true,
         "meta": {
+          "inputs": [
+            {
+              "name": "input",
+              "position": "top",
+              "type": {
+                "type": "<class 'inspect._empty'>"
+              }
+            }
+          ],
           "name": "Build document graph",
-          "params": {},
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "inputs": {
-            "input": {
-              "position": "top",
-              "name": "input",
-              "type": {
-                "type": "<class 'inspect._empty'>"
-              }
-            }
-          },
+          ],
+          "params": [],
           "type": "basic"
-        }
+        },
+        "params": {},
+        "title": "Build document graph"
       },
+      "height": 80.0,
+      "id": "Build document graph 1",
+      "parentId": null,
       "position": {
         "x": -36.39166052931119,
         "y": -212.34993098590766
       },
-      "width": 200.0,
-      "parentId": null,
-      "height": 80.0
+      "type": "basic",
+      "width": 200.0
     },
     {
-      "id": "Add neighbors 1",
-      "type": "basic",
       "data": {
-        "title": "Add neighbors",
-        "params": {},
+        "collapsed": true,
         "display": null,
         "error": null,
         "meta": {
-          "type": "basic",
-          "inputs": {
-            "nodes": {
+          "inputs": [
+            {
+              "name": "edges",
+              "position": "top",
               "type": {
                 "type": "<class 'inspect._empty'>"
-              },
-              "name": "nodes",
-              "position": "top"
+              }
             },
-            "item": {
-              "position": "left",
+            {
               "name": "item",
+              "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             },
-            "edges": {
-              "name": "edges",
+            {
+              "name": "nodes",
               "position": "top",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
-          "params": {},
+          ],
           "name": "Add neighbors",
-          "outputs": {
-            "output": {
-              "position": "right",
+          "outputs": [
+            {
               "name": "output",
+              "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          }
+          ],
+          "params": [],
+          "type": "basic"
         },
-        "collapsed": true
+        "params": {},
+        "title": "Add neighbors"
       },
+      "height": 56.0,
+      "id": "Add neighbors 1",
+      "parentId": null,
       "position": {
         "x": -2.516468588848724,
         "y": 167.64180115746848
       },
-      "parentId": null,
-      "height": 56.0,
+      "type": "basic",
       "width": 200.0
     },
     {
-      "id": "Predict links 1",
-      "type": "basic",
       "data": {
-        "title": "Predict links",
-        "params": {},
+        "__execution_delay": null,
+        "collapsed": true,
         "display": null,
         "error": null,
-        "__execution_delay": null,
         "meta": {
-          "name": "Predict links",
-          "inputs": {
-            "edges": {
+          "inputs": [
+            {
+              "name": "edges",
+              "position": "top",
               "type": {
                 "type": "<class 'inspect._empty'>"
-              },
-              "name": "edges",
-              "position": "top"
+              }
             },
-            "nodes": {
+            {
               "name": "nodes",
               "position": "top",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
-          "type": "basic",
-          "outputs": {
-            "output": {
+          ],
+          "name": "Predict links",
+          "outputs": [
+            {
               "name": "output",
+              "position": "right",
               "type": {
                 "type": "None"
-              },
-              "position": "right"
+              }
             }
-          },
-          "params": {}
+          ],
+          "params": [],
+          "type": "basic"
         },
-        "collapsed": true
+        "params": {},
+        "title": "Predict links"
       },
+      "height": 200.0,
+      "id": "Predict links 1",
+      "parentId": null,
       "position": {
         "x": 34.865308360949726,
         "y": -37.44504613652989
       },
-      "height": 200.0,
-      "width": 200.0,
-      "parentId": null
-    }
-  ],
-  "edges": [
-    {
-      "id": "xy-edge__Input document 1output-Split document 1input",
-      "source": "Input document 1",
-      "target": "Split document 1",
-      "sourceHandle": "output",
-      "targetHandle": "input"
-    },
-    {
-      "id": "xy-edge__Split document 1output-View 1input",
-      "source": "Split document 1",
-      "target": "View 1",
-      "sourceHandle": "output",
-      "targetHandle": "input"
-    },
-    {
-      "id": "xy-edge__Input chat 1output-RAG 1input",
-      "source": "Input chat 1",
-      "target": "RAG 1",
-      "sourceHandle": "output",
-      "targetHandle": "input"
-    },
-    {
-      "id": "xy-edge__Split document 1output-RAG 1db",
-      "source": "Split document 1",
-      "target": "RAG 1",
-      "sourceHandle": "output",
-      "targetHandle": "db"
-    },
-    {
-      "id": "xy-edge__RAG 1output-View 3input",
-      "source": "RAG 1",
-      "target": "View 3",
-      "sourceHandle": "output",
-      "targetHandle": "input"
-    },
-    {
-      "id": "xy-edge__Create prompt 1output-Ask LLM 1input",
-      "source": "Create prompt 1",
-      "target": "Ask LLM 1",
-      "sourceHandle": "output",
-      "targetHandle": "input"
-    },
-    {
-      "id": "xy-edge__Ask LLM 1output-View 4input",
-      "source": "Ask LLM 1",
-      "target": "View 4",
-      "sourceHandle": "output",
-      "targetHandle": "input"
-    },
-    {
-      "id": "xy-edge__RAG 1output-Add neighbors 1item",
-      "source": "RAG 1",
-      "target": "Add neighbors 1",
-      "sourceHandle": "output",
-      "targetHandle": "item"
-    },
-    {
-      "id": "xy-edge__Add neighbors 1output-Create prompt 1input",
-      "source": "Add neighbors 1",
-      "target": "Create prompt 1",
-      "sourceHandle": "output",
-      "targetHandle": "input"
-    },
-    {
-      "id": "xy-edge__Split document 1output-Build document graph 1input",
-      "source": "Split document 1",
-      "target": "Build document graph 1",
-      "sourceHandle": "output",
-      "targetHandle": "input"
-    },
-    {
-      "id": "xy-edge__Split document 1output-Add neighbors 1nodes",
-      "source": "Split document 1",
-      "target": "Add neighbors 1",
-      "sourceHandle": "output",
-      "targetHandle": "nodes"
-    },
-    {
-      "id": "xy-edge__Split document 1output-Predict links 1nodes",
-      "source": "Split document 1",
-      "target": "Predict links 1",
-      "sourceHandle": "output",
-      "targetHandle": "nodes"
-    },
-    {
-      "id": "xy-edge__Build document graph 1output-Predict links 1edges",
-      "source": "Build document graph 1",
-      "target": "Predict links 1",
-      "sourceHandle": "output",
-      "targetHandle": "edges"
-    },
-    {
-      "id": "xy-edge__Predict links 1output-Add neighbors 1edges",
-      "source": "Predict links 1",
-      "target": "Add neighbors 1",
-      "sourceHandle": "output",
-      "targetHandle": "edges"
+      "type": "basic",
+      "width": 200.0
     }
   ]
 }

examples/Image processing.lynxkite.json

@@ -46,26 +46,26 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "Open image",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "filename": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "filename",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -91,18 +91,18 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "image": {
+          "inputs": [
+            {
               "name": "image",
               "position": "left",
               "type": {
                 "type": "<module 'PIL.Image' from '/media/nvme/darabos/lynxkite-2024/.venv/lib/python3.11/site-packages/PIL/Image.py'>"
               }
             }
-          },
+          ],
           "name": "View image",
-          "outputs": {},
-          "params": {},
+          "outputs": [],
+          "params": [],
           "type": "image"
         },
         "params": {},
@@ -126,18 +126,18 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "image": {
+          "inputs": [
+            {
               "name": "image",
               "position": "left",
               "type": {
                 "type": "<module 'PIL.Image' from '/media/nvme/darabos/lynxkite-2024/.venv/lib/python3.11/site-packages/PIL/Image.py'>"
               }
             }
-          },
+          ],
           "name": "View image",
-          "outputs": {},
-          "params": {},
+          "outputs": [],
+          "params": [],
           "type": "image"
         },
         "params": {},
@@ -163,26 +163,26 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "image": {
+          "inputs": [
+            {
               "name": "image",
               "position": "left",
               "type": {
                 "type": "<module 'PIL.Image' from '/media/nvme/darabos/lynxkite-2024/.venv/lib/python3.11/site-packages/PIL/Image.py'>"
               }
             }
-          },
+          ],
           "name": "To grayscale",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {},
+          ],
+          "params": [],
           "type": "basic"
         },
         "params": {},
@@ -208,34 +208,34 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "image": {
+          "inputs": [
+            {
               "name": "image",
               "position": "left",
               "type": {
                 "type": "<module 'PIL.Image' from '/media/nvme/darabos/lynxkite-2024/.venv/lib/python3.11/site-packages/PIL/Image.py'>"
               }
             }
-          },
+          ],
           "name": "Blur",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "radius": {
+          ],
+          "params": [
+            {
               "default": 5.0,
               "name": "radius",
               "type": {
                 "type": "<class 'float'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -263,26 +263,26 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "image": {
+          "inputs": [
+            {
               "name": "image",
               "position": "left",
               "type": {
                 "type": "<module 'PIL.Image' from '/media/nvme/darabos/lynxkite-2024/.venv/lib/python3.11/site-packages/PIL/Image.py'>"
               }
             }
-          },
+          ],
           "name": "Flip vertically",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {},
+          ],
+          "params": [],
           "type": "basic"
         },
         "params": {},

examples/LynxScribe Data Cleaning.lynxkite.json

@@ -46,26 +46,26 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "LynxScribe Message",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "top",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "prompt_content": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "prompt_content",
               "type": {
                 "format": "textarea"
               }
             },
-            "prompt_role": {
+            {
               "default": null,
               "name": "prompt_role",
               "type": {
@@ -75,7 +75,7 @@
                 ]
               }
             }
-          },
+          ],
           "position": {
             "x": 653.0,
             "y": 954.0
@@ -107,26 +107,26 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "LynxScribe Message",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "top",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "prompt_content": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "prompt_content",
               "type": {
                 "format": "textarea"
               }
             },
-            "prompt_role": {
+            {
               "default": null,
               "name": "prompt_role",
               "type": {
@@ -136,7 +136,7 @@
                 ]
               }
             }
-          },
+          ],
           "position": {
             "x": 1498.0,
             "y": 660.0
@@ -168,40 +168,40 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "Read Excel",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "columns": {
+          ],
+          "params": [
+            {
               "default": "",
               "name": "columns",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "file_path": {
+            {
               "default": null,
               "name": "file_path",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "sheet_name": {
+            {
               "default": "Sheet1",
               "name": "sheet_name",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "position": {
             "x": 236.0,
             "y": 150.0
@@ -234,62 +234,62 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "dataframe": {
+          "inputs": [
+            {
               "name": "dataframe",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             },
-            "instruction_prompt": {
+            {
               "name": "instruction_prompt",
               "position": "bottom",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             },
-            "system_prompt": {
+            {
               "name": "system_prompt",
               "position": "bottom",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "LynxScribe Task Solver",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "llm_interface": {
+          ],
+          "params": [
+            {
               "default": "openai",
               "name": "llm_interface",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "llm_model_name": {
+            {
               "default": "gpt-4o",
               "name": "llm_model_name",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "new_column_names": {
+            {
               "default": "processed_field",
               "name": "new_column_names",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "position": {
             "x": 1511.0,
             "y": 220.0
@@ -431,18 +431,18 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "input": {
+          "inputs": [
+            {
               "name": "input",
               "position": "bottom",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "View DataFrame",
-          "outputs": {},
-          "params": {},
+          "outputs": [],
+          "params": [],
           "position": {
             "x": 1719.0,
             "y": 332.0
@@ -500,18 +500,18 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "input": {
+          "inputs": [
+            {
               "name": "input",
               "position": "bottom",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "View DataFrame",
-          "outputs": {},
-          "params": {},
+          "outputs": [],
+          "params": [],
           "position": {
             "x": 1083.0,
             "y": 134.0

examples/LynxScribe FAQ Chatbot Builder.lynxkite.json

@@ -60,68 +60,68 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "LynxScribe FAQ to RAG",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "faq_excel_path": {
+          ],
+          "params": [
+            {
               "default": "uploads/organon_demo/organon_en_copy.xlsx",
               "name": "faq_excel_path",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "scenario_cluster_distance_pct": {
+            {
               "default": 30.0,
               "name": "scenario_cluster_distance_pct",
               "type": {
                 "type": "<class 'float'>"
               }
             },
-            "text_embedder_interface": {
+            {
               "default": "openai",
               "name": "text_embedder_interface",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "text_embedder_model_name_or_path": {
+            {
               "default": "text-embedding-3-large",
               "name": "text_embedder_model_name_or_path",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "vdb_collection_name": {
+            {
               "default": "lynx",
               "name": "vdb_collection_name",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "vdb_num_dimensions": {
+            {
               "default": 3072.0,
               "name": "vdb_num_dimensions",
               "type": {
                 "type": "<class 'int'>"
               }
             },
-            "vdb_provider_name": {
+            {
               "default": "faiss",
               "name": "vdb_provider_name",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -154,48 +154,48 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "rag_graph": {
+          "inputs": [
+            {
               "name": "rag_graph",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "LynxScribe RAG Graph Chatbot Builder",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "top",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "node_types": {
+          ],
+          "params": [
+            {
               "default": "intent_cluster",
               "name": "node_types",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "scenario_file": {
+            {
               "default": "uploads/lynx_chatbot_scenario_selector.yaml",
               "name": "scenario_file",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "scenario_meta_name": {
+            {
               "default": "scenario_name",
               "name": "scenario_meta_name",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "position": {
             "x": 1569.0,
             "y": 528.0
@@ -228,90 +228,90 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "chat_processor": {
+          "inputs": [
+            {
               "name": "chat_processor",
               "position": "bottom",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             },
-            "knowledge_base": {
+            {
               "name": "knowledge_base",
               "position": "bottom",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "LynxScribe RAG Graph Chatbot Backend",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "top",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "llm_interface": {
+          ],
+          "params": [
+            {
               "default": "openai",
               "name": "llm_interface",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "llm_model_name": {
+            {
               "default": "gpt-4o",
               "name": "llm_model_name",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "negative_answer": {
+            {
               "default": "I'm sorry, but the data I've been trained on does not contain any information related to your question.",
               "name": "negative_answer",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "retriever_limits_by_type": {
+            {
               "default": "{}",
               "name": "retriever_limits_by_type",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "retriever_max_iterations": {
+            {
               "default": 3.0,
               "name": "retriever_max_iterations",
               "type": {
                 "type": "<class 'int'>"
               }
             },
-            "retriever_overall_chunk_limit": {
+            {
               "default": 20.0,
               "name": "retriever_overall_chunk_limit",
               "type": {
                 "type": "<class 'int'>"
               }
             },
-            "retriever_overall_token_limit": {
+            {
               "default": 3000.0,
               "name": "retriever_overall_token_limit",
               "type": {
                 "type": "<class 'int'>"
               }
             },
-            "retriever_strict_limits": {
+            {
               "default": true,
               "name": "retriever_strict_limits",
               "type": {
                 "type": "<class 'bool'>"
               }
             }
-          },
+          ],
           "position": {
             "x": 1280.0,
             "y": 450.0
@@ -347,26 +347,26 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "processor": {
+          "inputs": [
+            {
               "name": "processor",
               "position": "bottom",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "Chat processor",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "top",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {},
+          ],
+          "params": [],
           "position": {
             "x": 1291.0,
             "y": 718.0
@@ -393,26 +393,26 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "Truncate history",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "top",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "max_tokens": {
+          ],
+          "params": [
+            {
               "default": 10000.0,
               "name": "max_tokens",
               "type": {
                 "type": "<class 'int'>"
               }
             }
-          },
+          ],
           "position": {
             "x": 1440.0,
             "y": 936.0
@@ -443,26 +443,26 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "Input chat",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "chat": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "chat",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "position": {
             "x": 449.0,
             "y": 172.0
@@ -493,41 +493,41 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "chat_api": {
+          "inputs": [
+            {
               "name": "chat_api",
               "position": "bottom",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             },
-            "message": {
+            {
               "name": "message",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "Test Chat API",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "show_details": {
+          ],
+          "params": [
+            {
               "default": false,
               "name": "show_details",
               "type": {
                 "type": "<class 'bool'>"
               }
             }
-          },
+          ],
           "position": {
             "x": 937.0,
             "y": 213.0
@@ -569,18 +569,18 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "input": {
+          "inputs": [
+            {
               "name": "input",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "View",
-          "outputs": {},
-          "params": {},
+          "outputs": [],
+          "params": [],
           "position": {
             "x": 1547.0,
             "y": 222.0

examples/LynxScribe Image Search.lynxkite.json

@@ -46,26 +46,26 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "Cloud-sourced File Listing",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "accepted_file_types": {
+          ],
+          "params": [
+            {
               "default": ".jpg, .jpeg, .png",
               "name": "accepted_file_types",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "cloud_provider": {
+            {
               "default": "gcp",
               "name": "cloud_provider",
               "type": {
@@ -76,14 +76,14 @@
                 ]
               }
             },
-            "folder_URL": {
+            {
               "default": "https://storage.googleapis.com/lynxkite_public_data/lynxscribe-images/image-rag-test",
               "name": "folder_URL",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -110,55 +110,55 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "file_urls": {
+          "inputs": [
+            {
               "name": "file_urls",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "LynxScribe Image Describer",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "llm_interface": {
+          ],
+          "params": [
+            {
               "default": "openai",
               "name": "llm_interface",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "llm_prompt_name": {
+            {
               "default": "cot_picture_descriptor",
               "name": "llm_prompt_name",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "llm_prompt_path": {
+            {
               "default": "uploads/image_description_prompts.yaml",
               "name": "llm_prompt_path",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "llm_visual_model": {
+            {
               "default": "gpt-4o",
               "name": "llm_visual_model",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -186,62 +186,62 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "image_descriptions": {
+          "inputs": [
+            {
               "name": "image_descriptions",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "LynxScribe Image RAG Builder",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "text_embedder_interface": {
+          ],
+          "params": [
+            {
               "default": "openai",
               "name": "text_embedder_interface",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "text_embedder_model_name_or_path": {
+            {
               "default": "text-embedding-3-large",
               "name": "text_embedder_model_name_or_path",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "vdb_collection_name": {
+            {
               "default": "lynx",
               "name": "vdb_collection_name",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "vdb_num_dimensions": {
+            {
               "default": 3072.0,
               "name": "vdb_num_dimensions",
               "type": {
                 "type": "<class 'int'>"
               }
             },
-            "vdb_provider_name": {
+            {
               "default": "faiss",
               "name": "vdb_provider_name",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -272,26 +272,26 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "Input chat",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "chat": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "chat",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -316,18 +316,18 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "embedding_similarities": {
+          "inputs": [
+            {
               "name": "embedding_similarities",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "LynxScribe Image Result Viewer",
-          "outputs": {},
-          "params": {},
+          "outputs": [],
+          "params": [],
           "type": "image"
         },
         "params": {},
@@ -352,41 +352,41 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "rag_graph": {
+          "inputs": [
+            {
               "name": "rag_graph",
               "position": "bottom",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             },
-            "text": {
+            {
               "name": "text",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "LynxScribe Image RAG Query",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "top_k": {
+          ],
+          "params": [
+            {
               "default": 3.0,
               "name": "top_k",
               "type": {
                 "type": "<class 'int'>"
               }
             }
-          },
+          ],
           "position": {
             "x": 1611.0,
             "y": 353.0

examples/LynxScribe RAG Chatbot.lynxkite.json

@@ -74,26 +74,26 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "Cloud-sourced File Listing",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "accepted_file_types": {
+          ],
+          "params": [
+            {
               "default": ".jpg, .jpeg, .png",
               "name": "accepted_file_types",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "cloud_provider": {
+            {
               "default": "gcp",
               "name": "cloud_provider",
               "type": {
@@ -104,14 +104,14 @@
                 ]
               }
             },
-            "folder_URL": {
+            {
               "default": "https://storage.googleapis.com/lynxkite_public_data/lynxscribe-images/image-rag-test",
               "name": "folder_URL",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -140,27 +140,27 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "file_urls": {
+          "inputs": [
+            {
               "name": "file_urls",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "LynxScribe Text RAG Loader",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "input_type": {
+          ],
+          "params": [
+            {
               "default": "v1",
               "name": "input_type",
               "type": {
@@ -170,42 +170,42 @@
                 ]
               }
             },
-            "text_embedder_interface": {
+            {
               "default": "openai",
               "name": "text_embedder_interface",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "text_embedder_model_name_or_path": {
+            {
               "default": "text-embedding-3-large",
               "name": "text_embedder_model_name_or_path",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "vdb_collection_name": {
+            {
               "default": "lynx",
               "name": "vdb_collection_name",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "vdb_num_dimensions": {
+            {
               "default": 3072.0,
               "name": "vdb_num_dimensions",
               "type": {
                 "type": "<class 'int'>"
               }
             },
-            "vdb_provider_name": {
+            {
               "default": "faiss",
               "name": "vdb_provider_name",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -237,90 +237,90 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "chat_processor": {
+          "inputs": [
+            {
               "name": "chat_processor",
               "position": "bottom",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             },
-            "knowledge_base": {
+            {
               "name": "knowledge_base",
               "position": "bottom",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "LynxScribe RAG Graph Chatbot Backend",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "top",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "llm_interface": {
+          ],
+          "params": [
+            {
               "default": "openai",
               "name": "llm_interface",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "llm_model_name": {
+            {
               "default": "gpt-4o",
               "name": "llm_model_name",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "negative_answer": {
+            {
               "default": "I'm sorry, but the data I've been trained on does not contain any information related to your question.",
               "name": "negative_answer",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "retriever_limits_by_type": {
+            {
               "default": "{}",
               "name": "retriever_limits_by_type",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "retriever_max_iterations": {
+            {
               "default": 3.0,
               "name": "retriever_max_iterations",
               "type": {
                 "type": "<class 'int'>"
               }
             },
-            "retriever_overall_chunk_limit": {
+            {
               "default": 20.0,
               "name": "retriever_overall_chunk_limit",
               "type": {
                 "type": "<class 'int'>"
               }
             },
-            "retriever_overall_token_limit": {
+            {
               "default": 3000.0,
               "name": "retriever_overall_token_limit",
               "type": {
                 "type": "<class 'int'>"
               }
             },
-            "retriever_strict_limits": {
+            {
               "default": true,
               "name": "retriever_strict_limits",
               "type": {
                 "type": "<class 'bool'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -352,26 +352,26 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "processor": {
+          "inputs": [
+            {
               "name": "processor",
               "position": "bottom",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "Chat processor",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "top",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {},
+          ],
+          "params": [],
           "type": "basic"
         },
         "params": {},
@@ -394,26 +394,26 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "Truncate history",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "top",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "max_tokens": {
+          ],
+          "params": [
+            {
               "default": 10000.0,
               "name": "max_tokens",
               "type": {
                 "type": "<class 'int'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -440,47 +440,47 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "Mask",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "top",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "exceptions": {
+          ],
+          "params": [
+            {
               "default": "",
               "name": "exceptions",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "mask_pattern": {
+            {
               "default": "",
               "name": "mask_pattern",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "name": {
+            {
               "default": "",
               "name": "name",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "regex": {
+            {
               "default": "",
               "name": "regex",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -510,26 +510,26 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "Input chat",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "chat": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "chat",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -556,41 +556,41 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "chat_api": {
+          "inputs": [
+            {
               "name": "chat_api",
               "position": "bottom",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             },
-            "message": {
+            {
               "name": "message",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "Test Chat API",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "show_details": {
+          ],
+          "params": [
+            {
               "default": false,
               "name": "show_details",
               "type": {
                 "type": "<class 'bool'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -628,18 +628,18 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "input": {
+          "inputs": [
+            {
               "name": "input",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "View",
-          "outputs": {},
-          "params": {},
+          "outputs": [],
+          "params": [],
           "type": "table_view"
         },
         "params": {},
@@ -664,48 +664,48 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "rag_graph": {
+          "inputs": [
+            {
               "name": "rag_graph",
               "position": "left",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "LynxScribe RAG Graph Chatbot Builder",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "top",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "node_types": {
+          ],
+          "params": [
+            {
               "default": "intent_cluster",
               "name": "node_types",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "scenario_file": {
+            {
               "default": "uploads/lynx_chatbot_scenario_selector.yaml",
               "name": "scenario_file",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "scenario_meta_name": {
+            {
               "default": "scenario_name",
               "name": "scenario_meta_name",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "position": {
             "x": 1121.0,
             "y": 813.0

examples/Model definition.lynxkite.json

@@ -81,26 +81,20 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "loss": {
+          "color": "green",
+          "inputs": [
+            {
               "name": "loss",
               "position": "bottom",
               "type": {
                 "type": "tensor"
               }
             }
-          },
+          ],
           "name": "Optimizer",
-          "outputs": {},
-          "params": {
-            "lr": {
-              "default": 0.001,
-              "name": "lr",
-              "type": {
-                "type": "<class 'float'>"
-              }
-            },
-            "type": {
+          "outputs": [],
+          "params": [
+            {
               "default": "AdamW",
               "name": "type",
               "type": {
@@ -114,15 +108,22 @@
                   "Galore AdamW"
                 ]
               }
+            },
+            {
+              "default": 0.001,
+              "name": "lr",
+              "type": {
+                "type": "<class 'float'>"
+              }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
           "lr": "0.1",
           "type": "SGD"
         },
-        "status": "planned",
+        "status": "done",
         "title": "Optimizer"
       },
       "dragHandle": ".bg-primary",
@@ -130,7 +131,7 @@
       "id": "Optimizer 2",
       "position": {
         "x": 359.75221367487865,
-        "y": -1560.7604266065723
+        "y": -1150.2183224762075
       },
       "type": "basic",
       "width": 232.0
@@ -143,28 +144,29 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "x": {
+          "color": "orange",
+          "inputs": [
+            {
               "name": "x",
               "position": "bottom",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "Activation",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "top",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "type": {
-              "default": "ReLU",
+          ],
+          "params": [
+            {
+              "default": null,
               "name": "type",
               "type": {
                 "enum": [
@@ -175,13 +177,13 @@
                 ]
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
           "type": "Leaky_ReLU"
         },
-        "status": "planned",
+        "status": "done",
         "title": "Activation"
       },
       "dragHandle": ".bg-primary",
@@ -202,40 +204,41 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {},
+          "color": "orange",
+          "inputs": [],
           "name": "Input: tensor",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "top",
               "type": {
                 "type": "tensor"
               }
             }
-          },
-          "params": {
-            "name": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "name",
               "type": {
                 "type": "None"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
           "name": "Y"
         },
-        "status": "planned",
+        "status": "done",
         "title": "Input: tensor"
       },
       "dragHandle": ".bg-primary",
       "height": 200.0,
       "id": "Input: tensor 3",
       "position": {
-        "x": 485.8840220312055,
-        "y": -268.0485936515193
+        "x": 454.7823474758749,
+        "y": -212.0655794519241
       },
       "type": "basic",
       "width": 200.0
@@ -248,45 +251,46 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "x": {
+          "color": "orange",
+          "inputs": [
+            {
               "name": "x",
               "position": "bottom",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             },
-            "y": {
+            {
               "name": "y",
               "position": "bottom",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "MSE loss",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "top",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {},
+          ],
+          "params": [],
           "type": "basic"
         },
         "params": {},
-        "status": "planned",
+        "status": "done",
         "title": "MSE loss"
       },
       "dragHandle": ".bg-primary",
       "height": 200.0,
       "id": "MSE loss 2",
       "position": {
-        "x": 384.54674698852955,
-        "y": -1184.4701545316577
+        "x": 375.21624462193034,
+        "y": -721.0552036572305
       },
       "type": "basic",
       "width": 200.0
@@ -299,48 +303,49 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "input": {
+          "color": "orange",
+          "inputs": [
+            {
               "name": "input",
               "position": "top",
               "type": {
                 "type": "tensor"
               }
             }
-          },
+          ],
           "name": "Repeat",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "bottom",
               "type": {
                 "type": "tensor"
               }
             }
-          },
-          "params": {
-            "same_weights": {
-              "default": false,
-              "name": "same_weights",
-              "type": {
-                "type": "<class 'bool'>"
-              }
-            },
-            "times": {
+          ],
+          "params": [
+            {
               "default": 1.0,
               "name": "times",
               "type": {
                 "type": "<class 'int'>"
               }
+            },
+            {
+              "default": false,
+              "name": "same_weights",
+              "type": {
+                "type": "<class 'bool'>"
+              }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
           "same_weights": false,
           "times": "2"
         },
-        "status": "planned",
+        "status": "done",
         "title": "Repeat"
       },
       "dragHandle": ".bg-primary",
@@ -361,51 +366,52 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "x": {
+          "color": "blue",
+          "inputs": [
+            {
               "name": "x",
               "position": "bottom",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "Linear",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "top",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "output_dim": {
+          ],
+          "params": [
+            {
               "default": 1024.0,
               "name": "output_dim",
               "type": {
                 "type": "<class 'int'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
           "output_dim": "4"
         },
-        "status": "planned",
+        "status": "done",
         "title": "Linear"
       },
       "dragHandle": ".bg-primary",
-      "height": 200.0,
+      "height": 189.0,
       "id": "Linear 1",
       "position": {
         "x": 98.54861342271252,
         "y": 14.121603973834155
       },
       "type": "basic",
-      "width": 200.0
+      "width": 199.0
     },
     {
       "data": {
@@ -415,32 +421,33 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {},
+          "color": "orange",
+          "inputs": [],
           "name": "Input: tensor",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "top",
               "type": {
                 "type": "tensor"
               }
             }
-          },
-          "params": {
-            "name": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "name",
               "type": {
                 "type": "None"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
           "name": "X"
         },
-        "status": "planned",
+        "status": "done",
         "title": "Input: tensor"
       },
       "dragHandle": ".bg-primary",
@@ -461,48 +468,49 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {},
+          "color": "orange",
+          "inputs": [],
           "name": "Constant vector",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "top",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "size": {
-              "default": 1.0,
-              "name": "size",
+          ],
+          "params": [
+            {
+              "default": 0.0,
+              "name": "value",
               "type": {
                 "type": "<class 'int'>"
               }
             },
-            "value": {
-              "default": 0.0,
-              "name": "value",
+            {
+              "default": 1.0,
+              "name": "size",
               "type": {
                 "type": "<class 'int'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
           "size": "1",
           "value": "1"
         },
-        "status": "planned",
+        "status": "done",
         "title": "Constant vector"
       },
       "dragHandle": ".bg-primary",
       "height": 258.0,
       "id": "Constant vector 1",
       "position": {
-        "x": 886.708922897265,
-        "y": -298.4394167425953
+        "x": 846.2767459753351,
+        "y": -226.90556526533476
       },
       "type": "basic",
       "width": 238.0
@@ -515,45 +523,46 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "a": {
+          "color": "orange",
+          "inputs": [
+            {
               "name": "a",
               "position": "bottom",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             },
-            "b": {
+            {
               "name": "b",
               "position": "bottom",
               "type": {
                 "type": "<class 'inspect._empty'>"
               }
             }
-          },
+          ],
           "name": "Add",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "top",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {},
+          ],
+          "params": [],
           "type": "basic"
         },
         "params": {},
-        "status": "planned",
+        "status": "done",
         "title": "Add"
       },
       "dragHandle": ".bg-primary",
       "height": 200.0,
       "id": "Add 1",
       "position": {
-        "x": 722.1292469875319,
-        "y": -762.6853551968964
+        "x": 631.934390777073,
+        "y": -395.6855954439944
       },
       "type": "basic",
       "width": 200.0
@@ -566,46 +575,47 @@
         "error": null,
         "input_metadata": null,
         "meta": {
-          "inputs": {
-            "x": {
+          "color": "orange",
+          "inputs": [
+            {
               "name": "x",
               "position": "bottom",
               "type": {
                 "type": "tensor"
               }
             }
-          },
+          ],
           "name": "Output",
-          "outputs": {
-            "x": {
+          "outputs": [
+            {
               "name": "x",
               "position": "top",
               "type": {
                 "type": "tensor"
               }
             }
-          },
-          "params": {
-            "name": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "name",
               "type": {
                 "type": "None"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {},
-        "status": "planned",
+        "status": "done",
         "title": "Output"
       },
       "dragHandle": ".bg-primary",
       "height": 200.0,
       "id": "Output 1",
       "position": {
-        "x": 185.15239170944702,
-        "y": -733.1526319565451
+        "x": 119.83887514325258,
+        "y": -453.23756095856885
       },
       "type": "basic",
       "width": 200.0

examples/Model use.lynxkite.json

@@ -137,41 +137,42 @@
           }
         ],
         "meta": {
-          "inputs": {
-            "bundle": {
+          "color": "orange",
+          "inputs": [
+            {
               "name": "bundle",
               "position": "left",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
+          ],
           "name": "Train/test split",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "table_name": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "table_name",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "test_ratio": {
+            {
               "default": 0.1,
               "name": "test_ratio",
               "type": {
                 "type": "<class 'float'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -234,26 +235,27 @@
         "error": null,
         "input_metadata": [],
         "meta": {
-          "inputs": {},
+          "color": "orange",
+          "inputs": [],
           "name": "Import Parquet",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "filename": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "filename",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -383,41 +385,42 @@
           }
         ],
         "meta": {
-          "inputs": {
-            "bundle": {
+          "color": "orange",
+          "inputs": [
+            {
               "name": "bundle",
               "position": "left",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
+          ],
           "name": "Define model",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "model_workspace": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "model_workspace",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "save_as": {
+            {
               "default": "model",
               "name": "save_as",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -575,8 +578,8 @@
                     "Input__tensor_1_output"
                   ],
                   "loss_inputs": [
-                    "Output_1_x",
-                    "Input__tensor_3_output"
+                    "Input__tensor_3_output",
+                    "Output_1_x"
                   ],
                   "outputs": [
                     "Output_1_x"
@@ -590,48 +593,49 @@
           }
         ],
         "meta": {
-          "inputs": {
-            "bundle": {
+          "color": "orange",
+          "inputs": [
+            {
               "name": "bundle",
               "position": "left",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
+          ],
           "name": "Train model",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "epochs": {
-              "default": 1.0,
-              "name": "epochs",
+          ],
+          "params": [
+            {
+              "default": "model",
+              "name": "model_name",
               "type": {
-                "type": "<class 'int'>"
+                "type": "<class 'str'>"
               }
             },
-            "input_mapping": {
+            {
               "default": null,
               "name": "input_mapping",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.ml_ops.ModelTrainingInputMapping'>"
               }
             },
-            "model_name": {
-              "default": "model",
-              "name": "model_name",
+            {
+              "default": 1.0,
+              "name": "epochs",
               "type": {
-                "type": "<class 'str'>"
+                "type": "<class 'int'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -800,8 +804,8 @@
                     "Input__tensor_1_output"
                   ],
                   "loss_inputs": [
-                    "Output_1_x",
-                    "Input__tensor_3_output"
+                    "Input__tensor_3_output",
+                    "Output_1_x"
                   ],
                   "outputs": [
                     "Output_1_x"
@@ -815,48 +819,49 @@
           }
         ],
         "meta": {
-          "inputs": {
-            "bundle": {
+          "color": "orange",
+          "inputs": [
+            {
               "name": "bundle",
               "position": "left",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
+          ],
           "name": "Model inference",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "input_mapping": {
-              "default": null,
-              "name": "input_mapping",
-              "type": {
-                "type": "<class 'lynxkite_graph_analytics.ml_ops.ModelInferenceInputMapping'>"
-              }
-            },
-            "model_name": {
+          ],
+          "params": [
+            {
               "default": "model",
               "name": "model_name",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "output_mapping": {
+            {
+              "default": null,
+              "name": "input_mapping",
+              "type": {
+                "type": "<class 'lynxkite_graph_analytics.ml_ops.ModelInferenceInputMapping'>"
+              }
+            },
+            {
               "default": null,
               "name": "output_mapping",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.ml_ops.ModelOutputMapping'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -1475,206 +1480,206 @@
           "series": [
             {
               "data": [
-                5.800187110900879,
-                5.598123073577881,
-                5.42051887512207,
-                5.2726593017578125,
-                5.157590389251709,
-                5.0745649337768555,
-                5.0191521644592285,
-                4.984806537628174,
-                4.964847564697266,
-                4.953816890716553,
-                4.947908878326416,
-                4.944762706756592,
-                4.943039417266846,
-                4.942024230957031,
-                4.941353797912598,
-                4.9408488273620605,
-                4.940422058105469,
-                4.940032482147217,
-                4.939662456512451,
-                4.939301013946533,
-                4.938945293426514,
-                4.938592910766602,
-                4.9382429122924805,
-                4.937894344329834,
-                4.937548637390137,
-                4.937204837799072,
-                4.936861515045166,
-                4.936521053314209,
-                4.936007976531982,
-                4.928510665893555,
-                4.7543463706970215,
-                4.202136039733887,
-                3.841205596923828,
-                3.605153799057007,
-                3.4602854251861572,
-                3.377415657043457,
-                3.3322527408599854,
-                3.308159589767456,
-                3.2952585220336914,
-                3.288172960281372,
-                3.2841086387634277,
-                3.2816221714019775,
-                3.2797133922576904,
-                3.251174211502075,
-                2.534057140350342,
-                2.100238800048828,
-                1.8637852668762207,
-                1.7448025941848755,
-                1.6882381439208984,
-                1.6618977785110474,
-                1.6495403051376343,
-                1.6435632705688477,
-                1.6405097246170044,
-                1.6388026475906372,
-                1.6377187967300415,
-                1.6369259357452393,
-                1.6362708806991577,
-                1.635683536529541,
-                1.6351302862167358,
-                1.6345962285995483,
-                1.634074091911316,
-                1.6335605382919312,
-                1.6330533027648926,
-                1.6325511932373047,
-                1.6320583820343018,
-                1.6315733194351196,
-                1.6311031579971313,
-                1.6306471824645996,
-                1.6301956176757812,
-                1.6297489404678345,
-                1.629309892654419,
-                1.6288747787475586,
-                1.6284427642822266,
-                1.6280156373977661,
-                1.6275969743728638,
-                1.6271847486495972,
-                1.6267770528793335,
-                1.6263741254806519,
-                1.625981092453003,
-                1.625562071800232,
-                1.6234854459762573,
-                1.526026964187622,
-                0.7520114779472351,
-                0.36320704221725464,
-                0.19313177466392517,
-                0.12368442118167877,
-                0.09587223827838898,
-                0.08457889407873154,
-                0.07980319857597351,
-                0.07760757952928543,
-                0.0764402449131012,
-                0.07568377256393433,
-                0.0751044973731041,
-                0.07460036873817444,
-                0.07414067536592484,
-                0.073702372610569,
-                0.07327572256326675,
-                0.0728573128581047,
-                0.07244749367237091,
-                0.07204563170671463,
-                0.07165331393480301,
-                0.07127555459737778,
-                0.07090453058481216,
-                0.07054518908262253,
-                0.07019751518964767,
-                0.06985506415367126,
-                0.06952166557312012,
-                0.06919547915458679,
-                0.06887446343898773,
-                0.06856007128953934,
-                0.0682557001709938,
-                0.06795719265937805,
-                0.06766397505998611,
-                0.06737591326236725,
-                0.06709206104278564,
-                0.06681231409311295,
-                0.06653629243373871,
-                0.06626027077436447,
-                0.06598811596632004,
-                0.06571972370147705,
-                0.06545503437519073,
-                0.06519390642642975,
-                0.06493626534938812,
-                0.06468204408884048,
-                0.06443134695291519,
-                0.06418412178754807,
-                0.06394005566835403,
-                0.06369906663894653,
-                0.06346159428358078,
-                0.0632280632853508,
-                0.06299739331007004,
-                0.06276948750019073,
-                0.0625443086028099,
-                0.06232282891869545,
-                0.06210631504654884,
-                0.061892297118902206,
-                0.06168072670698166,
-                0.06147276982665062,
-                0.061268385499715805,
-                0.061066266149282455,
-                0.0608663484454155,
-                0.060668591409921646,
-                0.06047294661402702,
-                0.06027935445308685,
-                0.06008780375123024,
-                0.05989820510149002,
-                0.0597105510532856,
-                0.059524793177843094,
-                0.05934089794754982,
-                0.0591588169336319,
-                0.05897851660847664,
-                0.058799974620342255,
-                0.05862313508987427,
-                0.05844798684120178,
-                0.05827448144555092,
-                0.05810258165001869,
-                0.057932913303375244,
-                0.05776538327336311,
-                0.05759938061237335,
-                0.05743485689163208,
-                0.05727178603410721,
-                0.057110145688056946,
-                0.05694990232586861,
-                0.056791022419929504,
-                0.056633491069078445,
-                0.05647730454802513,
-                0.05632239580154419,
-                0.056168779730796814,
-                0.05601642653346062,
-                0.05586530268192291,
-                0.05571539327502251,
-                0.05556711554527283,
-                0.05542108789086342,
-                0.05527620390057564,
-                0.05513244494795799,
-                0.05498979613184929,
-                0.054848212748765945,
-                0.05470770597457886,
-                0.05456825718283653,
-                0.05442983657121658,
-                0.05429244041442871,
-                0.05415605381131172,
-                0.05402064323425293,
-                0.05388621985912323,
-                0.05375276133418083,
-                0.05362024903297424,
-                0.05348866432905197,
-                0.05335800349712372,
-                0.053228266537189484,
-                0.0530996136367321,
-                0.052972279489040375,
-                0.05284580960869789,
-                0.05272020027041435,
-                0.05259542167186737,
-                0.05247148126363754,
-                0.05234837532043457,
-                0.05222644284367561,
-                0.052105557173490524,
-                0.05198581516742706,
-                0.051866982132196426
+                5.951645851135254,
+                5.274348735809326,
+                4.588619709014893,
+                3.966594934463501,
+                3.0671465396881104,
+                2.3460588455200195,
+                1.986690640449524,
+                1.8489981889724731,
+                1.801417589187622,
+                1.7839369773864746,
+                1.7767301797866821,
+                1.7733982801437378,
+                1.7716325521469116,
+                1.7705225944519043,
+                1.7696930170059204,
+                1.7689863443374634,
+                1.7683357000350952,
+                1.7677124738693237,
+                1.7671048641204834,
+                1.766507625579834,
+                1.7659177780151367,
+                1.7653343677520752,
+                1.7647572755813599,
+                1.764186143875122,
+                1.763621211051941,
+                1.763061761856079,
+                1.762508511543274,
+                1.7619603872299194,
+                1.7614178657531738,
+                1.760880470275879,
+                1.7603485584259033,
+                1.7598220109939575,
+                1.7593002319335938,
+                1.7587836980819702,
+                1.7582720518112183,
+                1.7577650547027588,
+                1.757262945175171,
+                1.7567654848098755,
+                1.756272792816162,
+                1.755784511566162,
+                1.755300760269165,
+                1.7548213005065918,
+                1.7543463706970215,
+                1.7538751363754272,
+                1.7534087896347046,
+                1.7529460191726685,
+                1.7524876594543457,
+                1.752032995223999,
+                1.751582384109497,
+                1.7511354684829712,
+                1.75069260597229,
+                1.7502535581588745,
+                1.7498178482055664,
+                1.7493858337402344,
+                1.7489577531814575,
+                1.748533010482788,
+                1.7481114864349365,
+                1.7476938962936401,
+                1.7472795248031616,
+                1.746868371963501,
+                1.7464605569839478,
+                1.7460559606552124,
+                1.7456544637680054,
+                1.7452563047409058,
+                1.744861125946045,
+                1.7444690465927124,
+                1.7440800666809082,
+                1.7436938285827637,
+                1.7433106899261475,
+                1.74293053150177,
+                1.7425531148910522,
+                1.7421785593032837,
+                1.7418066263198853,
+                1.7414374351501465,
+                1.7410712242126465,
+                1.740707516670227,
+                1.7403463125228882,
+                1.739988088607788,
+                1.7396321296691895,
+                1.739278793334961,
+                1.738927960395813,
+                1.7385796308517456,
+                1.7382338047027588,
+                1.7378901243209839,
+                1.7375489473342896,
+                1.7372102737426758,
+                1.7368735074996948,
+                1.7365405559539795,
+                1.736209511756897,
+                1.735880970954895,
+                1.7355544567108154,
+                1.7352303266525269,
+                1.7349083423614502,
+                1.734588384628296,
+                1.7342705726623535,
+                1.7339547872543335,
+                1.7336410284042358,
+                1.7333295345306396,
+                1.7330199480056763,
+                1.7327126264572144,
+                1.7324069738388062,
+                1.7321033477783203,
+                1.7318018674850464,
+                1.7315021753311157,
+                1.731204867362976,
+                1.7309091091156006,
+                1.730615258216858,
+                1.730323314666748,
+                1.730033040046692,
+                1.729726791381836,
+                1.7290540933609009,
+                1.727712631225586,
+                1.7197412252426147,
+                1.596683144569397,
+                0.773148238658905,
+                0.39096447825431824,
+                0.2109919637441635,
+                0.13099151849746704,
+                0.09647822380065918,
+                0.08164384216070175,
+                0.07520285993814468,
+                0.0723332017660141,
+                0.07098480314016342,
+                0.0702858567237854,
+                0.0698651373386383,
+                0.06956446170806885,
+                0.0693163350224495,
+                0.06909190863370895,
+                0.06887885183095932,
+                0.06867185235023499,
+                0.0684686228632927,
+                0.06826816499233246,
+                0.06807000190019608,
+                0.06787554919719696,
+                0.06768527626991272,
+                0.06749691069126129,
+                0.06731042265892029,
+                0.06712576001882553,
+                0.06694285571575165,
+                0.06676167249679565,
+                0.06658219546079636,
+                0.06640437990427017,
+                0.06622816622257233,
+                0.06605355441570282,
+                0.06588048487901688,
+                0.0657089352607727,
+                0.06553887575864792,
+                0.06537164747714996,
+                0.06520784646272659,
+                0.06504552066326141,
+                0.06488457322120667,
+                0.06472500413656235,
+                0.06456676870584488,
+                0.06440985947847366,
+                0.06425532698631287,
+                0.06410346925258636,
+                0.06395288556814194,
+                0.0638035461306572,
+                0.06365542858839035,
+                0.06350891292095184,
+                0.06336474418640137,
+                0.0632217675447464,
+                0.06307994574308395,
+                0.06293924152851105,
+                0.06280024349689484,
+                0.06266289204359055,
+                0.0625266581773758,
+                0.062391478568315506,
+                0.062257349491119385,
+                0.06212425231933594,
+                0.06199217587709427,
+                0.06186108663678169,
+                0.06173097714781761,
+                0.061601828783750534,
+                0.06147363409399986,
+                0.061346352100372314,
+                0.06121999770402908,
+                0.06109452247619629,
+                0.060969945043325424,
+                0.060846228152513504,
+                0.06072336435317993,
+                0.06060132384300232,
+                0.06048011779785156,
+                0.06035973131656647,
+                0.06024013087153435,
+                0.060121312737464905,
+                0.06000327318906784,
+                0.05988664552569389,
+                0.059771209955215454,
+                0.0596565380692482,
+                0.059542614966630936,
+                0.05942942202091217,
+                0.05931694060564041,
+                0.059205178171396255,
+                0.05909412354230881,
+                0.05898374691605568,
+                0.058874040842056274,
+                0.05876500904560089,
+                0.05865663290023804,
+                0.05854890123009682
               ],
               "type": "line"
             }
@@ -1726,8 +1731,8 @@
                     "Input__tensor_1_output"
                   ],
                   "loss_inputs": [
-                    "Output_1_x",
-                    "Input__tensor_3_output"
+                    "Input__tensor_3_output",
+                    "Output_1_x"
                   ],
                   "outputs": [
                     "Output_1_x"
@@ -1741,18 +1746,19 @@
           }
         ],
         "meta": {
-          "inputs": {
-            "bundle": {
+          "color": "orange",
+          "inputs": [
+            {
               "name": "bundle",
               "position": "left",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
+          ],
           "name": "View loss",
-          "outputs": {},
-          "params": {},
+          "outputs": [],
+          "params": [],
           "type": "visualization"
         },
         "params": {},
@@ -2192,184 +2198,184 @@
               ],
               "data": [
                 [
-                  56,
-                  "[0.32565445 0.90939188 0.07488042 0.13730896]",
-                  "[1.32565451 1.90939188 1.07488036 1.13730896]",
-                  "[2.3657565116882324, 2.313479423522949, 2.1553378105163574, 2.1699535846710205]"
+                  5.0,
+                  "[0.67269951 0.10478973 0.5584439  0.83605725]",
+                  "[1.67269945 1.10478973 1.5584439  1.83605719]",
+                  "[2.5200114250183105, 2.5500504970550537, 2.474149227142334, 2.5841031074523926]"
                 ],
                 [
-                  23,
-                  "[0.90817457 0.89270043 0.38583666 0.66566533]",
-                  "[1.90817451 1.89270043 1.3858366  1.66566539]",
-                  "[2.8040859699249268, 2.819502830505371, 2.7440733909606934, 2.7479381561279297]"
+                  9.0,
+                  "[0.32225502 0.16999388 0.05823922 0.9628762 ]",
+                  "[1.32225502 1.16999388 1.05823922 1.9628762 ]",
+                  "[2.2936718463897705, 2.29734468460083, 2.193934440612793, 2.465013265609741]"
                 ],
                 [
-                  59,
-                  "[0.54914117 0.03810108 0.87531954 0.73044223]",
-                  "[1.54914117 1.03810108 1.87531948 1.73044229]",
-                  "[2.5295400619506836, 2.495408773422241, 2.4967894554138184, 2.6805124282836914]"
+                  42.0,
+                  "[0.75292218 0.81470108 0.49657214 0.56217098]",
+                  "[1.75292218 1.81470108 1.49657214 1.56217098]",
+                  "[2.705364942550659, 2.693166971206665, 2.6420576572418213, 2.709315061569214]"
                 ],
                 [
-                  33,
-                  "[0.27845025 0.32472342 0.82203609 0.77107543]",
-                  "[1.27845025 1.32472348 1.82203603 1.77107549]",
-                  "[2.5397789478302, 2.508394241333008, 2.4924893379211426, 2.650639057159424]"
+                  44.0,
+                  "[0.52784437 0.54268694 0.12358981 0.72116476]",
+                  "[1.52784443 1.54268694 1.12358975 1.7211647 ]",
+                  "[2.4462273120880127, 2.429269552230835, 2.3485944271087646, 2.5453922748565674]"
                 ],
                 [
-                  62,
-                  "[0.81788456 0.58174163 0.29376316 0.7971254 ]",
-                  "[1.81788456 1.58174157 1.29376316 1.79712534]",
-                  "[2.64847731590271, 2.634650230407715, 2.6081323623657227, 2.7195992469787598]"
+                  82.0,
+                  "[0.63235509 0.70352674 0.96188956 0.46240485]",
+                  "[1.63235509 1.70352674 1.96188951 1.46240485]",
+                  "[2.7882840633392334, 2.7618415355682373, 2.7329940795898438, 2.6951816082000732]"
                 ],
                 [
-                  76,
-                  "[0.59492421 0.90274489 0.38069052 0.46101224]",
-                  "[1.59492421 1.90274489 1.38069057 1.46101224]",
-                  "[2.646230697631836, 2.637777090072632, 2.52846097946167, 2.531282424926758]"
+                  63.0,
+                  "[0.94559073 0.65736622 0.25761551 0.48553199]",
+                  "[1.94559073 1.65736628 1.25761557 1.48553205]",
+                  "[2.58785343170166, 2.573683500289917, 2.514312505722046, 2.6052181720733643]"
                 ],
                 [
-                  71,
-                  "[0.9630242  0.76359051 0.24853623 0.76881069]",
-                  "[1.96302414 1.76359057 1.24853623 1.76881075]",
-                  "[2.748387575149536, 2.752307176589966, 2.706347942352295, 2.764111042022705]"
+                  45.0,
+                  "[0.73217702 0.65233225 0.44077861 0.33837909]",
+                  "[1.73217702 1.65233231 1.44077861 1.33837914]",
+                  "[2.56579852104187, 2.5119059085845947, 2.4670586585998535, 2.514880657196045]"
                 ],
                 [
-                  4,
-                  "[0.76807946 0.98855817 0.08259124 0.01730657]",
-                  "[1.76807952 1.98855817 1.0825913  1.01730657]",
-                  "[2.525120258331299, 2.500986099243164, 2.3167755603790283, 2.2522761821746826]"
+                  58.0,
+                  "[0.79905868 0.89367443 0.75429088 0.3190186 ]",
+                  "[1.79905868 1.89367437 1.75429082 1.3190186 ]",
+                  "[2.784841537475586, 2.7429990768432617, 2.7168993949890137, 2.684943914413452]"
                 ],
                 [
-                  29,
+                  29.0,
                   "[0.23942459 0.90487361 0.69337189 0.65089428]",
                   "[1.23942459 1.90487361 1.69337189 1.65089428]",
-                  "[2.6811459064483643, 2.6773998737335205, 2.5942978858947754, 2.6238982677459717]"
+                  "[2.7037124633789062, 2.6642377376556396, 2.616722822189331, 2.701845645904541]"
                 ],
                 [
-                  90,
-                  "[0.49584109 0.80599248 0.07096875 0.75872749]",
-                  "[1.49584103 1.80599248 1.07096875 1.75872755]",
-                  "[2.53598952293396, 2.5045714378356934, 2.455559015274048, 2.5678346157073975]"
+                  55.0,
+                  "[0.95928186 0.84273899 0.71514636 0.38619852]",
+                  "[1.95928192 1.84273899 1.7151463  1.38619852]",
+                  "[2.8087925910949707, 2.792400598526001, 2.760772466659546, 2.733377695083618]"
                 ],
                 [
-                  21,
-                  "[0.56922203 0.98222166 0.76851749 0.28615737]",
-                  "[1.56922197 1.9822216  1.76851749 1.28615737]",
-                  "[2.764127016067505, 2.778721809387207, 2.6293208599090576, 2.547865152359009]"
+                  37.0,
+                  "[0.78956431 0.87284744 0.06880784 0.03455889]",
+                  "[1.78956437 1.87284744 1.06880784 1.03455889]",
+                  "[2.4434266090393066, 2.3314132690429688, 2.2909493446350098, 2.365412712097168]"
                 ],
                 [
-                  98,
-                  "[0.87608397 0.93200487 0.80169648 0.37758952]",
-                  "[1.87608397 1.93200493 1.80169654 1.37758946]",
-                  "[2.885874032974243, 2.9194400310516357, 2.7887256145477295, 2.6982016563415527]"
+                  24.0,
+                  "[0.48507756 0.80808765 0.77162558 0.47834778]",
+                  "[1.48507762 1.80808759 1.77162552 1.47834778]",
+                  "[2.719438314437866, 2.6760094165802, 2.6397786140441895, 2.658838987350464]"
                 ],
                 [
-                  66,
-                  "[0.02162331 0.81861657 0.92468154 0.07808572]",
-                  "[1.02162337 1.81861663 1.92468154 1.07808566]",
-                  "[2.5120248794555664, 2.486686944961548, 2.315469741821289, 2.275869369506836]"
+                  6.0,
+                  "[0.18686318 0.49356437 0.51323432 0.75392658]",
+                  "[1.18686318 1.49356437 1.51323438 1.75392652]",
+                  "[2.4986000061035156, 2.4670026302337646, 2.398942708969116, 2.5478687286376953]"
                 ],
                 [
-                  73,
-                  "[0.80654246 0.08253473 0.74478531 0.71257162]",
-                  "[1.8065424  1.08253479 1.74478531 1.71257162]",
-                  "[2.5862319469451904, 2.5615270137786865, 2.5580317974090576, 2.718832015991211]"
+                  19.0,
+                  "[0.24388778 0.07268471 0.68350857 0.73431659]",
+                  "[1.24388778 1.07268476 1.68350863 1.73431659]",
+                  "[2.4221277236938477, 2.398268938064575, 2.330900192260742, 2.4378199577331543]"
                 ],
                 [
-                  49,
-                  "[0.08107251 0.2602725  0.18861133 0.44833237]",
-                  "[1.08107257 1.2602725  1.18861127 1.44833231]",
-                  "[2.1395106315612793, 2.043048858642578, 1.9888705015182495, 2.2045695781707764]"
+                  33.0,
+                  "[0.27845025 0.32472342 0.82203609 0.77107543]",
+                  "[1.27845025 1.32472348 1.82203603 1.77107549]",
+                  "[2.5835256576538086, 2.573005437850952, 2.5142269134521484, 2.591273069381714]"
                 ],
                 [
-                  6,
-                  "[0.18686318 0.49356437 0.51323432 0.75392658]",
-                  "[1.18686318 1.49356437 1.51323438 1.75392652]",
-                  "[2.4604146480560303, 2.416104793548584, 2.3870620727539062, 2.5486795902252197]"
+                  71.0,
+                  "[0.9630242  0.76359051 0.24853623 0.76881069]",
+                  "[1.96302414 1.76359057 1.24853623 1.76881075]",
+                  "[2.696070432662964, 2.731595754623413, 2.6591246128082275, 2.793705463409424]"
                 ],
                 [
-                  30,
-                  "[0.94516498 0.08422136 0.5608117  0.07652664]",
-                  "[1.94516492 1.08422136 1.56081176 1.07652664]",
-                  "[2.41292142868042, 2.3658392429351807, 2.2621009349823, 2.336780548095703]"
+                  12.0,
+                  "[0.11693293 0.49860179 0.55020827 0.88832849]",
+                  "[1.11693287 1.49860179 1.55020833 1.88832855]",
+                  "[2.529472827911377, 2.5154130458831787, 2.441786766052246, 2.6100752353668213]"
                 ],
                 [
-                  39,
-                  "[0.00497234 0.39319336 0.57054168 0.75150961]",
-                  "[1.00497234 1.39319336 1.57054162 1.75150967]",
-                  "[2.3767666816711426, 2.318239450454712, 2.2965610027313232, 2.4914658069610596]"
+                  8.0,
+                  "[4.27091718e-01 4.89909172e-01 6.92297399e-01 2.57611275e-04]",
+                  "[1.42709172 1.48990917 1.69229746 1.00025761]",
+                  "[2.431171178817749, 2.315561294555664, 2.2837576866149902, 2.2987921237945557]"
                 ],
                 [
-                  35,
-                  "[0.98033333 0.97656083 0.38939917 0.81491041]",
-                  "[1.98033333 1.97656083 1.38939917 1.81491041]",
-                  "[2.9007155895233154, 2.931007146835327, 2.872464179992676, 2.8720178604125977]"
+                  64.0,
+                  "[0.60075855 0.12234765 0.00614399 0.30560958]",
+                  "[1.60075855 1.12234759 1.00614405 1.30560958]",
+                  "[2.1521613597869873, 2.0637009143829346, 1.995371699333191, 2.1883833408355713]"
                 ],
                 [
-                  28,
-                  "[0.79423058 0.07138705 0.061777   0.18766576]",
-                  "[1.79423058 1.07138705 1.061777   1.1876657 ]",
-                  "[2.2043371200561523, 2.119929790496826, 2.0417239665985107, 2.2062151432037354]"
+                  85.0,
+                  "[0.40234613 0.54987347 0.49542785 0.54153186]",
+                  "[1.40234613 1.54987347 1.49542785 1.5415318 ]",
+                  "[2.515237331390381, 2.466916799545288, 2.4108681678771973, 2.5100111961364746]"
                 ],
                 [
-                  99,
-                  "[0.68891573 0.25576538 0.96339929 0.503833  ]",
-                  "[1.68891573 1.25576544 1.96339929 1.50383306]",
-                  "[2.640495777130127, 2.628694772720337, 2.5738489627838135, 2.6524853706359863]"
+                  39.0,
+                  "[0.00497234 0.39319336 0.57054168 0.75150961]",
+                  "[1.00497234 1.39319336 1.57054162 1.75150967]",
+                  "[2.437438726425171, 2.3902065753936768, 2.3222527503967285, 2.476053237915039]"
                 ],
                 [
-                  10,
-                  "[0.50783676 0.04156506 0.21984279 0.8454656 ]",
-                  "[1.50783682 1.04156506 1.21984279 1.84546566]",
-                  "[2.3187222480773926, 2.2490477561950684, 2.237614393234253, 2.4606916904449463]"
+                  99.0,
+                  "[0.68891573 0.25576538 0.96339929 0.503833  ]",
+                  "[1.68891573 1.25576544 1.96339929 1.50383306]",
+                  "[2.652355432510376, 2.639017343521118, 2.600130319595337, 2.5669779777526855]"
                 ],
                 [
-                  37,
-                  "[0.78956431 0.87284744 0.06880784 0.03455889]",
-                  "[1.78956437 1.87284744 1.06880784 1.03455889]",
-                  "[2.48598313331604, 2.454476833343506, 2.2831082344055176, 2.2463605403900146]"
+                  70.0,
+                  "[0.47963417 0.81818312 0.48720706 0.49339259]",
+                  "[1.47963417 1.81818318 1.48720706 1.49339259]",
+                  "[2.6165666580200195, 2.5666303634643555, 2.5178661346435547, 2.6018319129943848]"
                 ],
                 [
-                  91,
-                  "[0.43500566 0.66041756 0.80293626 0.96224713]",
-                  "[1.43500566 1.66041756 1.80293632 1.96224713]",
-                  "[2.7682571411132812, 2.7744951248168945, 2.761075019836426, 2.8592607975006104]"
+                  65.0,
+                  "[0.39147133 0.29854035 0.84663737 0.58175623]",
+                  "[1.39147139 1.29854035 1.84663737 1.58175623]",
+                  "[2.5662052631378174, 2.534679889678955, 2.4866561889648438, 2.518486499786377]"
                 ],
                 [
-                  47,
-                  "[0.60110539 0.3618983  0.32342511 0.98672163]",
-                  "[1.60110545 1.3618983  1.32342505 1.98672163]",
-                  "[2.543933868408203, 2.510021686553955, 2.5257022380828857, 2.722487449645996]"
+                  25.0,
+                  "[0.68062544 0.98093534 0.14778823 0.53244978]",
+                  "[1.68062544 1.98093534 1.14778829 1.53244972]",
+                  "[2.6060662269592285, 2.5712525844573975, 2.509855270385742, 2.6539924144744873]"
                 ],
                 [
-                  40,
-                  "[0.44330525 0.09997386 0.89025736 0.90507984]",
-                  "[1.44330525 1.09997392 1.89025736 1.90507984]",
-                  "[2.5668387413024902, 2.537842035293579, 2.555079221725464, 2.749858856201172]"
+                  81.0,
+                  "[0.6032477  0.83361369 0.18538666 0.19108021]",
+                  "[1.60324764 1.83361363 1.18538666 1.19108021]",
+                  "[2.464529275894165, 2.3653628826141357, 2.320333242416382, 2.4114229679107666]"
                 ],
                 [
-                  32,
-                  "[0.30754459 0.77694583 0.09278506 0.38326019]",
-                  "[1.30754459 1.77694583 1.09278512 1.38326025]",
-                  "[2.3738114833831787, 2.3195064067840576, 2.212083339691162, 2.2918801307678223]"
+                  79.0,
+                  "[0.91730917 0.22574073 0.09591609 0.33056474]",
+                  "[1.91730917 1.22574067 1.09591603 1.33056474]",
+                  "[2.3257997035980225, 2.2782139778137207, 2.2121763229370117, 2.3205032348632812]"
                 ],
                 [
-                  45,
-                  "[0.73217702 0.65233225 0.44077861 0.33837909]",
-                  "[1.73217702 1.65233231 1.44077861 1.33837914]",
-                  "[2.5859265327453613, 2.567556619644165, 2.459083080291748, 2.479666233062744]"
+                  4.0,
+                  "[0.76807946 0.98855817 0.08259124 0.01730657]",
+                  "[1.76807952 1.98855817 1.0825913  1.01730657]",
+                  "[2.4806268215179443, 2.3638875484466553, 2.3269295692443848, 2.396709442138672]"
                 ],
                 [
-                  72,
-                  "[0.60609657 0.96257663 0.19292736 0.95702219]",
-                  "[1.60609651 1.96257663 1.19292736 1.95702219]",
-                  "[2.7291908264160156, 2.728882074356079, 2.696915626525879, 2.7788424491882324]"
+                  21.0,
+                  "[0.56922203 0.98222166 0.76851749 0.28615737]",
+                  "[1.56922197 1.9822216  1.76851749 1.28615737]",
+                  "[2.755495309829712, 2.68673038482666, 2.663788318634033, 2.644230842590332]"
                 ],
                 [
-                  86,
-                  "[0.80893755 0.92237449 0.88346356 0.93164903]",
-                  "[1.80893755 1.92237449 1.88346362 1.93164897]",
-                  "[3.024338483810425, 3.075038194656372, 3.033391237258911, 3.0232954025268555]"
+                  97.0,
+                  "[0.72795159 0.79317838 0.27832931 0.96576637]",
+                  "[1.72795153 1.79317832 1.27832937 1.96576643]",
+                  "[2.7061498165130615, 2.754149913787842, 2.6724681854248047, 2.852900266647339]"
                 ]
               ]
             },
@@ -2381,352 +2387,352 @@
               ],
               "data": [
                 [
-                  30,
+                  30.0,
                   "[0.94516498 0.08422136 0.5608117  0.07652664]",
                   "[1.94516492 1.08422136 1.56081176 1.07652664]"
                 ],
                 [
-                  31,
+                  31.0,
                   "[0.26661873 0.45946234 0.13510543 0.81294441]",
                   "[1.26661873 1.4594624  1.13510537 1.81294441]"
                 ],
                 [
-                  32,
+                  32.0,
                   "[0.30754459 0.77694583 0.09278506 0.38326019]",
                   "[1.30754459 1.77694583 1.09278512 1.38326025]"
                 ],
                 [
-                  33,
+                  33.0,
                   "[0.27845025 0.32472342 0.82203609 0.77107543]",
                   "[1.27845025 1.32472348 1.82203603 1.77107549]"
                 ],
                 [
-                  34,
+                  34.0,
                   "[0.4827103  0.10563457 0.98858833 0.82286644]",
                   "[1.48271036 1.10563457 1.98858833 1.82286644]"
                 ],
                 [
-                  35,
+                  35.0,
                   "[0.98033333 0.97656083 0.38939917 0.81491041]",
                   "[1.98033333 1.97656083 1.38939917 1.81491041]"
                 ],
                 [
-                  36,
+                  36.0,
                   "[0.74064726 0.4155122  0.09800029 0.49930882]",
                   "[1.74064732 1.4155122  1.09800029 1.49930882]"
                 ],
                 [
-                  37,
+                  37.0,
                   "[0.78956431 0.87284744 0.06880784 0.03455889]",
                   "[1.78956437 1.87284744 1.06880784 1.03455889]"
                 ],
                 [
-                  38,
+                  38.0,
                   "[0.94221359 0.57740951 0.98649532 0.40934443]",
                   "[1.94221354 1.57740951 1.98649526 1.40934443]"
                 ],
                 [
-                  39,
+                  39.0,
                   "[0.00497234 0.39319336 0.57054168 0.75150961]",
                   "[1.00497234 1.39319336 1.57054162 1.75150967]"
                 ],
                 [
-                  40,
+                  40.0,
                   "[0.44330525 0.09997386 0.89025736 0.90507984]",
                   "[1.44330525 1.09997392 1.89025736 1.90507984]"
                 ],
                 [
-                  41,
+                  41.0,
                   "[0.72290605 0.96945059 0.68354797 0.15270454]",
                   "[1.72290611 1.96945059 1.68354797 1.15270448]"
                 ],
                 [
-                  42,
+                  42.0,
                   "[0.75292218 0.81470108 0.49657214 0.56217098]",
                   "[1.75292218 1.81470108 1.49657214 1.56217098]"
                 ],
                 [
-                  43,
+                  43.0,
                   "[0.33480108 0.59181517 0.76198453 0.98062384]",
                   "[1.33480108 1.59181523 1.76198459 1.98062384]"
                 ],
                 [
-                  44,
+                  44.0,
                   "[0.52784437 0.54268694 0.12358981 0.72116476]",
                   "[1.52784443 1.54268694 1.12358975 1.7211647 ]"
                 ],
                 [
-                  45,
+                  45.0,
                   "[0.73217702 0.65233225 0.44077861 0.33837909]",
                   "[1.73217702 1.65233231 1.44077861 1.33837914]"
                 ],
                 [
-                  46,
+                  46.0,
                   "[0.34084332 0.73018837 0.54168713 0.91440833]",
                   "[1.34084332 1.73018837 1.54168713 1.91440833]"
                 ],
                 [
-                  47,
+                  47.0,
                   "[0.60110539 0.3618983  0.32342511 0.98672163]",
                   "[1.60110545 1.3618983  1.32342505 1.98672163]"
                 ],
                 [
-                  48,
+                  48.0,
                   "[0.77427191 0.21829212 0.12769502 0.74303615]",
                   "[1.77427197 1.21829212 1.12769508 1.74303615]"
                 ],
                 [
-                  49,
+                  49.0,
                   "[0.08107251 0.2602725  0.18861133 0.44833237]",
                   "[1.08107257 1.2602725  1.18861127 1.44833231]"
                 ],
                 [
-                  50,
+                  50.0,
                   "[0.59812403 0.78395379 0.0291847  0.81814629]",
                   "[1.59812403 1.78395379 1.0291847  1.81814623]"
                 ],
                 [
-                  51,
+                  51.0,
                   "[0.93488538 0.73882395 0.37345302 0.0274905 ]",
                   "[1.93488538 1.73882389 1.37345302 1.0274905 ]"
                 ],
                 [
-                  52,
+                  52.0,
                   "[0.30631393 0.48311198 0.87847513 0.67559886]",
                   "[1.30631399 1.48311198 1.87847519 1.67559886]"
                 ],
                 [
-                  53,
+                  53.0,
                   "[0.18720162 0.74115586 0.98626411 0.30355608]",
                   "[1.18720162 1.74115586 1.98626411 1.30355608]"
                 ],
                 [
-                  54,
+                  54.0,
                   "[0.85566247 0.83362883 0.48424995 0.25265992]",
                   "[1.85566247 1.83362889 1.48424995 1.25265992]"
                 ],
                 [
-                  55,
+                  55.0,
                   "[0.95928186 0.84273899 0.71514636 0.38619852]",
                   "[1.95928192 1.84273899 1.7151463  1.38619852]"
                 ],
                 [
-                  56,
+                  56.0,
                   "[0.32565445 0.90939188 0.07488042 0.13730896]",
                   "[1.32565451 1.90939188 1.07488036 1.13730896]"
                 ],
                 [
-                  57,
+                  57.0,
                   "[0.9829582  0.59269661 0.40120947 0.95487177]",
                   "[1.9829582  1.59269667 1.40120947 1.95487177]"
                 ],
                 [
-                  58,
+                  58.0,
                   "[0.79905868 0.89367443 0.75429088 0.3190186 ]",
                   "[1.79905868 1.89367437 1.75429082 1.3190186 ]"
                 ],
                 [
-                  59,
+                  59.0,
                   "[0.54914117 0.03810108 0.87531954 0.73044223]",
                   "[1.54914117 1.03810108 1.87531948 1.73044229]"
                 ],
                 [
-                  60,
+                  60.0,
                   "[0.67418337 0.79634351 0.23229051 0.71345252]",
                   "[1.67418337 1.79634356 1.23229051 1.71345258]"
                 ],
                 [
-                  61,
+                  61.0,
                   "[0.87285906 0.48354989 0.39394957 0.59456545]",
                   "[1.872859   1.48354983 1.39394951 1.59456539]"
                 ],
                 [
-                  62,
+                  62.0,
                   "[0.81788456 0.58174163 0.29376316 0.7971254 ]",
                   "[1.81788456 1.58174157 1.29376316 1.79712534]"
                 ],
                 [
-                  63,
+                  63.0,
                   "[0.94559073 0.65736622 0.25761551 0.48553199]",
                   "[1.94559073 1.65736628 1.25761557 1.48553205]"
                 ],
                 [
-                  64,
+                  64.0,
                   "[0.60075855 0.12234765 0.00614399 0.30560958]",
                   "[1.60075855 1.12234759 1.00614405 1.30560958]"
                 ],
                 [
-                  65,
+                  65.0,
                   "[0.39147133 0.29854035 0.84663737 0.58175623]",
                   "[1.39147139 1.29854035 1.84663737 1.58175623]"
                 ],
                 [
-                  66,
+                  66.0,
                   "[0.02162331 0.81861657 0.92468154 0.07808572]",
                   "[1.02162337 1.81861663 1.92468154 1.07808566]"
                 ],
                 [
-                  67,
+                  67.0,
                   "[0.02235305 0.52774918 0.7331115  0.84358269]",
                   "[1.02235305 1.52774918 1.7331115  1.84358263]"
                 ],
                 [
-                  68,
+                  68.0,
                   "[0.6080932  0.56563014 0.32107437 0.72599429]",
                   "[1.60809326 1.5656302  1.32107437 1.72599435]"
                 ],
                 [
-                  69,
+                  69.0,
                   "[0.67447788 0.6125319  0.98007888 0.65968603]",
                   "[1.67447782 1.6125319  1.98007894 1.65968609]"
                 ],
                 [
-                  70,
+                  70.0,
                   "[0.47963417 0.81818312 0.48720706 0.49339259]",
                   "[1.47963417 1.81818318 1.48720706 1.49339259]"
                 ],
                 [
-                  71,
+                  71.0,
                   "[0.9630242  0.76359051 0.24853623 0.76881069]",
                   "[1.96302414 1.76359057 1.24853623 1.76881075]"
                 ],
                 [
-                  72,
+                  72.0,
                   "[0.60609657 0.96257663 0.19292736 0.95702219]",
                   "[1.60609651 1.96257663 1.19292736 1.95702219]"
                 ],
                 [
-                  73,
+                  73.0,
                   "[0.80654246 0.08253473 0.74478531 0.71257162]",
                   "[1.8065424  1.08253479 1.74478531 1.71257162]"
                 ],
                 [
-                  74,
+                  74.0,
                   "[0.70167565 0.26930219 0.5660674  0.61194974]",
                   "[1.70167565 1.26930213 1.56606746 1.61194968]"
                 ],
                 [
-                  75,
+                  75.0,
                   "[0.76933283 0.86241865 0.44114518 0.65644735]",
                   "[1.76933289 1.86241865 1.44114518 1.65644741]"
                 ],
                 [
-                  76,
+                  76.0,
                   "[0.59492421 0.90274489 0.38069052 0.46101224]",
                   "[1.59492421 1.90274489 1.38069057 1.46101224]"
                 ],
                 [
-                  77,
+                  77.0,
                   "[0.15064228 0.03198934 0.25754827 0.51484001]",
                   "[1.15064228 1.03198934 1.25754833 1.51484001]"
                 ],
                 [
-                  78,
+                  78.0,
                   "[0.12024075 0.21342516 0.56858408 0.58644271]",
                   "[1.12024069 1.21342516 1.56858408 1.58644271]"
                 ],
                 [
-                  79,
+                  79.0,
                   "[0.91730917 0.22574073 0.09591609 0.33056474]",
                   "[1.91730917 1.22574067 1.09591603 1.33056474]"
                 ],
                 [
-                  80,
+                  80.0,
                   "[0.49691743 0.61873293 0.90698647 0.94486356]",
                   "[1.49691749 1.61873293 1.90698647 1.94486356]"
                 ],
                 [
-                  81,
+                  81.0,
                   "[0.6032477  0.83361369 0.18538666 0.19108021]",
                   "[1.60324764 1.83361363 1.18538666 1.19108021]"
                 ],
                 [
-                  82,
+                  82.0,
                   "[0.63235509 0.70352674 0.96188956 0.46240485]",
                   "[1.63235509 1.70352674 1.96188951 1.46240485]"
                 ],
                 [
-                  83,
+                  83.0,
                   "[0.37959969 0.42820001 0.10690689 0.96353984]",
                   "[1.37959969 1.42820001 1.10690689 1.96353984]"
                 ],
                 [
-                  84,
+                  84.0,
                   "[0.49607176 0.1922397  0.46640229 0.78321403]",
                   "[1.49607182 1.19223976 1.46640229 1.78321409]"
                 ],
                 [
-                  85,
+                  85.0,
                   "[0.40234613 0.54987347 0.49542785 0.54153186]",
                   "[1.40234613 1.54987347 1.49542785 1.5415318 ]"
                 ],
                 [
-                  86,
+                  86.0,
                   "[0.80893755 0.92237449 0.88346356 0.93164903]",
                   "[1.80893755 1.92237449 1.88346362 1.93164897]"
                 ],
                 [
-                  87,
+                  87.0,
                   "[0.12858278 0.09930819 0.83222693 0.72485673]",
                   "[1.12858272 1.09930825 1.83222699 1.72485673]"
                 ],
                 [
-                  88,
+                  88.0,
                   "[0.72470158 0.4940322  0.41027349 0.89364016]",
                   "[1.72470164 1.49403214 1.41027355 1.89364016]"
                 ],
                 [
-                  89,
+                  89.0,
                   "[0.47856545 0.46267092 0.6376707  0.84747767]",
                   "[1.47856545 1.46267092 1.63767076 1.84747767]"
                 ],
                 [
-                  90,
+                  90.0,
                   "[0.49584109 0.80599248 0.07096875 0.75872749]",
                   "[1.49584103 1.80599248 1.07096875 1.75872755]"
                 ],
                 [
-                  91,
+                  91.0,
                   "[0.43500566 0.66041756 0.80293626 0.96224713]",
                   "[1.43500566 1.66041756 1.80293632 1.96224713]"
                 ],
                 [
-                  92,
+                  92.0,
                   "[0.78397602 0.74223626 0.26603186 0.41664881]",
                   "[1.78397608 1.74223626 1.26603186 1.41664886]"
                 ],
                 [
-                  93,
+                  93.0,
                   "[0.28942841 0.05601001 0.33039129 0.27781558]",
                   "[1.28942847 1.05601001 1.33039129 1.27781558]"
                 ],
                 [
-                  94,
+                  94.0,
                   "[0.68094063 0.45189077 0.22661722 0.37354094]",
                   "[1.68094063 1.45189071 1.22661722 1.37354088]"
                 ],
                 [
-                  95,
+                  95.0,
                   "[0.43681622 0.74680805 0.83598751 0.12414402]",
                   "[1.43681622 1.74680805 1.83598757 1.12414408]"
                 ],
                 [
-                  96,
+                  96.0,
                   "[0.47870928 0.17129105 0.27300501 0.20634609]",
                   "[1.47870922 1.17129111 1.27300501 1.20634604]"
                 ],
                 [
-                  97,
+                  97.0,
                   "[0.72795159 0.79317838 0.27832931 0.96576637]",
                   "[1.72795153 1.79317832 1.27832937 1.96576643]"
                 ],
                 [
-                  98,
+                  98.0,
                   "[0.87608397 0.93200487 0.80169648 0.37758952]",
                   "[1.87608397 1.93200493 1.80169654 1.37758946]"
                 ],
                 [
-                  99,
+                  99.0,
                   "[0.68891573 0.25576538 0.96339929 0.503833  ]",
                   "[1.68891573 1.25576544 1.96339929 1.50383306]"
                 ]
@@ -2738,310 +2744,310 @@
               ],
               "data": [
                 [
-                  5.800187110900879
+                  5.951645851135254
                 ],
                 [
-                  5.598123073577881
+                  5.274348735809326
                 ],
                 [
-                  5.42051887512207
+                  4.588619709014893
                 ],
                 [
-                  5.2726593017578125
+                  3.966594934463501
                 ],
                 [
-                  5.157590389251709
+                  3.0671465396881104
                 ],
                 [
-                  5.0745649337768555
+                  2.3460588455200195
                 ],
                 [
-                  5.0191521644592285
+                  1.986690640449524
                 ],
                 [
-                  4.984806537628174
+                  1.8489981889724731
                 ],
                 [
-                  4.964847564697266
+                  1.801417589187622
                 ],
                 [
-                  4.953816890716553
+                  1.7839369773864746
                 ],
                 [
-                  4.947908878326416
+                  1.7767301797866821
                 ],
                 [
-                  4.944762706756592
+                  1.7733982801437378
                 ],
                 [
-                  4.943039417266846
+                  1.7716325521469116
                 ],
                 [
-                  4.942024230957031
+                  1.7705225944519043
                 ],
                 [
-                  4.941353797912598
+                  1.7696930170059204
                 ],
                 [
-                  4.9408488273620605
+                  1.7689863443374634
                 ],
                 [
-                  4.940422058105469
+                  1.7683357000350952
                 ],
                 [
-                  4.940032482147217
+                  1.7677124738693237
                 ],
                 [
-                  4.939662456512451
+                  1.7671048641204834
                 ],
                 [
-                  4.939301013946533
+                  1.766507625579834
                 ],
                 [
-                  4.938945293426514
+                  1.7659177780151367
                 ],
                 [
-                  4.938592910766602
+                  1.7653343677520752
                 ],
                 [
-                  4.9382429122924805
+                  1.7647572755813599
                 ],
                 [
-                  4.937894344329834
+                  1.764186143875122
                 ],
                 [
-                  4.937548637390137
+                  1.763621211051941
                 ],
                 [
-                  4.937204837799072
+                  1.763061761856079
                 ],
                 [
-                  4.936861515045166
+                  1.762508511543274
                 ],
                 [
-                  4.936521053314209
+                  1.7619603872299194
                 ],
                 [
-                  4.936007976531982
+                  1.7614178657531738
                 ],
                 [
-                  4.928510665893555
+                  1.760880470275879
                 ],
                 [
-                  4.7543463706970215
+                  1.7603485584259033
                 ],
                 [
-                  4.202136039733887
+                  1.7598220109939575
                 ],
                 [
-                  3.841205596923828
+                  1.7593002319335938
                 ],
                 [
-                  3.605153799057007
+                  1.7587836980819702
                 ],
                 [
-                  3.4602854251861572
+                  1.7582720518112183
                 ],
                 [
-                  3.377415657043457
+                  1.7577650547027588
                 ],
                 [
-                  3.3322527408599854
+                  1.757262945175171
                 ],
                 [
-                  3.308159589767456
+                  1.7567654848098755
                 ],
                 [
-                  3.2952585220336914
+                  1.756272792816162
                 ],
                 [
-                  3.288172960281372
+                  1.755784511566162
                 ],
                 [
-                  3.2841086387634277
+                  1.755300760269165
                 ],
                 [
-                  3.2816221714019775
+                  1.7548213005065918
                 ],
                 [
-                  3.2797133922576904
+                  1.7543463706970215
                 ],
                 [
-                  3.251174211502075
+                  1.7538751363754272
                 ],
                 [
-                  2.534057140350342
+                  1.7534087896347046
                 ],
                 [
-                  2.100238800048828
+                  1.7529460191726685
                 ],
                 [
-                  1.8637852668762207
+                  1.7524876594543457
                 ],
                 [
-                  1.7448025941848755
+                  1.752032995223999
                 ],
                 [
-                  1.6882381439208984
+                  1.751582384109497
                 ],
                 [
-                  1.6618977785110474
+                  1.7511354684829712
                 ],
                 [
-                  1.6495403051376343
+                  1.75069260597229
                 ],
                 [
-                  1.6435632705688477
+                  1.7502535581588745
                 ],
                 [
-                  1.6405097246170044
+                  1.7498178482055664
                 ],
                 [
-                  1.6388026475906372
+                  1.7493858337402344
                 ],
                 [
-                  1.6377187967300415
+                  1.7489577531814575
                 ],
                 [
-                  1.6369259357452393
+                  1.748533010482788
                 ],
                 [
-                  1.6362708806991577
+                  1.7481114864349365
                 ],
                 [
-                  1.635683536529541
+                  1.7476938962936401
                 ],
                 [
-                  1.6351302862167358
+                  1.7472795248031616
                 ],
                 [
-                  1.6345962285995483
+                  1.746868371963501
                 ],
                 [
-                  1.634074091911316
+                  1.7464605569839478
                 ],
                 [
-                  1.6335605382919312
+                  1.7460559606552124
                 ],
                 [
-                  1.6330533027648926
+                  1.7456544637680054
                 ],
                 [
-                  1.6325511932373047
+                  1.7452563047409058
                 ],
                 [
-                  1.6320583820343018
+                  1.744861125946045
                 ],
                 [
-                  1.6315733194351196
+                  1.7444690465927124
                 ],
                 [
-                  1.6311031579971313
+                  1.7440800666809082
                 ],
                 [
-                  1.6306471824645996
+                  1.7436938285827637
                 ],
                 [
-                  1.6301956176757812
+                  1.7433106899261475
                 ],
                 [
-                  1.6297489404678345
+                  1.74293053150177
                 ],
                 [
-                  1.629309892654419
+                  1.7425531148910522
                 ],
                 [
-                  1.6288747787475586
+                  1.7421785593032837
                 ],
                 [
-                  1.6284427642822266
+                  1.7418066263198853
                 ],
                 [
-                  1.6280156373977661
+                  1.7414374351501465
                 ],
                 [
-                  1.6275969743728638
+                  1.7410712242126465
                 ],
                 [
-                  1.6271847486495972
+                  1.740707516670227
                 ],
                 [
-                  1.6267770528793335
+                  1.7403463125228882
                 ],
                 [
-                  1.6263741254806519
+                  1.739988088607788
                 ],
                 [
-                  1.625981092453003
+                  1.7396321296691895
                 ],
                 [
-                  1.625562071800232
+                  1.739278793334961
                 ],
                 [
-                  1.6234854459762573
+                  1.738927960395813
                 ],
                 [
-                  1.526026964187622
+                  1.7385796308517456
                 ],
                 [
-                  0.7520114779472351
+                  1.7382338047027588
                 ],
                 [
-                  0.36320704221725464
+                  1.7378901243209839
                 ],
                 [
-                  0.19313177466392517
+                  1.7375489473342896
                 ],
                 [
-                  0.12368442118167877
+                  1.7372102737426758
                 ],
                 [
-                  0.09587223827838898
+                  1.7368735074996948
                 ],
                 [
-                  0.08457889407873154
+                  1.7365405559539795
                 ],
                 [
-                  0.07980319857597351
+                  1.736209511756897
                 ],
                 [
-                  0.07760757952928543
+                  1.735880970954895
                 ],
                 [
-                  0.0764402449131012
+                  1.7355544567108154
                 ],
                 [
-                  0.07568377256393433
+                  1.7352303266525269
                 ],
                 [
-                  0.0751044973731041
+                  1.7349083423614502
                 ],
                 [
-                  0.07460036873817444
+                  1.734588384628296
                 ],
                 [
-                  0.07414067536592484
+                  1.7342705726623535
                 ],
                 [
-                  0.073702372610569
+                  1.7339547872543335
                 ],
                 [
-                  0.07327572256326675
+                  1.7336410284042358
                 ],
                 [
-                  0.0728573128581047
+                  1.7333295345306396
                 ],
                 [
-                  0.07244749367237091
+                  1.7330199480056763
                 ],
                 [
-                  0.07204563170671463
+                  1.7327126264572144
                 ]
               ]
             }
           },
           "other": {
-            "model": "ModelConfig(model=Sequential(\n  (0) - Identity(): Input__tensor_1_output -> START_Repeat_1_output\n  (1) - Linear(4, 4, bias=True): START_Repeat_1_output -> Linear_1_output\n  (2) - <function leaky_relu at 0x78e367f84d60>: Linear_1_output -> Activation_1_output\n  (3) - Identity(): Activation_1_output -> START_Repeat_1_output\n  (4) - Linear(4, 4, bias=True): START_Repeat_1_output -> Linear_1_output\n  (5) - <function leaky_relu at 0x78e367f84d60>: Linear_1_output -> Activation_1_output\n  (6) - Identity(): Activation_1_output -> END_Repeat_1_output\n  (7) - Identity(): END_Repeat_1_output -> Output_1_x\n  (8) - Identity(): Output_1_x -> Output_1_x\n), model_inputs=['Input__tensor_1_output'], model_outputs=['Output_1_x'], loss_inputs=['Output_1_x', 'Input__tensor_3_output'], loss=Sequential(\n  (0) - <function constant_vector.<locals>.<lambda> at 0x78e237191260>: nothing -> Constant_vector_1_output\n  (1) - <built-in method add of type object at 0x78e36059ef00>: Input__tensor_3_output, Constant_vector_1_output -> Add_1_output\n  (2) - <function mse_loss at 0x78e367f86840>: Output_1_x, Add_1_output -> MSE_loss_2_output\n  (3) - Identity(): MSE_loss_2_output -> loss\n), optimizer_parameters={'lr': 0.1, 'type': <OptionsFor_type.SGD: 4>}, optimizer=SGD (\nParameter Group 0\n    dampening: 0\n    differentiable: False\n    foreach: None\n    fused: None\n    lr: 0.1\n    maximize: False\n    momentum: 0\n    nesterov: False\n    weight_decay: 0\n), source_workspace='Model definition', trained=True)"
+            "model": "ModelConfig(model=Sequential(\n  (0) - Identity(): Input__tensor_1_output -> START_Repeat_1_output\n  (1) - Linear(4, 4, bias=True): START_Repeat_1_output -> Linear_1_output\n  (2) - <function leaky_relu at 0x7f4117e80ea0>: Linear_1_output -> Activation_1_output\n  (3) - Identity(): Activation_1_output -> START_Repeat_1_output\n  (4) - Linear(4, 4, bias=True): START_Repeat_1_output -> Linear_1_output\n  (5) - <function leaky_relu at 0x7f4117e80ea0>: Linear_1_output -> Activation_1_output\n  (6) - Identity(): Activation_1_output -> END_Repeat_1_output\n  (7) - Identity(): END_Repeat_1_output -> Output_1_x\n  (8) - Identity(): Output_1_x -> Output_1_x\n), model_inputs=['Input__tensor_1_output'], model_outputs=['Output_1_x'], loss_inputs=['Input__tensor_3_output', 'Output_1_x'], loss=Sequential(\n  (0) - <function constant_vector.<locals>.<lambda> at 0x7f4051099620>: nothing -> Constant_vector_1_output\n  (1) - <built-in method add of type object at 0x7f411059ef00>: Input__tensor_3_output, Constant_vector_1_output -> Add_1_output\n  (2) - <function mse_loss at 0x7f4117e82980>: Output_1_x, Add_1_output -> MSE_loss_2_output\n  (3) - Identity(): MSE_loss_2_output -> loss\n), optimizer_parameters={'lr': 0.1, 'type': <OptionsFor_type.SGD: 4>}, optimizer=SGD (\nParameter Group 0\n    dampening: 0\n    differentiable: False\n    foreach: None\n    fused: None\n    lr: 0.1\n    maximize: False\n    momentum: 0\n    nesterov: False\n    weight_decay: 0\n), source_workspace='Model definition', trained=True)"
           },
           "relations": []
         },
@@ -3083,8 +3089,8 @@
                     "Input__tensor_1_output"
                   ],
                   "loss_inputs": [
-                    "Output_1_x",
-                    "Input__tensor_3_output"
+                    "Input__tensor_3_output",
+                    "Output_1_x"
                   ],
                   "outputs": [
                     "Output_1_x"
@@ -3098,26 +3104,27 @@
           }
         ],
         "meta": {
-          "inputs": {
-            "bundle": {
+          "color": "orange",
+          "inputs": [
+            {
               "name": "bundle",
               "position": "left",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
+          ],
           "name": "View tables",
-          "outputs": {},
-          "params": {
-            "limit": {
+          "outputs": [],
+          "params": [
+            {
               "default": 100.0,
               "name": "limit",
               "type": {
                 "type": "<class 'int'>"
               }
             }
-          },
+          ],
           "type": "table_view"
         },
         "params": {
@@ -3148,184 +3155,184 @@
             {
               "data": [
                 [
-                  5.752160549163818,
-                  -0.8232598900794983,
+                  788.9803466796875,
+                  -51.541831970214844,
                   "",
-                  -2.058953046798706
+                  9.09527587890625
                 ],
                 [
-                  0.7012296915054321,
-                  0.5504218339920044,
+                  602.7313232421875,
+                  524.9680786132812,
                   "",
-                  4.149958610534668
+                  4.464115142822266
                 ],
                 [
-                  2.945161819458008,
-                  -1.014856219291687,
+                  -936.723876953125,
+                  -598.2774658203125,
                   "",
-                  0.019882630556821823
+                  13.456573486328125
                 ],
                 [
-                  2.5901684761047363,
-                  -1.2229167222976685,
+                  -740.7808837890625,
+                  -169.9661407470703,
                   "",
-                  0.34879058599472046
+                  3.4803123474121094
                 ],
                 [
-                  1.4952237606048584,
-                  -0.1513950079679489,
+                  -463.2208251953125,
+                  -782.707275390625,
                   "",
-                  2.7570903301239014
+                  14.162765502929688
                 ],
                 [
-                  1.344888687133789,
-                  -1.1611599922180176,
+                  -591.0269775390625,
+                  -1083.541259765625,
                   "",
-                  2.0714128017425537
+                  10.555366516113281
                 ],
                 [
-                  0.3736271560192108,
-                  0.34866970777511597,
+                  -1005.5611572265625,
+                  -858.7088623046875,
                   "",
-                  3.9460649490356445
+                  8.691032409667969
                 ],
                 [
-                  4.606325149536133,
-                  -0.44266968965530396,
+                  853.4742431640625,
+                  313.06414794921875,
                   "",
-                  -1.2447248697280884
+                  13.883481979370117
                 ],
                 [
-                  0.8212581276893616,
-                  -0.6836636066436768,
+                  694.8038330078125,
+                  873.2905883789062,
                   "",
-                  5.419023513793945
+                  13.051898956298828
                 ],
                 [
-                  3.042868137359619,
-                  -1.6362674236297607,
+                  -71.77912902832031,
+                  360.3193359375,
                   "",
-                  0.780156135559082
+                  15.06808090209961
                 ],
                 [
-                  0.7296130061149597,
-                  -0.1887897551059723,
+                  820.8765869140625,
+                  29.677410125732422,
                   "",
-                  3.203200578689575
+                  5.008731842041016
                 ],
                 [
-                  0.8891782760620117,
-                  1.2451283931732178,
+                  -991.318115234375,
+                  732.60205078125,
                   "",
-                  4.304920196533203
+                  12.890125274658203
                 ],
                 [
-                  4.700596332550049,
-                  -0.063453808426857,
+                  554.213134765625,
+                  -916.6630859375,
                   "",
-                  -1.466339349746704
+                  7.605861663818359
                 ],
                 [
-                  2.212623119354248,
-                  -0.24241189658641815,
+                  145.04811096191406,
+                  -901.040771484375,
                   "",
-                  1.563027262687683
+                  5.379741668701172
                 ],
                 [
-                  5.110715866088867,
-                  -1.116548776626587,
+                  1018.691650390625,
+                  1071.2506103515625,
                   "",
-                  -2.46594500541687
+                  10.797737121582031
                 ],
                 [
-                  3.6852052211761475,
-                  -1.414133071899414,
+                  -476.2529602050781,
+                  817.712890625,
                   "",
-                  -3.59246563911438
+                  14.483116149902344
                 ],
                 [
-                  5.279581069946289,
-                  -0.6892402172088623,
+                  -840.4203491210938,
+                  729.9735717773438,
                   "",
-                  -2.0778040885925293
+                  8.294794082641602
                 ],
                 [
-                  4.4375996589660645,
-                  -1.3382771015167236,
+                  -31.723953247070312,
+                  849.07275390625,
                   "",
-                  -3.1805598735809326
+                  4.843757629394531
                 ],
                 [
-                  0.4160999357700348,
-                  1.0794298648834229,
+                  -463.68719482421875,
+                  324.799072265625,
                   "",
-                  4.508198261260986
+                  4.095094680786133
                 ],
                 [
-                  5.0630598068237305,
-                  -0.9982349276542664,
+                  766.6671142578125,
+                  757.201416015625,
                   "",
-                  -2.31571626663208
+                  7.2570648193359375
                 ],
                 [
-                  1.388333797454834,
-                  -0.6052800416946411,
+                  -693.414306640625,
+                  1021.6004638671875,
                   "",
-                  2.2662086486816406
+                  5.442634582519531
                 ],
                 [
-                  5.247096061706543,
-                  -1.422383189201355,
+                  60.164451599121094,
+                  -653.205322265625,
                   "",
-                  -2.9033005237579346
+                  11.511402130126953
                 ],
                 [
-                  5.0349931716918945,
-                  -0.20492368936538696,
+                  -198.70584106445312,
+                  931.2337646484375,
                   "",
-                  -1.5952072143554688
+                  10.254695892333984
                 ],
                 [
-                  0.8588991165161133,
-                  0.931562602519989,
+                  -801.8848876953125,
+                  137.9746551513672,
                   "",
-                  4.554385185241699
+                  9.343021392822266
                 ],
                 [
-                  2.5351479053497314,
-                  -0.6277468204498291,
+                  879.371337890625,
+                  -865.5347900390625,
                   "",
-                  -0.05971255153417587
+                  9.882560729980469
                 ],
                 [
-                  2.1338918209075928,
-                  -0.7544606328010559,
+                  1085.8511962890625,
+                  -983.2652587890625,
                   "",
-                  1.1391218900680542
+                  6.058769226074219
                 ],
                 [
-                  5.549644470214844,
-                  -0.3897499740123749,
+                  -767.4273681640625,
+                  -607.4093017578125,
                   "",
-                  -2.751723289489746
+                  4.310338973999023
                 ],
                 [
-                  2.397034168243408,
-                  -1.7871567010879517,
+                  -482.94732666015625,
+                  -838.2176513671875,
                   "",
-                  0.6067442297935486
+                  5.693187713623047
                 ],
                 [
-                  1.2974268198013306,
-                  0.5350163578987122,
+                  799.220703125,
+                  -555.1533203125,
                   "",
-                  3.7050516605377197
+                  13.654813766479492
                 ],
                 [
-                  0.1969093680381775,
-                  1.3218902349472046,
+                  330.50946044921875,
+                  -629.55126953125,
                   "",
-                  4.904805660247803
+                  14.695697784423828
                 ]
               ],
               "symbolSize": 25.65378780242026,
@@ -3340,7 +3347,7 @@
           },
           "visualMap": {
             "calculable": true,
-            "dimension": 3,
+            "dimension": 3.0,
             "inRange": {
               "color": [
                 "#440154",
@@ -3355,9 +3362,9 @@
                 "#FDE725"
               ]
             },
-            "max": 5.419023513793945,
-            "min": -3.59246563911438,
-            "right": 10,
+            "max": 15.06808090209961,
+            "min": 3.4803123474121094,
+            "right": 10.0,
             "top": "center"
           },
           "xAxis": [
@@ -3409,8 +3416,8 @@
                     "Input__tensor_1_output"
                   ],
                   "loss_inputs": [
-                    "Output_1_x",
-                    "Input__tensor_3_output"
+                    "Input__tensor_3_output",
+                    "Output_1_x"
                   ],
                   "outputs": [
                     "Output_1_x"
@@ -3424,27 +3431,56 @@
           }
         ],
         "meta": {
-          "inputs": {
-            "bundle": {
+          "color": "orange",
+          "inputs": [
+            {
               "name": "bundle",
               "position": "left",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
+          ],
           "name": "View vectors",
-          "outputs": {},
-          "params": {
-            "label_column": {
+          "outputs": [],
+          "params": [
+            {
+              "default": "nodes",
+              "name": "table_name",
+              "type": {
+                "type": "<class 'str'>"
+              }
+            },
+            {
+              "default": "",
+              "name": "vector_column",
+              "type": {
+                "type": "<class 'str'>"
+              }
+            },
+            {
               "default": "",
               "name": "label_column",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "metric": {
-              "default": "euclidean",
+            {
+              "default": 15.0,
+              "name": "n_neighbors",
+              "type": {
+                "type": "<class 'int'>"
+              }
+            },
+            {
+              "default": 0.1,
+              "name": "min_dist",
+              "type": {
+                "type": "<class 'float'>"
+              }
+            },
+            {
+              "default": null,
               "name": "metric",
               "type": {
                 "enum": [
@@ -3465,36 +3501,8 @@
                   "hamming"
                 ]
               }
-            },
-            "min_dist": {
-              "default": 0.1,
-              "name": "min_dist",
-              "type": {
-                "type": "<class 'float'>"
-              }
-            },
-            "n_neighbors": {
-              "default": 15.0,
-              "name": "n_neighbors",
-              "type": {
-                "type": "<class 'int'>"
-              }
-            },
-            "table_name": {
-              "default": "nodes",
-              "name": "table_name",
-              "type": {
-                "type": "<class 'str'>"
-              }
-            },
-            "vector_column": {
-              "default": "",
-              "name": "vector_column",
-              "type": {
-                "type": "<class 'str'>"
-              }
             }
-          },
+          ],
           "type": "visualization"
         },
         "params": {

examples/NetworkX demo.lynxkite.json

@@ -531,40 +531,40 @@
           }
         ],
         "meta": {
-          "inputs": {
-            "graph": {
+          "inputs": [
+            {
               "name": "graph",
               "position": "left",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
+          ],
           "name": "Visualize graph",
-          "outputs": {},
-          "params": {
-            "color_edges_by": {
+          "outputs": [],
+          "params": [
+            {
               "default": null,
               "name": "color_edges_by",
               "type": {
                 "format": "edge attribute"
               }
             },
-            "color_nodes_by": {
+            {
               "default": null,
               "name": "color_nodes_by",
               "type": {
                 "format": "node attribute"
               }
             },
-            "label_by": {
+            {
               "default": null,
               "name": "label_by",
               "type": {
                 "format": "node attribute"
               }
             }
-          },
+          ],
           "type": "visualization"
         },
         "params": {
@@ -9730,40 +9730,40 @@
           }
         ],
         "meta": {
-          "inputs": {
-            "graph": {
+          "inputs": [
+            {
               "name": "graph",
               "position": "left",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
+          ],
           "name": "Visualize graph",
-          "outputs": {},
-          "params": {
-            "color_edges_by": {
+          "outputs": [],
+          "params": [
+            {
               "default": null,
               "name": "color_edges_by",
               "type": {
                 "format": "edge attribute"
               }
             },
-            "color_nodes_by": {
+            {
               "default": null,
               "name": "color_nodes_by",
               "type": {
                 "format": "node attribute"
               }
             },
-            "label_by": {
+            {
               "default": null,
               "name": "label_by",
               "type": {
                 "format": "node attribute"
               }
             }
-          },
+          ],
           "type": "visualization"
         },
         "params": {
@@ -9792,26 +9792,26 @@
         "in_progress": true,
         "input_metadata": [],
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "NX \u203a Ladder Graph",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "<class 'networkx.classes.graph.Graph'>"
               }
             }
-          },
-          "params": {
-            "n": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "n",
               "type": {
                 "type": "<class 'int'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -9842,34 +9842,34 @@
           {}
         ],
         "meta": {
-          "inputs": {
-            "graph": {
+          "inputs": [
+            {
               "name": "graph",
               "position": "left",
               "type": {
                 "type": "<class 'networkx.classes.graph.Graph'>"
               }
             }
-          },
+          ],
           "name": "Sample graph",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "nodes": {
+          ],
+          "params": [
+            {
               "default": 100.0,
               "name": "nodes",
               "type": {
                 "type": "<class 'int'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -9900,34 +9900,34 @@
           {}
         ],
         "meta": {
-          "inputs": {
-            "graph": {
+          "inputs": [
+            {
               "name": "graph",
               "position": "left",
               "type": {
                 "type": "<class 'networkx.classes.graph.Graph'>"
               }
             }
-          },
+          ],
           "name": "Sample graph",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "nodes": {
+          ],
+          "params": [
+            {
               "default": 100.0,
               "name": "nodes",
               "type": {
                 "type": "<class 'int'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -10409,40 +10409,40 @@
           }
         ],
         "meta": {
-          "inputs": {
-            "graph": {
+          "inputs": [
+            {
               "name": "graph",
               "position": "left",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
+          ],
           "name": "Visualize graph",
-          "outputs": {},
-          "params": {
-            "color_edges_by": {
+          "outputs": [],
+          "params": [
+            {
               "default": null,
               "name": "color_edges_by",
               "type": {
                 "format": "edge attribute"
               }
             },
-            "color_nodes_by": {
+            {
               "default": null,
               "name": "color_nodes_by",
               "type": {
                 "format": "node attribute"
               }
             },
-            "label_by": {
+            {
               "default": null,
               "name": "label_by",
               "type": {
                 "format": "node attribute"
               }
             }
-          },
+          ],
           "type": "visualization"
         },
         "params": {
@@ -10473,26 +10473,26 @@
           {}
         ],
         "meta": {
-          "inputs": {
-            "G": {
+          "inputs": [
+            {
               "name": "G",
               "position": "left",
               "type": {
                 "type": "<class 'networkx.classes.graph.Graph'>"
               }
             }
-          },
+          ],
           "name": "NX \u203a Core Number",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "<class 'networkx.classes.graph.Graph'>"
               }
             }
-          },
-          "params": {},
+          ],
+          "params": [],
           "type": "basic"
         },
         "params": {},
@@ -10521,26 +10521,26 @@
           {}
         ],
         "meta": {
-          "inputs": {
-            "graph": {
+          "inputs": [
+            {
               "name": "graph",
               "position": "left",
               "type": {
                 "type": "<class 'networkx.classes.graph.Graph'>"
               }
             }
-          },
+          ],
           "name": "Discard loop edges",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {},
+          ],
+          "params": [],
           "type": "basic"
         },
         "params": {},
@@ -10567,18 +10567,18 @@
         "in_progress": true,
         "input_metadata": [],
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "NX \u203a Karate Club Graph",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "<class 'networkx.classes.graph.Graph'>"
               }
             }
-          },
-          "params": {},
+          ],
+          "params": [],
           "type": "basic"
         },
         "params": {},
@@ -11608,40 +11608,40 @@
           }
         ],
         "meta": {
-          "inputs": {
-            "graph": {
+          "inputs": [
+            {
               "name": "graph",
               "position": "left",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
+          ],
           "name": "Visualize graph",
-          "outputs": {},
-          "params": {
-            "color_edges_by": {
+          "outputs": [],
+          "params": [
+            {
               "default": null,
               "name": "color_edges_by",
               "type": {
                 "format": "edge attribute"
               }
             },
-            "color_nodes_by": {
+            {
               "default": null,
               "name": "color_nodes_by",
               "type": {
                 "format": "node attribute"
               }
             },
-            "label_by": {
+            {
               "default": null,
               "name": "label_by",
               "type": {
                 "format": "node attribute"
               }
             }
-          },
+          ],
           "type": "visualization"
         },
         "params": {
@@ -11668,68 +11668,68 @@
         "error": null,
         "input_metadata": [],
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "NX \u203a Scale-Free Graph",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "<class 'networkx.classes.graph.Graph'>"
               }
             }
-          },
-          "params": {
-            "alpha": {
+          ],
+          "params": [
+            {
               "default": "0.41",
               "name": "alpha",
               "type": {
                 "type": "<class 'float'>"
               }
             },
-            "beta": {
+            {
               "default": "0.54",
               "name": "beta",
               "type": {
                 "type": "<class 'float'>"
               }
             },
-            "delta_in": {
+            {
               "default": "0.2",
               "name": "delta_in",
               "type": {
                 "type": "<class 'float'>"
               }
             },
-            "delta_out": {
+            {
               "default": "0",
               "name": "delta_out",
               "type": {
                 "type": "<class 'float'>"
               }
             },
-            "gamma": {
+            {
               "default": "0.05",
               "name": "gamma",
               "type": {
                 "type": "<class 'float'>"
               }
             },
-            "n": {
+            {
               "default": null,
               "name": "n",
               "type": {
                 "type": "<class 'int'>"
               }
             },
-            "seed": {
+            {
               "default": null,
               "name": "seed",
               "type": {
                 "type": "int | None"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -11764,55 +11764,55 @@
           {}
         ],
         "meta": {
-          "inputs": {
-            "G": {
+          "inputs": [
+            {
               "name": "G",
               "position": "left",
               "type": {
                 "type": "<class 'networkx.classes.graph.Graph'>"
               }
             }
-          },
+          ],
           "name": "NX \u203a PageRank",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "<class 'networkx.classes.graph.Graph'>"
               }
             }
-          },
-          "params": {
-            "alpha": {
+          ],
+          "params": [
+            {
               "default": "0.85",
               "name": "alpha",
               "type": {
                 "type": "float | None"
               }
             },
-            "max_iter": {
+            {
               "default": "100",
               "name": "max_iter",
               "type": {
                 "type": "int | None"
               }
             },
-            "tol": {
+            {
               "default": "1e-06",
               "name": "tol",
               "type": {
                 "type": "float | None"
               }
             },
-            "weight": {
+            {
               "default": "weight",
               "name": "weight",
               "type": {
                 "type": "str | None"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {

examples/ODE-GNN experiment.lynxkite.json

@@ -52,26 +52,26 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "Biomedical foundation graph (PLACEHOLDER)",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "filter_nodes": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "filter_nodes",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -97,41 +97,41 @@
         "display": null,
         "error": "Missing input: bundle",
         "meta": {
-          "inputs": {
-            "bundle": {
+          "inputs": [
+            {
               "name": "bundle",
               "position": "left",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
+          ],
           "name": "Train/test split",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "table_name": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "table_name",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "test_ratio": {
+            {
               "default": 0.1,
               "name": "test_ratio",
               "type": {
                 "type": "<class 'float'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -156,40 +156,40 @@
         "display": null,
         "error": "[Errno 2] No such file or directory: ''",
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "Import CSV",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "columns": {
+          ],
+          "params": [
+            {
               "default": "<from file>",
               "name": "columns",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "filename": {
+            {
               "default": null,
               "name": "filename",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "separator": {
+            {
               "default": "<auto>",
               "name": "separator",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -217,48 +217,48 @@
         "display": null,
         "error": "Missing input: bundle",
         "meta": {
-          "inputs": {
-            "bundle": {
+          "inputs": [
+            {
               "name": "bundle",
               "position": "left",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
+          ],
           "name": "Model inference",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "model_mapping": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "model_mapping",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "model_name": {
+            {
               "default": null,
               "name": "model_name",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "save_output_as": {
+            {
               "default": "prediction",
               "name": "save_output_as",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -286,34 +286,34 @@
         "display": null,
         "error": "Missing input: bundle",
         "meta": {
-          "inputs": {
-            "bundle": {
+          "inputs": [
+            {
               "name": "bundle",
               "position": "left",
               "type": {
                 "type": "list[lynxkite_graph_analytics.core.Bundle]"
               }
             }
-          },
+          ],
           "name": "Organize",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "relations": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "relations",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "type": "graph_creation_view"
         },
         "params": {
@@ -339,33 +339,33 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "Define model",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "model_workspace": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "model_workspace",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "save_as": {
+            {
               "default": "model",
               "name": "save_as",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "position": {
             "x": 286.0,
             "y": 208.0
@@ -396,48 +396,48 @@
         "display": null,
         "error": "Missing input: bundle",
         "meta": {
-          "inputs": {
-            "bundle": {
+          "inputs": [
+            {
               "name": "bundle",
               "position": "left",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
+          ],
           "name": "Train model",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "epochs": {
+          ],
+          "params": [
+            {
               "default": 1.0,
               "name": "epochs",
               "type": {
                 "type": "<class 'int'>"
               }
             },
-            "model_mapping": {
+            {
               "default": null,
               "name": "model_mapping",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "model_name": {
+            {
               "default": null,
               "name": "model_name",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "position": {
             "x": 995.0,
             "y": 350.0

examples/ODE-GNN.lynxkite.json

@@ -113,34 +113,34 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {
-            "edges": {
+          "inputs": [
+            {
               "name": "edges",
               "position": "bottom",
               "type": {
                 "type": "tensor"
               }
             },
-            "x": {
+            {
               "name": "x",
               "position": "bottom",
               "type": {
                 "type": "tensor"
               }
             }
-          },
+          ],
           "name": "Graph conv",
-          "outputs": {
-            "x": {
+          "outputs": [
+            {
               "name": "x",
               "position": "top",
               "type": {
                 "type": "tensor"
               }
             }
-          },
-          "params": {
-            "type": {
+          ],
+          "params": [
+            {
               "default": "1",
               "name": "type",
               "type": {
@@ -152,7 +152,7 @@
                 ]
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -178,34 +178,34 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {
-            "input": {
+          "inputs": [
+            {
               "name": "input",
               "position": "top",
               "type": {
                 "type": "tensor"
               }
             }
-          },
+          ],
           "name": "Repeat",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "bottom",
               "type": {
                 "type": "tensor"
               }
             }
-          },
-          "params": {
-            "times": {
+          ],
+          "params": [
+            {
               "default": 1.0,
               "name": "times",
               "type": {
                 "type": "<class 'int'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -231,33 +231,33 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {
-            "a": {
+          "inputs": [
+            {
               "name": "a",
               "position": "bottom",
               "type": {
                 "type": "tensor"
               }
             },
-            "b": {
+            {
               "name": "b",
               "position": "bottom",
               "type": {
                 "type": "tensor"
               }
             }
-          },
+          ],
           "name": "Concatenate",
-          "outputs": {
-            "x": {
+          "outputs": [
+            {
               "name": "x",
               "position": "top",
               "type": {
                 "type": "tensor"
               }
             }
-          },
-          "params": {},
+          ],
+          "params": [],
           "type": "basic"
         },
         "params": {},
@@ -281,18 +281,18 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "Input: graph edges",
-          "outputs": {
-            "edges": {
+          "outputs": [
+            {
               "name": "edges",
               "position": "top",
               "type": {
                 "type": "tensor"
               }
             }
-          },
-          "params": {},
+          ],
+          "params": [],
           "type": "basic"
         },
         "params": {},
@@ -316,18 +316,18 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "Input: embedding",
-          "outputs": {
-            "x": {
+          "outputs": [
+            {
               "name": "x",
               "position": "top",
               "type": {
                 "type": "tensor"
               }
             }
-          },
-          "params": {},
+          ],
+          "params": [],
           "type": "basic"
         },
         "params": {},
@@ -349,27 +349,27 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {
-            "x": {
+          "inputs": [
+            {
               "name": "x",
               "position": "bottom",
               "type": {
                 "type": "tensor"
               }
             }
-          },
+          ],
           "name": "Activation",
-          "outputs": {
-            "x": {
+          "outputs": [
+            {
               "name": "x",
               "position": "top",
               "type": {
                 "type": "tensor"
               }
             }
-          },
-          "params": {
-            "type": {
+          ],
+          "params": [
+            {
               "default": "1",
               "name": "type",
               "type": {
@@ -381,7 +381,7 @@
                 ]
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -407,40 +407,40 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {
-            "h": {
+          "inputs": [
+            {
               "name": "h",
               "position": "bottom",
               "type": {
                 "type": "tensor"
               }
             },
-            "x": {
+            {
               "name": "x",
               "position": "bottom",
               "type": {
                 "type": "tensor"
               }
             }
-          },
+          ],
           "name": "LSTM",
-          "outputs": {
-            "h": {
+          "outputs": [
+            {
               "name": "h",
               "position": "top",
               "type": {
                 "type": "tensor"
               }
             },
-            "x": {
+            {
               "name": "x",
               "position": "top",
               "type": {
                 "type": "tensor"
               }
             }
-          },
-          "params": {},
+          ],
+          "params": [],
           "type": "basic"
         },
         "params": {},
@@ -464,18 +464,18 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "Input: sequential",
-          "outputs": {
-            "y": {
+          "outputs": [
+            {
               "name": "y",
               "position": "top",
               "type": {
                 "type": "tensor"
               }
             }
-          },
-          "params": {},
+          ],
+          "params": [],
           "type": "basic"
         },
         "params": {},
@@ -499,18 +499,18 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "Input: zeros",
-          "outputs": {
-            "x": {
+          "outputs": [
+            {
               "name": "x",
               "position": "top",
               "type": {
                 "type": "tensor"
               }
             }
-          },
-          "params": {},
+          ],
+          "params": [],
           "type": "basic"
         },
         "params": {},
@@ -534,26 +534,26 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {
-            "input": {
+          "inputs": [
+            {
               "name": "input",
               "position": "top",
               "type": {
                 "type": "tensor"
               }
             }
-          },
+          ],
           "name": "Recurrent chain",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "bottom",
               "type": {
                 "type": "tensor"
               }
             }
-          },
-          "params": {},
+          ],
+          "params": [],
           "type": "basic"
         },
         "params": {},
@@ -577,33 +577,33 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {
-            "x": {
+          "inputs": [
+            {
               "name": "x",
               "position": "bottom",
               "type": {
                 "type": "tensor"
               }
             },
-            "y": {
+            {
               "name": "y",
               "position": "bottom",
               "type": {
                 "type": "tensor"
               }
             }
-          },
+          ],
           "name": "MSE loss",
-          "outputs": {
-            "loss": {
+          "outputs": [
+            {
               "name": "loss",
               "position": "top",
               "type": {
                 "type": "tensor"
               }
             }
-          },
-          "params": {},
+          ],
+          "params": [],
           "type": "basic"
         },
         "params": {},
@@ -627,18 +627,18 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "Input: label",
-          "outputs": {
-            "y": {
+          "outputs": [
+            {
               "name": "y",
               "position": "top",
               "type": {
                 "type": "tensor"
               }
             }
-          },
-          "params": {},
+          ],
+          "params": [],
           "type": "basic"
         },
         "params": {},
@@ -660,26 +660,26 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {
-            "loss": {
+          "inputs": [
+            {
               "name": "loss",
               "position": "bottom",
               "type": {
                 "type": "tensor"
               }
             }
-          },
+          ],
           "name": "Optimizer",
-          "outputs": {},
-          "params": {
-            "lr": {
+          "outputs": [],
+          "params": [
+            {
               "default": 0.001,
               "name": "lr",
               "type": {
                 "type": "<class 'float'>"
               }
             },
-            "type": {
+            {
               "default": "1",
               "name": "type",
               "type": {
@@ -694,7 +694,7 @@
                 ]
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -719,34 +719,34 @@
         "display": null,
         "error": null,
         "meta": {
-          "inputs": {
-            "x": {
+          "inputs": [
+            {
               "name": "x",
               "position": "bottom",
               "type": {
                 "type": "tensor"
               }
             }
-          },
+          ],
           "name": "Neural ODE",
-          "outputs": {
-            "x": {
+          "outputs": [
+            {
               "name": "x",
               "position": "top",
               "type": {
                 "type": "tensor"
               }
             }
-          },
-          "params": {
-            "absolute_tolerance": {
+          ],
+          "params": [
+            {
               "default": null,
               "name": "absolute_tolerance",
               "type": {
                 "type": "None"
               }
             },
-            "method": {
+            {
               "default": "1",
               "name": "method",
               "type": {
@@ -764,14 +764,14 @@
                 ]
               }
             },
-            "relative_tolerance": {
+            {
               "default": null,
               "name": "relative_tolerance",
               "type": {
                 "type": "None"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {

examples/RAG chatbot app.lynxkite.json

@@ -1,174 +1,260 @@
 {
+  "edges": [
+    {
+      "id": "xy-edge__Answer Post Processing 1output-Chat Output 1input",
+      "source": "Answer Post Processing 1",
+      "sourceHandle": "output",
+      "target": "Chat Output 1",
+      "targetHandle": "input"
+    },
+    {
+      "id": "xy-edge__Chat Input 1output-Graph RAG Answer 1qa_embs",
+      "source": "Chat Input 1",
+      "sourceHandle": "output",
+      "target": "Graph RAG Answer 1",
+      "targetHandle": "qa_embs"
+    },
+    {
+      "id": "xy-edge__Chat Input 1output-k-NN Intent Classifier 1qa_embs",
+      "source": "Chat Input 1",
+      "sourceHandle": "output",
+      "target": "k-NN Intent Classifier 1",
+      "targetHandle": "qa_embs"
+    },
+    {
+      "id": "xy-edge__Chroma Graph RAG Loader 1output-k-NN Intent Classifier 1rag_graph",
+      "source": "Chroma Graph RAG Loader 1",
+      "sourceHandle": "output",
+      "target": "k-NN Intent Classifier 1",
+      "targetHandle": "rag_graph"
+    },
+    {
+      "id": "xy-edge__k-NN Intent Classifier 1output-Graph RAG Answer 1intent",
+      "source": "k-NN Intent Classifier 1",
+      "sourceHandle": "output",
+      "target": "Graph RAG Answer 1",
+      "targetHandle": "intent"
+    },
+    {
+      "id": "xy-edge__Chroma Graph RAG Loader 1output-Scenario Builder 1input",
+      "source": "Chroma Graph RAG Loader 1",
+      "sourceHandle": "output",
+      "target": "Scenario Builder 1",
+      "targetHandle": "input"
+    },
+    {
+      "id": "xy-edge__Scenario Builder 1output-Graph RAG Answer 1prompt_dict",
+      "source": "Scenario Builder 1",
+      "sourceHandle": "output",
+      "target": "Graph RAG Answer 1",
+      "targetHandle": "prompt_dict"
+    },
+    {
+      "id": "xy-edge__Graph RAG Answer 1output-Answer Post Processing 1qa_embs",
+      "source": "Graph RAG Answer 1",
+      "sourceHandle": "output",
+      "target": "Answer Post Processing 1",
+      "targetHandle": "qa_embs"
+    },
+    {
+      "id": "xy-edge__Chroma Graph RAG Loader 1output-Answer Post Processing 1rag_graph",
+      "source": "Chroma Graph RAG Loader 1",
+      "sourceHandle": "output",
+      "target": "Answer Post Processing 1",
+      "targetHandle": "rag_graph"
+    },
+    {
+      "id": "xy-edge__Chroma Graph RAG Loader 1output-Graph RAG Answer 1rag_graph",
+      "source": "Chroma Graph RAG Loader 1",
+      "sourceHandle": "output",
+      "target": "Graph RAG Answer 1",
+      "targetHandle": "rag_graph"
+    }
+  ],
   "env": "LynxScribe",
   "nodes": [
     {
-      "id": "Chat Input 1",
-      "type": "basic",
       "data": {
-        "title": "Chat Input",
-        "params": {
-          "load_mode": "augmented",
-          "model": "Yi-34B (triton)",
-          "embedder": "GritLM-7b (triton)"
-        },
         "display": null,
         "error": null,
         "inputs": {},
-        "outputs": {
-          "output": "<class 'server.ops.Bundle'>"
-        },
         "meta": {
+          "inputs": [],
           "name": "Chat Input",
-          "params": {
-            "load_mode": {
-              "name": "load_mode",
+          "outputs": [
+            {
+              "name": "output",
+              "position": "right",
+              "type": {
+                "type": "None"
+              }
+            }
+          ],
+          "params": [
+            {
               "default": 1,
+              "name": "embedder",
               "type": {
                 "enum": [
-                  "augmented"
+                  "GritLM-7b (triton)"
                 ]
               }
             },
-            "model": {
-              "name": "model",
+            {
               "default": 1,
+              "name": "load_mode",
               "type": {
                 "enum": [
-                  "Yi-34B (triton)"
+                  "augmented"
                 ]
               }
             },
-            "embedder": {
-              "name": "embedder",
+            {
               "default": 1,
+              "name": "model",
               "type": {
                 "enum": [
-                  "GritLM-7b (triton)"
+                  "Yi-34B (triton)"
                 ]
               }
             }
-          },
-          "inputs": {},
-          "outputs": {
-            "output": {
-              "name": "output",
-              "type": {
-                "type": "None"
-              },
-              "position": "right"
-            }
-          },
-          "type": "basic",
-          "sub_nodes": null
-        }
+          ],
+          "sub_nodes": null,
+          "type": "basic"
+        },
+        "outputs": {
+          "output": "<class 'server.ops.Bundle'>"
+        },
+        "params": {
+          "embedder": "GritLM-7b (triton)",
+          "load_mode": "augmented",
+          "model": "Yi-34B (triton)"
+        },
+        "title": "Chat Input"
       },
+      "id": "Chat Input 1",
+      "parentId": null,
+      "parentNode": null,
       "position": {
         "x": 195.66666666666669,
         "y": 163.66666666666666
       },
-      "parentId": null,
-      "parentNode": null
+      "type": "basic"
     },
     {
-      "id": "Chroma Graph RAG Loader 1",
-      "type": "basic",
       "data": {
-        "title": "Chroma Graph RAG Loader",
-        "params": {
-          "location": "GCP",
-          "bucket": "",
-          "folder": "",
-          "embedder": "GritLM-7b (triton)"
-        },
         "display": null,
         "error": null,
         "inputs": {},
-        "outputs": {
-          "output": "<class 'server.ops.Bundle'>"
-        },
         "meta": {
+          "inputs": [],
           "name": "Chroma Graph RAG Loader",
-          "params": {
-            "location": {
-              "name": "location",
-              "default": 1,
+          "outputs": [
+            {
+              "name": "output",
+              "position": "right",
               "type": {
-                "enum": [
-                  "GCP"
-                ]
+                "type": "None"
               }
-            },
-            "bucket": {
-              "name": "bucket",
+            }
+          ],
+          "params": [
+            {
               "default": "",
+              "name": "bucket",
               "type": {
                 "format": "collapsed"
               }
             },
-            "folder": {
-              "name": "folder",
+            {
+              "default": 1,
+              "name": "embedder",
+              "type": {
+                "enum": [
+                  "GritLM-7b (triton)"
+                ]
+              }
+            },
+            {
               "default": "",
+              "name": "folder",
               "type": {
                 "format": "collapsed"
               }
             },
-            "embedder": {
-              "name": "embedder",
+            {
               "default": 1,
+              "name": "location",
               "type": {
                 "enum": [
-                  "GritLM-7b (triton)"
+                  "GCP"
                 ]
               }
             }
-          },
-          "inputs": {},
-          "outputs": {
-            "output": {
-              "name": "output",
-              "type": {
-                "type": "None"
-              },
-              "position": "right"
-            }
-          },
-          "type": "basic",
-          "sub_nodes": null
-        }
+          ],
+          "sub_nodes": null,
+          "type": "basic"
+        },
+        "outputs": {
+          "output": "<class 'server.ops.Bundle'>"
+        },
+        "params": {
+          "bucket": "",
+          "embedder": "GritLM-7b (triton)",
+          "folder": "",
+          "location": "GCP"
+        },
+        "title": "Chroma Graph RAG Loader"
       },
+      "id": "Chroma Graph RAG Loader 1",
+      "parentId": null,
+      "parentNode": null,
       "position": {
         "x": 195.60875221397816,
         "y": 395.94296449008243
       },
-      "parentId": null,
-      "parentNode": null
+      "type": "basic"
     },
     {
-      "id": "k-NN Intent Classifier 1",
-      "type": "basic",
       "data": {
-        "title": "k-NN Intent Classifier",
-        "params": {
-          "distance": "cosine",
-          "max_dist": 0.3,
-          "k": "10",
-          "voting": "weighted"
-        },
+        "collapsed": false,
         "display": null,
         "error": null,
         "inputs": {
           "qa_embs": "None",
           "rag_graph": "None"
         },
-        "outputs": {
-          "output": "<class 'server.ops.Bundle'>"
-        },
         "meta": {
+          "inputs": [
+            {
+              "name": "qa_embs",
+              "position": "left",
+              "type": {
+                "type": "None"
+              }
+            },
+            {
+              "name": "rag_graph",
+              "position": "left",
+              "type": {
+                "type": "None"
+              }
+            }
+          ],
           "name": "k-NN Intent Classifier",
-          "params": {
-            "distance": {
-              "name": "distance",
+          "outputs": [
+            {
+              "name": "output",
+              "position": "right",
+              "type": {
+                "type": "None"
+              }
+            }
+          ],
+          "params": [
+            {
               "default": 1,
+              "name": "distance",
               "type": {
                 "enum": [
                   "cosine",
@@ -176,23 +262,23 @@
                 ]
               }
             },
-            "max_dist": {
-              "name": "max_dist",
-              "default": 0.3,
+            {
+              "default": 3,
+              "name": "k",
               "type": {
-                "type": "<class 'float'>"
+                "type": "<class 'int'>"
               }
             },
-            "k": {
-              "name": "k",
-              "default": 3,
+            {
+              "default": 0.3,
+              "name": "max_dist",
               "type": {
-                "type": "<class 'int'>"
+                "type": "<class 'float'>"
               }
             },
-            "voting": {
-              "name": "voting",
+            {
               "default": 1,
+              "name": "voting",
               "type": {
                 "enum": [
                   "most common",
@@ -200,104 +286,102 @@
                 ]
               }
             }
-          },
-          "inputs": {
-            "qa_embs": {
-              "name": "qa_embs",
-              "type": {
-                "type": "None"
-              },
-              "position": "left"
-            },
-            "rag_graph": {
-              "name": "rag_graph",
-              "type": {
-                "type": "None"
-              },
-              "position": "left"
-            }
-          },
-          "outputs": {
-            "output": {
-              "name": "output",
-              "type": {
-                "type": "None"
-              },
-              "position": "right"
-            }
-          },
-          "type": "basic",
-          "sub_nodes": null
+          ],
+          "sub_nodes": null,
+          "type": "basic"
+        },
+        "outputs": {
+          "output": "<class 'server.ops.Bundle'>"
+        },
+        "params": {
+          "distance": "cosine",
+          "k": "10",
+          "max_dist": 0.3,
+          "voting": "weighted"
         },
-        "collapsed": false
+        "title": "k-NN Intent Classifier"
       },
+      "id": "k-NN Intent Classifier 1",
+      "parentId": null,
+      "parentNode": null,
       "position": {
         "x": 563.2980104689954,
         "y": 133.15405056058248
       },
-      "parentId": null,
-      "parentNode": null
+      "type": "basic"
     },
     {
-      "id": "Graph RAG Answer 1",
-      "type": "basic",
       "data": {
-        "title": "Graph RAG Answer",
-        "params": {
-          "answer_llm": "Yi-34B (triton)",
-          "faq_dist": 0.12,
-          "max_dist": 0.25,
-          "ctx_tokens": 2800,
-          "distance": "cosine",
-          "graph_rag_params": ""
-        },
+        "collapsed": false,
         "display": null,
         "error": null,
         "inputs": {
-          "qa_embs": "None",
           "intent": "None",
-          "rag_graph": "None",
-          "prompt_dict": "None"
-        },
-        "outputs": {
-          "output": "<class 'server.ops.Bundle'>"
+          "prompt_dict": "None",
+          "qa_embs": "None",
+          "rag_graph": "None"
         },
         "meta": {
-          "name": "Graph RAG Answer",
-          "params": {
-            "answer_llm": {
-              "name": "answer_llm",
-              "default": 1,
+          "inputs": [
+            {
+              "name": "intent",
+              "position": "left",
               "type": {
-                "enum": [
-                  "Yi-34B (triton)"
-                ]
+                "type": "None"
               }
             },
-            "faq_dist": {
-              "name": "faq_dist",
-              "default": 0.12,
+            {
+              "name": "prompt_dict",
+              "position": "left",
               "type": {
-                "type": "<class 'float'>"
+                "type": "None"
               }
             },
-            "max_dist": {
-              "name": "max_dist",
-              "default": 0.25,
+            {
+              "name": "qa_embs",
+              "position": "left",
               "type": {
-                "type": "<class 'float'>"
+                "type": "None"
               }
             },
-            "ctx_tokens": {
-              "name": "ctx_tokens",
+            {
+              "name": "rag_graph",
+              "position": "left",
+              "type": {
+                "type": "None"
+              }
+            }
+          ],
+          "name": "Graph RAG Answer",
+          "outputs": [
+            {
+              "name": "output",
+              "position": "right",
+              "type": {
+                "type": "None"
+              }
+            }
+          ],
+          "params": [
+            {
+              "default": 1,
+              "name": "answer_llm",
+              "type": {
+                "enum": [
+                  "Yi-34B (triton)"
+                ]
+              }
+            },
+            {
               "default": 2800,
+              "name": "ctx_tokens",
               "type": {
                 "type": "<class 'int'>"
               }
             },
-            "distance": {
-              "name": "distance",
+            {
               "default": 1,
+              "name": "distance",
               "type": {
                 "enum": [
                   "cosine",
@@ -305,145 +389,148 @@
                 ]
               }
             },
-            "graph_rag_params": {
-              "name": "graph_rag_params",
-              "default": "",
+            {
+              "default": 0.12,
+              "name": "faq_dist",
               "type": {
-                "format": "collapsed"
+                "type": "<class 'float'>"
               }
-            }
-          },
-          "inputs": {
-            "qa_embs": {
-              "name": "qa_embs",
-              "type": {
-                "type": "None"
-              },
-              "position": "left"
-            },
-            "intent": {
-              "name": "intent",
-              "type": {
-                "type": "None"
-              },
-              "position": "left"
             },
-            "rag_graph": {
-              "name": "rag_graph",
+            {
+              "default": "",
+              "name": "graph_rag_params",
               "type": {
-                "type": "None"
-              },
-              "position": "left"
+                "format": "collapsed"
+              }
             },
-            "prompt_dict": {
-              "name": "prompt_dict",
-              "type": {
-                "type": "None"
-              },
-              "position": "left"
-            }
-          },
-          "outputs": {
-            "output": {
-              "name": "output",
+            {
+              "default": 0.25,
+              "name": "max_dist",
               "type": {
-                "type": "None"
-              },
-              "position": "right"
+                "type": "<class 'float'>"
+              }
             }
-          },
-          "type": "basic",
-          "sub_nodes": null
+          ],
+          "sub_nodes": null,
+          "type": "basic"
+        },
+        "outputs": {
+          "output": "<class 'server.ops.Bundle'>"
         },
-        "collapsed": false
+        "params": {
+          "answer_llm": "Yi-34B (triton)",
+          "ctx_tokens": 2800,
+          "distance": "cosine",
+          "faq_dist": 0.12,
+          "graph_rag_params": "",
+          "max_dist": 0.25
+        },
+        "title": "Graph RAG Answer"
       },
+      "id": "Graph RAG Answer 1",
+      "parentId": null,
+      "parentNode": null,
       "position": {
         "x": 954.7861764338505,
         "y": 158.59348288997435
       },
-      "parentId": null,
-      "parentNode": null
+      "type": "basic"
     },
     {
-      "id": "Scenario Builder 1",
-      "type": "basic",
       "data": {
-        "title": "Scenario Builder",
-        "params": {
-          "scenario": ""
-        },
         "display": null,
         "error": null,
         "inputs": {
           "input": "<class 'server.ops.Bundle'>"
         },
-        "outputs": {
-          "output": "<class 'server.ops.Bundle'>"
-        },
         "meta": {
-          "name": "Scenario Builder",
-          "params": {
-            "scenario": {
-              "name": "scenario",
-              "default": "",
-              "type": {
-                "format": "collapsed"
-              }
-            }
-          },
-          "inputs": {
-            "input": {
+          "inputs": [
+            {
               "name": "input",
+              "position": "left",
               "type": {
                 "type": "None"
-              },
-              "position": "left"
+              }
             }
-          },
-          "outputs": {
-            "output": {
+          ],
+          "name": "Scenario Builder",
+          "outputs": [
+            {
               "name": "output",
+              "position": "right",
               "type": {
                 "type": "None"
-              },
-              "position": "right"
+              }
+            }
+          ],
+          "params": [
+            {
+              "default": "",
+              "name": "scenario",
+              "type": {
+                "format": "collapsed"
+              }
             }
-          },
-          "type": "basic",
-          "sub_nodes": null
-        }
+          ],
+          "sub_nodes": null,
+          "type": "basic"
+        },
+        "outputs": {
+          "output": "<class 'server.ops.Bundle'>"
+        },
+        "params": {
+          "scenario": ""
+        },
+        "title": "Scenario Builder"
       },
+      "id": "Scenario Builder 1",
+      "parentId": null,
+      "parentNode": null,
       "position": {
         "x": 564.4460318313352,
         "y": 542.19038386186
       },
-      "parentId": null,
-      "parentNode": null
+      "type": "basic"
     },
     {
-      "id": "Answer Post Processing 1",
-      "type": "basic",
       "data": {
-        "title": "Answer Post Processing",
-        "params": {
-          "distance": "cosine",
-          "min_conf": 0.78
-        },
         "display": null,
         "error": null,
         "inputs": {
           "qa_embs": "None",
           "rag_graph": "None"
         },
-        "outputs": {
-          "output": "<class 'server.ops.Bundle'>"
-        },
         "meta": {
+          "inputs": [
+            {
+              "name": "qa_embs",
+              "position": "left",
+              "type": {
+                "type": "None"
+              }
+            },
+            {
+              "name": "rag_graph",
+              "position": "left",
+              "type": {
+                "type": "None"
+              }
+            }
+          ],
           "name": "Answer Post Processing",
-          "params": {
-            "distance": {
-              "name": "distance",
+          "outputs": [
+            {
+              "name": "output",
+              "position": "right",
+              "type": {
+                "type": "None"
+              }
+            }
+          ],
+          "params": [
+            {
               "default": 1,
+              "name": "distance",
               "type": {
                 "enum": [
                   "cosine",
@@ -451,158 +538,71 @@
                 ]
               }
             },
-            "min_conf": {
-              "name": "min_conf",
+            {
               "default": 0.78,
+              "name": "min_conf",
               "type": {
                 "type": "<class 'float'>"
               }
             }
-          },
-          "inputs": {
-            "qa_embs": {
-              "name": "qa_embs",
-              "type": {
-                "type": "None"
-              },
-              "position": "left"
-            },
-            "rag_graph": {
-              "name": "rag_graph",
-              "type": {
-                "type": "None"
-              },
-              "position": "left"
-            }
-          },
-          "outputs": {
-            "output": {
-              "name": "output",
-              "type": {
-                "type": "None"
-              },
-              "position": "right"
-            }
-          },
-          "type": "basic",
-          "sub_nodes": null
-        }
+          ],
+          "sub_nodes": null,
+          "type": "basic"
+        },
+        "outputs": {
+          "output": "<class 'server.ops.Bundle'>"
+        },
+        "params": {
+          "distance": "cosine",
+          "min_conf": 0.78
+        },
+        "title": "Answer Post Processing"
       },
+      "id": "Answer Post Processing 1",
+      "parentId": null,
+      "parentNode": null,
       "position": {
         "x": 1278.9987187264371,
         "y": 203.10622200721383
       },
-      "parentId": null,
-      "parentNode": null
+      "type": "basic"
     },
     {
-      "id": "Chat Output 1",
-      "type": "basic",
       "data": {
-        "title": "Chat Output",
-        "params": {},
+        "collapsed": true,
         "display": null,
         "error": null,
         "inputs": {
           "input": "<class 'server.ops.Bundle'>"
         },
-        "outputs": {},
         "meta": {
-          "name": "Chat Output",
-          "params": {},
-          "inputs": {
-            "input": {
+          "inputs": [
+            {
               "name": "input",
+              "position": "left",
               "type": {
                 "type": "None"
-              },
-              "position": "left"
+              }
             }
-          },
-          "outputs": {},
-          "type": "basic",
-          "sub_nodes": null
+          ],
+          "name": "Chat Output",
+          "outputs": [],
+          "params": [],
+          "sub_nodes": null,
+          "type": "basic"
         },
-        "collapsed": true
+        "outputs": {},
+        "params": {},
+        "title": "Chat Output"
       },
+      "id": "Chat Output 1",
+      "parentId": null,
+      "parentNode": null,
       "position": {
         "x": 1567.1754450730762,
         "y": 249.55429591996437
       },
-      "parentId": null,
-      "parentNode": null
-    }
-  ],
-  "edges": [
-    {
-      "id": "xy-edge__Answer Post Processing 1output-Chat Output 1input",
-      "source": "Answer Post Processing 1",
-      "target": "Chat Output 1",
-      "sourceHandle": "output",
-      "targetHandle": "input"
-    },
-    {
-      "id": "xy-edge__Chat Input 1output-Graph RAG Answer 1qa_embs",
-      "source": "Chat Input 1",
-      "target": "Graph RAG Answer 1",
-      "sourceHandle": "output",
-      "targetHandle": "qa_embs"
-    },
-    {
-      "id": "xy-edge__Chat Input 1output-k-NN Intent Classifier 1qa_embs",
-      "source": "Chat Input 1",
-      "target": "k-NN Intent Classifier 1",
-      "sourceHandle": "output",
-      "targetHandle": "qa_embs"
-    },
-    {
-      "id": "xy-edge__Chroma Graph RAG Loader 1output-k-NN Intent Classifier 1rag_graph",
-      "source": "Chroma Graph RAG Loader 1",
-      "target": "k-NN Intent Classifier 1",
-      "sourceHandle": "output",
-      "targetHandle": "rag_graph"
-    },
-    {
-      "id": "xy-edge__k-NN Intent Classifier 1output-Graph RAG Answer 1intent",
-      "source": "k-NN Intent Classifier 1",
-      "target": "Graph RAG Answer 1",
-      "sourceHandle": "output",
-      "targetHandle": "intent"
-    },
-    {
-      "id": "xy-edge__Chroma Graph RAG Loader 1output-Scenario Builder 1input",
-      "source": "Chroma Graph RAG Loader 1",
-      "target": "Scenario Builder 1",
-      "sourceHandle": "output",
-      "targetHandle": "input"
-    },
-    {
-      "id": "xy-edge__Scenario Builder 1output-Graph RAG Answer 1prompt_dict",
-      "source": "Scenario Builder 1",
-      "target": "Graph RAG Answer 1",
-      "sourceHandle": "output",
-      "targetHandle": "prompt_dict"
-    },
-    {
-      "id": "xy-edge__Graph RAG Answer 1output-Answer Post Processing 1qa_embs",
-      "source": "Graph RAG Answer 1",
-      "target": "Answer Post Processing 1",
-      "sourceHandle": "output",
-      "targetHandle": "qa_embs"
-    },
-    {
-      "id": "xy-edge__Chroma Graph RAG Loader 1output-Answer Post Processing 1rag_graph",
-      "source": "Chroma Graph RAG Loader 1",
-      "target": "Answer Post Processing 1",
-      "sourceHandle": "output",
-      "targetHandle": "rag_graph"
-    },
-    {
-      "id": "xy-edge__Chroma Graph RAG Loader 1output-Graph RAG Answer 1rag_graph",
-      "source": "Chroma Graph RAG Loader 1",
-      "target": "Graph RAG Answer 1",
-      "sourceHandle": "output",
-      "targetHandle": "rag_graph"
+      "type": "basic"
     }
   ]
 }

examples/Word2vec.lynxkite.json

@@ -6107,26 +6107,26 @@
           }
         ],
         "meta": {
-          "inputs": {
-            "bundle": {
+          "inputs": [
+            {
               "name": "bundle",
               "position": "left",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
+          ],
           "name": "View vectors",
-          "outputs": {},
-          "params": {
-            "label_column": {
+          "outputs": [],
+          "params": [
+            {
               "default": "",
               "name": "label_column",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "metric": {
+            {
               "default": "euclidean",
               "name": "metric",
               "type": {
@@ -6149,35 +6149,35 @@
                 ]
               }
             },
-            "min_dist": {
+            {
               "default": 0.1,
               "name": "min_dist",
               "type": {
                 "type": "<class 'float'>"
               }
             },
-            "n_neighbors": {
+            {
               "default": 15.0,
               "name": "n_neighbors",
               "type": {
                 "type": "<class 'int'>"
               }
             },
-            "table_name": {
+            {
               "default": "nodes",
               "name": "table_name",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "vector_column": {
+            {
               "default": "",
               "name": "vector_column",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "type": "visualization"
         },
         "params": {
@@ -12267,26 +12267,26 @@
           }
         ],
         "meta": {
-          "inputs": {
-            "bundle": {
+          "inputs": [
+            {
               "name": "bundle",
               "position": "left",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
+          ],
           "name": "View vectors",
-          "outputs": {},
-          "params": {
-            "label_column": {
+          "outputs": [],
+          "params": [
+            {
               "default": "",
               "name": "label_column",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "metric": {
+            {
               "default": "euclidean",
               "name": "metric",
               "type": {
@@ -12309,35 +12309,35 @@
                 ]
               }
             },
-            "min_dist": {
+            {
               "default": 0.1,
               "name": "min_dist",
               "type": {
                 "type": "<class 'float'>"
               }
             },
-            "n_neighbors": {
+            {
               "default": 15.0,
               "name": "n_neighbors",
               "type": {
                 "type": "<class 'int'>"
               }
             },
-            "table_name": {
+            {
               "default": "nodes",
               "name": "table_name",
               "type": {
                 "type": "<class 'str'>"
               }
             },
-            "vector_column": {
+            {
               "default": "",
               "name": "vector_column",
               "type": {
                 "type": "<class 'str'>"
               }
             }
-          },
+          ],
           "type": "visualization"
         },
         "params": {
@@ -12367,18 +12367,18 @@
         "error": null,
         "input_metadata": [],
         "meta": {
-          "inputs": {},
+          "inputs": [],
           "name": "Word2vec for the top 1000 words",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {},
+          ],
+          "params": [],
           "type": "basic"
         },
         "params": {},
@@ -12405,34 +12405,34 @@
           {}
         ],
         "meta": {
-          "inputs": {
-            "df": {
+          "inputs": [
+            {
               "name": "df",
               "position": "left",
               "type": {
                 "type": "<class 'pandas.core.frame.DataFrame'>"
               }
             }
-          },
+          ],
           "name": "Take first N",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "n": {
+          ],
+          "params": [
+            {
               "default": 10.0,
               "name": "n",
               "type": {
                 "type": "<class 'int'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -12461,34 +12461,34 @@
           {}
         ],
         "meta": {
-          "inputs": {
-            "df": {
+          "inputs": [
+            {
               "name": "df",
               "position": "left",
               "type": {
                 "type": "<class 'pandas.core.frame.DataFrame'>"
               }
             }
-          },
+          ],
           "name": "Sample N",
-          "outputs": {
-            "output": {
+          "outputs": [
+            {
               "name": "output",
               "position": "right",
               "type": {
                 "type": "None"
               }
             }
-          },
-          "params": {
-            "n": {
+          ],
+          "params": [
+            {
               "default": 10.0,
               "name": "n",
               "type": {
                 "type": "<class 'int'>"
               }
             }
-          },
+          ],
           "type": "basic"
         },
         "params": {
@@ -12939,26 +12939,26 @@
           }
         ],
         "meta": {
-          "inputs": {
-            "bundle": {
+          "inputs": [
+            {
               "name": "bundle",
               "position": "left",
               "type": {
                 "type": "<class 'lynxkite_graph_analytics.core.Bundle'>"
               }
             }
-          },
+          ],
           "name": "View tables",
-          "outputs": {},
-          "params": {
-            "limit": {
+          "outputs": [],
+          "params": [
+            {
               "default": 100.0,
               "name": "limit",
               "type": {
                 "type": "<class 'int'>"
               }
             }
-          },
+          ],
           "position": {
             "x": 356.0,
             "y": 478.0

lynxkite-app/web/src/workspace/nodes/LynxKiteNode.tsx

@@ -14,7 +14,7 @@ interface LynxKiteNodeProps {
   children: any;
 }
 
-function getHandles(inputs: object, outputs: object) {
+function getHandles(inputs: any[], outputs: any[]) {
   const handles: {
     position: "top" | "bottom" | "left" | "right";
     name: string;
@@ -23,10 +23,10 @@ function getHandles(inputs: object, outputs: object) {
     showLabel: boolean;
     type: "source" | "target";
   }[] = [];
-  for (const e of Object.values(inputs)) {
+  for (const e of inputs) {
     handles.push({ ...e, type: "target" });
   }
-  for (const e of Object.values(outputs)) {
+  for (const e of outputs) {
     handles.push({ ...e, type: "source" });
   }
   const counts = { top: 0, bottom: 0, left: 0, right: 0 };
@@ -53,7 +53,7 @@ function LynxKiteNodeComponent(props: LynxKiteNodeProps) {
   const reactFlow = useReactFlow();
   const data = props.data;
   const expanded = !data.collapsed;
-  const handles = getHandles(data.meta?.value?.inputs || {}, data.meta?.value?.outputs || {});
+  const handles = getHandles(data.meta?.value?.inputs || [], data.meta?.value?.outputs || []);
   function titleClicked() {
     reactFlow.updateNodeData(props.id, { collapsed: expanded });
   }

lynxkite-app/web/src/workspace/nodes/NodeWithParams.tsx

@@ -31,23 +31,21 @@ export function NodeWithParams(props: any) {
       __execution_delay: opts.delay || 0,
     });
   }
-  const params = props.data?.params ? Object.entries(props.data.params) : [];
-
   return (
     <>
-      {props.collapsed && params.length > 0 && (
+      {props.collapsed && metaParams.length > 0 && (
         <div className="params-expander" onClick={() => setCollapsed(!collapsed)}>
           <Triangle className={`flippy ${collapsed ? "flippy-90" : ""}`} />
         </div>
       )}
       {!collapsed &&
-        params.map(([name, value]) =>
-          metaParams?.[name]?.type === "group" ? (
+        metaParams.map((meta: any) =>
+          meta.type === "group" ? (
             <NodeGroupParameter
-              key={name}
-              value={value}
+              key={meta.name}
+              value={props.data.params[meta.name]}
               data={props.data}
-              meta={metaParams?.[name]}
+              meta={meta}
               setParam={(name: string, value: any, opts?: UpdateOptions) =>
                 setParam(name, value, opts || {})
               }
@@ -55,12 +53,14 @@ export function NodeWithParams(props: any) {
             />
           ) : (
             <NodeParameter
-              name={name}
-              key={name}
-              value={value}
+              name={meta.name}
+              key={meta.name}
+              value={props.data.params[meta.name]}
               data={props.data}
-              meta={metaParams?.[name]}
-              onChange={(value: any, opts?: UpdateOptions) => setParam(name, value, opts || {})}
+              meta={meta}
+              onChange={(value: any, opts?: UpdateOptions) =>
+                setParam(meta.name, value, opts || {})
+              }
             />
           ),
         )}

lynxkite-core/src/lynxkite/core/executors/one_by_one.py

@@ -46,7 +46,7 @@ def register(env: str, cache: bool = True):
     ops.EXECUTORS[env] = lambda ws: execute(ws, ops.CATALOGS[env], cache=cache)
 
 
-def get_stages(ws, catalog):
+def get_stages(ws, catalog: ops.Catalog):
     """Inputs on top/bottom are batch inputs. We decompose the graph into a DAG of components along these edges."""
     nodes = {n.id: n for n in ws.nodes}
     batch_inputs = {}
@@ -57,8 +57,7 @@ def get_stages(ws, catalog):
         inputs.setdefault(edge.target, []).append(edge.source)
         node = nodes[edge.target]
         op = catalog[node.data.title]
-        i = op.inputs[edge.targetHandle]
-        if i.position in "top or bottom":
+        if op.get_input(edge.targetHandle).position in "top or bottom":
             batch_inputs.setdefault(edge.target, []).append(edge.source)
     stages = []
     for bt, bss in batch_inputs.items():
@@ -110,7 +109,7 @@ async def execute(ws: workspace.Workspace, catalog, cache=None):
             continue
         node.publish_error(None)
         # Start tasks for nodes that have no non-batch inputs.
-        if all([i.position in "top or bottom" for i in op.inputs.values()]):
+        if all([i.position in "top or bottom" for i in op.inputs]):
             tasks[node.id] = [NO_INPUT]
     batch_inputs = {}
     # Run the rest until we run out of tasks.
@@ -132,7 +131,7 @@ async def execute(ws: workspace.Workspace, catalog, cache=None):
             for task in ts:
                 try:
                     inputs = []
-                    for i in op.inputs.values():
+                    for i in op.inputs:
                         if i.position in "top or bottom":
                             assert (n, i.name) in batch_inputs, f"{i.name} is missing"
                             inputs.append(batch_inputs[(n, i.name)])
@@ -165,8 +164,7 @@ async def execute(ws: workspace.Workspace, catalog, cache=None):
                 for edge in edges[node.id]:
                     t = nodes[edge.target]
                     op = catalog[t.data.title]
-                    i = op.inputs[edge.targetHandle]
-                    if i.position in "top or bottom":
+                    if op.get_input(edge.targetHandle).position in "top or bottom":
                         batch_inputs.setdefault((edge.target, edge.targetHandle), []).extend(
                             results
                         )

lynxkite-core/src/lynxkite/core/executors/simple.py

@@ -37,7 +37,7 @@ async def execute(ws: workspace.Workspace, catalog: ops.Catalog):
         try:
             inputs = []
             missing = []
-            for i in op.inputs.values():
+            for i in op.inputs:
                 edges = in_edges[node_id]
                 if i.name in edges and edges[i.name] in outputs:
                     inputs.append(outputs[edges[i.name]])
@@ -50,11 +50,11 @@ async def execute(ws: workspace.Workspace, catalog: ops.Catalog):
             result.output = await await_if_needed(result.output)
             result.display = await await_if_needed(result.display)
             if len(op.outputs) == 1:
-                [output] = list(op.outputs.values())
+                [output] = op.outputs
                 outputs[node_id, output.name] = result.output
             elif len(op.outputs) > 1:
                 assert type(result.output) is dict, "An op with multiple outputs must return a dict"
-                for output in op.outputs.values():
+                for output in op.outputs:
                     outputs[node_id, output.name] = result.output[output.name]
             node.publish_result(result)
         except Exception as e:

lynxkite-core/src/lynxkite/core/ops.py

@@ -163,9 +163,9 @@ def _param_to_type(name, value, type):
 class Op(BaseConfig):
     func: typing.Callable = pydantic.Field(exclude=True)
     name: str
-    params: dict[str, Parameter | ParameterGroup]
-    inputs: dict[str, Input]
-    outputs: dict[str, Output]
+    params: list[Parameter | ParameterGroup]
+    inputs: list[Input]
+    outputs: list[Output]
     # TODO: Make type an enum with the possible values.
     type: str = "basic"  # The UI to use for this operation.
     color: str = "orange"  # The color of the operation in the UI.
@@ -189,14 +189,26 @@ class Op(BaseConfig):
                 res.display = res.output
         return res
 
-    def convert_params(self, params):
+    def get_input(self, name: str):
+        """Returns the input with the given name."""
+        for i in self.inputs:
+            if i.name == name:
+                return i
+        raise ValueError(f"Input {name} not found in operation {self.name}.")
+
+    def get_output(self, name: str):
+        """Returns the output with the given name."""
+        for o in self.outputs:
+            if o.name == name:
+                return o
+        raise ValueError(f"Output {name} not found in operation {self.name}.")
+
+    def convert_params(self, params: dict[str, typing.Any]):
         """Returns the parameters converted to the expected type."""
-        res = {}
-        for p in params:
-            if p in self.params:
-                res[p] = _param_to_type(p, params[p], self.params[p].type)
-            else:
-                res[p] = params[p]
+        res = dict(params)
+        for p in self.params:
+            if p.name in params:
+                res[p.name] = _param_to_type(p.name, params[p.name], p.type)
         return res
 
 
@@ -218,21 +230,21 @@ def op(
             func = mem.cache(func)
             func = _global_slow(func)
         # Positional arguments are inputs.
-        inputs = {
-            name: Input(name=name, type=param.annotation)
+        inputs = [
+            Input(name=name, type=param.annotation)
             for name, param in sig.parameters.items()
             if param.kind not in (param.KEYWORD_ONLY, param.VAR_KEYWORD)
-        }
-        _params = {}
+        ]
+        _params = []
         for n, param in sig.parameters.items():
             if param.kind == param.KEYWORD_ONLY and not n.startswith("_"):
-                _params[n] = Parameter.basic(n, param.default, param.annotation)
+                _params.append(Parameter.basic(n, param.default, param.annotation))
         if params:
-            _params.update(params)
+            _params.extend(params)
         if outputs:
-            _outputs = {name: Output(name=name, type=None) for name in outputs}
+            _outputs = [Output(name=name, type=None) for name in outputs]
         else:
-            _outputs = {"output": Output(name="output", type=None)} if view == "basic" else {}
+            _outputs = [Output(name="output", type=None)] if view == "basic" else []
         _view = view
         if view == "matplotlib":
             _view = "image"
@@ -255,6 +267,7 @@ def op(
 
 
 def matplotlib_to_image(func):
+    """Decorator for converting a matplotlib figure to an image."""
     import matplotlib.pyplot as plt
     import base64
     import io
@@ -278,7 +291,7 @@ def input_position(**kwargs):
     def decorator(func):
         op = func.__op__
         for k, v in kwargs.items():
-            op.inputs[k].position = v
+            op.get_input(k).position = v
         return func
 
     return decorator
@@ -290,7 +303,7 @@ def output_position(**kwargs):
     def decorator(func):
         op = func.__op__
         for k, v in kwargs.items():
-            op.outputs[k].position = v
+            op.get_output(k).position = v
         return func
 
     return decorator
@@ -307,13 +320,9 @@ def register_passive_op(env: str, name: str, inputs=[], outputs=["output"], para
     op = Op(
         func=no_op,
         name=name,
-        params={p.name: p for p in params},
-        inputs=dict(
-            (i, Input(name=i, type=None)) if isinstance(i, str) else (i.name, i) for i in inputs
-        ),
-        outputs=dict(
-            (o, Output(name=o, type=None)) if isinstance(o, str) else (o.name, o) for o in outputs
-        ),
+        params=params,
+        inputs=[Input(name=i, type=None) if isinstance(i, str) else i for i in inputs],
+        outputs=[Output(name=o, type=None) if isinstance(o, str) else o for o in outputs],
         **kwargs,
     )
     CATALOGS.setdefault(env, {})

lynxkite-core/src/lynxkite/core/workspace.py

@@ -107,9 +107,9 @@ class Workspace(BaseConfig):
         for n in self.nodes:
             if n.id in _ops:
                 for h in _ops[n.id].inputs:
-                    valid_targets.add((n.id, h))
+                    valid_targets.add((n.id, h.name))
                 for h in _ops[n.id].outputs:
-                    valid_sources.add((n.id, h))
+                    valid_sources.add((n.id, h.name))
         edges = [
             edge
             for edge in self.edges
@@ -197,6 +197,7 @@ def update_metadata(ws: Workspace) -> Workspace:
         else:
             data.error = "Unknown operation."
             if hasattr(node, "_crdt"):
+                node._crdt["data"]["meta"] = {}
                 node._crdt["data"]["error"] = "Unknown operation."
     return ws
 

lynxkite-core/tests/test_ops.py

@@ -9,12 +9,12 @@ def test_op_decorator_no_params_no_types_default_positions():
         return a + b
 
     assert add.__op__.name == "add"
-    assert add.__op__.params == {}
-    assert add.__op__.inputs == {
-        "a": ops.Input(name="a", type=inspect._empty, position="left"),
-        "b": ops.Input(name="b", type=inspect._empty, position="left"),
-    }
-    assert add.__op__.outputs == {"result": ops.Output(name="result", type=None, position="right")}
+    assert add.__op__.params == []
+    assert add.__op__.inputs == [
+        ops.Input(name="a", type=inspect._empty, position="left"),
+        ops.Input(name="b", type=inspect._empty, position="left"),
+    ]
+    assert add.__op__.outputs == [ops.Output(name="result", type=None, position="right")]
     assert add.__op__.type == "basic"
     assert ops.CATALOGS["test"]["add"] == add.__op__
 
@@ -27,12 +27,12 @@ def test_op_decorator_custom_positions():
         return a + b
 
     assert add.__op__.name == "add"
-    assert add.__op__.params == {}
-    assert add.__op__.inputs == {
-        "a": ops.Input(name="a", type=inspect._empty, position="right"),
-        "b": ops.Input(name="b", type=inspect._empty, position="top"),
-    }
-    assert add.__op__.outputs == {"result": ops.Output(name="result", type=None, position="bottom")}
+    assert add.__op__.params == []
+    assert add.__op__.inputs == [
+        ops.Input(name="a", type=inspect._empty, position="right"),
+        ops.Input(name="b", type=inspect._empty, position="top"),
+    ]
+    assert add.__op__.outputs == [ops.Output(name="result", type=None, position="bottom")]
     assert add.__op__.type == "basic"
     assert ops.CATALOGS["test"]["add"] == add.__op__
 
@@ -43,16 +43,12 @@ def test_op_decorator_with_params_and_types_():
         return a * b
 
     assert multiply.__op__.name == "multiply"
-    assert multiply.__op__.params == {
-        "param": ops.Parameter(name="param", default="param", type=str)
-    }
-    assert multiply.__op__.inputs == {
-        "a": ops.Input(name="a", type=int, position="left"),
-        "b": ops.Input(name="b", type=float, position="left"),
-    }
-    assert multiply.__op__.outputs == {
-        "result": ops.Output(name="result", type=None, position="right")
-    }
+    assert multiply.__op__.params == [ops.Parameter(name="param", default="param", type=str)]
+    assert multiply.__op__.inputs == [
+        ops.Input(name="a", type=int, position="left"),
+        ops.Input(name="b", type=float, position="left"),
+    ]
+    assert multiply.__op__.outputs == [ops.Output(name="result", type=None, position="right")]
     assert multiply.__op__.type == "basic"
     assert ops.CATALOGS["test"]["multiply"] == multiply.__op__
 
@@ -68,16 +64,14 @@ def test_op_decorator_with_complex_types():
         return color.name
 
     assert complex_op.__op__.name == "color_op"
-    assert complex_op.__op__.params == {}
-    assert complex_op.__op__.inputs == {
-        "color": ops.Input(name="color", type=Color, position="left"),
-        "color_list": ops.Input(name="color_list", type=list[Color], position="left"),
-        "color_dict": ops.Input(name="color_dict", type=dict[str, Color], position="left"),
-    }
+    assert complex_op.__op__.params == []
+    assert complex_op.__op__.inputs == [
+        ops.Input(name="color", type=Color, position="left"),
+        ops.Input(name="color_list", type=list[Color], position="left"),
+        ops.Input(name="color_dict", type=dict[str, Color], position="left"),
+    ]
     assert complex_op.__op__.type == "basic"
-    assert complex_op.__op__.outputs == {
-        "result": ops.Output(name="result", type=None, position="right")
-    }
+    assert complex_op.__op__.outputs == [ops.Output(name="result", type=None, position="right")]
     assert ops.CATALOGS["test"]["color_op"] == complex_op.__op__
 
 

lynxkite-graph-analytics/src/lynxkite_graph_analytics/core.py

@@ -150,7 +150,7 @@ def disambiguate_edges(ws: workspace.Workspace):
     for edge in reversed(ws.edges):
         dst_node = nodes[edge.target]
         op = catalog.get(dst_node.data.title)
-        if op.inputs[edge.targetHandle].type == list[Bundle]:
+        if op.get_input(edge.targetHandle).type == list[Bundle]:
             # Takes multiple bundles as an input. No need to disambiguate.
             continue
         if (edge.target, edge.targetHandle) in seen:
@@ -201,7 +201,7 @@ async def _execute_node(node, ws, catalog, outputs):
     # Convert inputs types to match operation signature.
     try:
         inputs = []
-        for p in op.inputs.values():
+        for p in op.inputs:
             if p.name not in input_map:
                 node.publish_error(f"Missing input: {p.name}")
                 return

lynxkite-graph-analytics/src/lynxkite_graph_analytics/lynxkite_ops.py

@@ -29,8 +29,8 @@ class FileFormat(enum.StrEnum):
 
 @op(
     "Import file",
-    params={
-        "file_format": ops.ParameterGroup(
+    params=[
+        ops.ParameterGroup(
             name="file_format",
             selector=ops.Parameter(name="file_format", type=FileFormat, default=FileFormat.csv),
             groups={
@@ -44,7 +44,7 @@ class FileFormat(enum.StrEnum):
             },
             default=FileFormat.csv,
         ),
-    },
+    ],
 )
 def import_file(
     *, file_path: str, table_name: str, file_format: FileFormat, **kwargs

lynxkite-graph-analytics/src/lynxkite_graph_analytics/networkx_ops.py

@@ -201,18 +201,19 @@ def _get_params(func) -> dict | None:
             types[k] = param.annotation
         if k in ["i", "j", "n"]:
             types[k] = int
-    params = {}
+    params = []
     for name, param in sig.parameters.items():
         _type = types.get(name, _UNSUPPORTED)
         if _type is _UNSUPPORTED:
             raise UnsupportedParameterType(name)
         if _type is _SKIP or _type in [nx.Graph, nx.DiGraph]:
             continue
-        params[name] = ops.Parameter.basic(
+        p = ops.Parameter.basic(
             name=name,
             default=str(param.default) if type(param.default) in [str, int, float] else None,
             type=_type,
         )
+        params.append(p)
     return params
 
 
@@ -252,7 +253,7 @@ def register_networkx(env: str):
                 params = _get_params(func)
             except UnsupportedParameterType:
                 continue
-            inputs = {k: ops.Input(name=k, type=nx.Graph) for k in func.graphs}
+            inputs = [ops.Input(name=k, type=nx.Graph) for k in func.graphs]
             nicename = "NX › " + name.replace("_", " ").title()
             for a, b in _REPLACEMENTS:
                 nicename = nicename.replace(a, b)
@@ -261,7 +262,7 @@ def register_networkx(env: str):
                 name=nicename,
                 params=params,
                 inputs=inputs,
-                outputs={"output": ops.Output(name="output", type=nx.Graph)},
+                outputs=[ops.Output(name="output", type=nx.Graph)],
                 type="basic",
             )
             cat[nicename] = op

lynxkite-graph-analytics/src/lynxkite_graph_analytics/pytorch/pytorch_core.py

@@ -20,9 +20,9 @@ def op(name, weights=False, **kwargs):
     def decorator(func):
         _op(func)
         op = func.__op__
-        for p in op.inputs.values():
+        for p in op.inputs:
             p.position = "bottom"
-        for p in op.outputs.values():
+        for p in op.outputs:
             p.position = "top"
         return func
 
@@ -302,8 +302,8 @@ class ModelBuilder:
 
     def run_op(self, node_id: str, op: ops.Op, params) -> Layer:
         """Returns the layer produced by this op."""
-        inputs = [_to_id(*i) for n in op.inputs for i in self.in_edges[node_id][n]]
-        outputs = [_to_id(node_id, n) for n in op.outputs]
+        inputs = [_to_id(*i) for n in op.inputs for i in self.in_edges[node_id][n.name]]
+        outputs = [_to_id(node_id, n.name) for n in op.outputs]
         if op.func == ops.no_op:
             module = torch.nn.Identity()
         else:

lynxkite-graph-analytics/src/lynxkite_graph_analytics/pytorch/pytorch_ops.py

@@ -150,9 +150,9 @@ ops.register_passive_op(
 
 def _set_handle_positions(op):
     op: ops.Op = op.__op__
-    for v in op.outputs.values():
+    for v in op.outputs:
         v.position = "top"
-    for v in op.inputs.values():
+    for v in op.inputs:
         v.position = "bottom"